| Revision as of 17:52, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 433687219 of page 3-Hydroxyisobutyryl-CoA for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 05:28, 8 May 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits fix mistake, add semisystematic nameTag: nowiki added |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 401772366 |
|
| verifiedrevid = 477218851 |
|
|ImageFile=3-Hydroxyisobutyryl-CoA.png |
|
| ImageFile=3-Hydroxyisobutyryl-CoA.png |
|
|ImageSize=250px |
|
| ImageSize=250px |
|
|
| IUPACName=3′-''O''-Phosphonoadenosine 5′-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl dihydrogen diphosphate] |
|
|IUPACName= <small>''S''-[2-[3-<nowiki>[[</nowiki>4-<nowiki>[[[</nowiki>(2''R'',3''S'',4''R'',5''R'')- |
|
|
|
| SystematicName=''O''<sup>1</sup>-<nowiki/>{methyl} ''O''<sup>3</sup>-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate |
|
5-(6-Aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] |
|
|
⚫ |
| OtherNames= |
|
oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 3-hydroxy-2-methylpropanethioate</small> |
|
| ⚫ |
|OtherNames= |
|
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo = 319440-43-2 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| CASNo_Ref = {{Cascite|changed|CAS}} |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 389192 |
|
| ChemSpiderID = 389192 |
|
| InChI1 = 1/C25H42N7O18P3S/c1-13(8-33)24(38)54-7-6-27-15(34)4-5-28-22(37)19(36)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-18(49-51(39,40)41)17(35)23(48-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-14,17-19,23,33,35-36H,4-10H2,1-3H3,(H,27,34)(H,28,37)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t13?,14-,17-,18-,19?,23-/m1/s1 |
|
| InChI1 = 1/C25H42N7O18P3S/c1-13(8-33)24(38)54-7-6-27-15(34)4-5-28-22(37)19(36)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-18(49-51(39,40)41)17(35)23(48-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-14,17-19,23,33,35-36H,4-10H2,1-3H3,(H,27,34)(H,28,37)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t13?,14-,17-,18-,19?,23-/m1/s1 |
| Line 17: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WWEOGFZEFHPUAM-VRQRJWBYSA-N |
|
| StdInChIKey = WWEOGFZEFHPUAM-VRQRJWBYSA-N |
|
⚫ |
| PubChem=440205 |
|
| CASNo= |
|
|
⚫ |
| SMILES = O=C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3OP(=O)(O)O)C(C)CO |
| ⚫ |
| PubChem=440205 |
|
| ⚫ |
| SMILES = O=C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3OP(=O)(O)O)C(C)CO |
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>25</sub>H<sub>42</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S |
|
| Formula=C<sub>25</sub>H<sub>42</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S |
|
| MolarMass=853.62 g/mol |
|
| MolarMass=853.62 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3-Hydroxyisobutyryl-CoA''' (or '''3-hydroxy-2-methylpropanoyl-CoA''') is an intermediate in the metabolism of ]. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Hydroxyisobutyryl-CoA, 3-}} |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |