| Revision as of 17:26, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 432146328 of page 2-Methylacetoacetyl-CoA for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 18:41, 14 June 2024 edit KormiSK (talk | contribs)Extended confirmed users923 editsmNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 401768115 |
|
| verifiedrevid = 477214420 |
|
|ImageFile=2-methylaceto-acetyl-CoA.png |
|
| ImageFile=2-methylaceto-acetyl-CoA.png |
|
|ImageSize=250px |
|
| ImageSize=250px |
|
|IUPACName= <small>''S''-methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 2-methyl-3-oxobutanethioate</small> |
|
|
|
| IUPACName=3′-''O''-Phosphonoadenosine 5′-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl dihydrogen diphosphate] |
| ⚫ |
|OtherNames= |
|
|
|
| SystematicName=''O''<sup>1</sup>-<nowiki/>{methyl} ''O''<sup>3</sup>-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 17216071 |
|
| ChemSpiderID = 17216071 |
|
| InChI1 = 1/C26H42N7O18P3S/c1-13(14(2)34)25(39)55-8-7-28-16(35)5-6-29-23(38)20(37)26(3,4)10-48-54(45,46)51-53(43,44)47-9-15-19(50-52(40,41)42)18(36)24(49-15)33-12-32-17-21(27)30-11-31-22(17)33/h11-13,15,18-20,24,36-37H,5-10H2,1-4H3,(H,28,35)(H,29,38)(H,43,44)(H,45,46)(H2,27,30,31)(H2,40,41,42)/t13?,15-,18-,19-,20-,24-/m1/s1 |
|
| InChI1 = 1/C26H42N7O18P3S/c1-13(14(2)34)25(39)55-8-7-28-16(35)5-6-29-23(38)20(37)26(3,4)10-48-54(45,46)51-53(43,44)47-9-15-19(50-52(40,41)42)18(36)24(49-15)33-12-32-17-21(27)30-11-31-22(17)33/h11-13,15,18-20,24,36-37H,5-10H2,1-4H3,(H,28,35)(H,29,38)(H,43,44)(H,45,46)(H2,27,30,31)(H2,40,41,42)/t13?,15-,18-,19-,20-,24-/m1/s1 |
| Line 15: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NHNODHRSCRALBF-JGCWONBBSA-N |
|
| StdInChIKey = NHNODHRSCRALBF-JGCWONBBSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 6712-01-2 --> |
|
|
|
| CASNo=6712-01-2 |
|
| PubChem=53 |
|
| PubChem=53 |
|
| SMILES = CC(=O)C(C)C(=O)SCCNC(=O)CCNC(=O)(O)C(C)(C)COP(O)(=O)OP(O)(=O)OC3O(n2cnc1c(N)ncnc12)(O)3OP(O)(O)=O |
|
| SMILES = CC(=O)(C)C(=O)SCCNC(=O)CCNC(=O)(O)C(C)(C)COP(O)(=O)OP(O)(=O)OC3O(n2cnc1c(N)ncnc12)(O)3OP(O)(O)=O |
|
| MeSHName=2-methylacetoacetyl-coenzyme+A |
|
| MeSHName=2-methylacetoacetyl-coenzyme+A |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>26</sub>H<sub>42</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S |
|
| Formula=C<sub>26</sub>H<sub>42</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S |
|
| MolarMass=865.63 g/mol |
|
| MolarMass=865.63 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2-Methylacetoacetyl-CoA''' is an intermediate in the metabolism of ]. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{organic-compound-stub}} |
|
|
|
|
|
{{DEFAULTSORT:Methylacetoacetyl-CoA, 2-}} |
|
|
] |