| Revision as of 14:12, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 22:52, 1 February 2024 edit undoShinkolobwe (talk | contribs)Extended confirmed users, Pending changes reviewers18,762 edits Changing short description from "Biomarker of faecal contamination" to "Biomarker of agricultural faecal contamination"Tag: Shortdesc helper |
| (14 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Biomarker of agricultural faecal contamination}} |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
|
{{More citations needed|date=November 2022}} |
|
{{Chembox |
|
{{Chembox |
|
| verifiedrevid = 377857752 |
|
| verifiedrevid = 428757793 |
|
| ImageFile = 24-ethylcoprostanol.png |
|
| ImageFile = 24-ethylcoprostanol.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = |
|
| IUPACName = 5β-Stigmastan-3β-ol |
|
|
| SystematicName = (1''R'',3a''S'',3b''R'',5a''R'',7''S'',9a''S'',9b''S'',11a''R'')-1--9a,11a-dimethylhexadecahydro-1''H''-cyclopentaphenanthren-7-ol |
|
| OtherNames = (3β,5β)-Stigmastan-3-ol,<br>5β-Stigmastan-3b-ol,<br>(24''R'')-Ethylcoprostanol,<br>24a-Ethylcoprostanol,<br>Copro-β-sitostanol,<br>Coprostigmastanol |
|
| OtherNames = (3β,5β)-Stigmastan-3-ol,<br>(24''R'')-Ethylcoprostanol,<br>24a-Ethylcoprostanol,<br>Copro-β-sitostanol,<br>Coprostigmastanol |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo = 4736-91-8 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = WW368UVU6Y |
| ⚫ |
| SMILES = O1CC2(C)(CC3()()2CC4(C)()3CC()4(CCC(CC)C(C)C)C)()C1 |
|
|
⚫ |
| CASNo = 4736-91-8 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| PubChem = 57461357 |
|
|
| ChEBI = 133627 |
|
|
| ChemSpiderID = 57566566 |
|
⚫ |
| SMILES = O1CC2(C)(CC3()()2CC4(C)()3CC()4(CCC(CC)C(C)C)C)()C1 |
|
|
| StdInChI = 1S/C29H52O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h19-27,30H,7-18H2,1-6H3/t20-,21?,22-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
|
|
| StdInChIKey = LGJMUZUPVCAVPU-OKGOGUTDSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>29</sub>H<sub>52</sub>O |
|
| Formula = C<sub>29</sub>H<sub>52</sub>O |
|
| MolarMass = 416.72 |
|
| MolarMass = 416.72 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''24-Ethyl coprostanol''' (24-ethyl 5β-cholestan-3β-ol) is a 29 ] ] formed from the ] of ] (24-ethyl cholest-5en-3β-ol, 24-ethyl cholesterol) in the ] of most higher animals, especially herbivores. This compound has been used as a ] for the presence of agricultural (non-human) ] matter in the ]. |
|
'''24-Ethyl coprostanol''' (24-ethyl 5β-cholestan-3β-ol) is a 29 ] ] formed from the ] of ] (24-ethyl cholest-5en-3β-ol, 24-ethyl cholesterol) in the ] of most higher animals, especially herbivores.<ref>{{Cite web |title=24-Ethyl coprostanol {{!}} C29H52O {{!}} ChemSpider |url=http://www.chemspider.com/Chemical-Structure.57566566.html |access-date=2022-11-15 |website=www.chemspider.com}}</ref> This compound has been used as a ] for the presence of agricultural (non-human) ] matter in nature. |
|
|
|
| ⚫ |
{{DEFAULTSORT:Ethyl Coprostanol, 24-}} |
|
| ⚫ |
] |
|
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{steroid-stub}} |
|
{{steroid-stub}} |
|
|
|
|
⚫ |
{{DEFAULTSORT:Ethyl Coprostanol, 24-}} |
|
⚫ |
] |