| Revision as of 18:14, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 458310197 of page 4-HO-MPT for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 18:48, 27 August 2023 edit Onel5969 (talk | contribs)Autopatrolled, Extended confirmed users, Page movers, New page reviewers, Pending changes reviewers, Rollbackers937,061 editsm Disambiguating links to Homology (link changed to Homologous series) using DisamAssist. |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 445928330 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = 4-HO-MPT.png |
|
|
⚫ |
| verifiedrevid = 477222052 |
| ⚫ |
| ImageSize = 120px |
|
|
⚫ |
| ImageFile = 4-HO-MPT.svg |
| ⚫ |
| IUPACName = 3-{2-ethyl}-1''H''-indol-4-ol |
|
|
⚫ |
| ImageSize = |
|
⚫ |
| PIN = 3-{2-ethyl}-1''H''-indol-4-ol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10513074 |
|
| ChemSpiderID = 10513074 |
|
| InChI = 1/C14H20N2O/c1-3-8-16(2)9-7-11-10-15-12-5-4-6-13(17)14(11)12/h4-6,10,15,17H,3,7-9H2,1-2H3 |
|
| InChI = 1S/C14H20N2O/c1-3-8-16(2)9-7-11-10-15-12-5-4-6-13(17)14(11)12/h4-6,10,15,17H,3,7-9H2,1-2H3 |
|
| InChIKey = XFQDDPQGBLSNCN-UHFFFAOYAC |
|
| InChIKey = XFQDDPQGBLSNCN-UHFFFAOYAC |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 15: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XFQDDPQGBLSNCN-UHFFFAOYSA-N |
|
| StdInChIKey = XFQDDPQGBLSNCN-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = |
|
| CASNo = 763035-03-6 |
|
|
| CASNo_Comment = (]) |
| ⚫ |
| PubChem = |
|
|
|
| CASNo1_Ref = {{cascite|changed|??}} |
|
| SMILES = CCCN(C)CCc2cnc1cccc(O)c12 |
|
|
|
| CASNo1 = 77872-42-5 |
|
|
| CASNo1_Comment = (]) |
|
⚫ |
| PubChem = 21786584 |
|
|
| UNII = 37A55H0XW4 |
|
|
| SMILES = OC1=CC=CC2=C1C(CCN(C)CCC)=CN2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>14</sub>H<sub>20</sub>N<sub>2</sub>O |
|
| Formula = |
|
|
| C=14 | H=20 | N=2 | O=1 |
|
| MolarMass = |
|
| MolarMass = |
|
| Appearance = |
|
| Appearance = |
| Line 28: |
Line 35: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''4-Hydroxy-''N''-methyl-''N''-propyltryptamine''', commonly known as '''4-HO-MPT''' or '''meprocin''', is a ] in the ] class of ]s and is a higher ] of the naturally occurring substituted tryptamine ] as well as being the 4-] ] of ]. |
|
|
|
|
|
==History== |
|
|
4-HO-MPT was first synthesized and ]ed by ] ] and written about in his 1994 book '']''.<ref name="TiHKAL"></ref> |
|
|
|
|
|
==Dosage and duration== |
|
|
For psychedelic effects, the dosage and duration are listed as "unknown" in TiHKAL.<ref name="TiHKAL" /> |
|
|
|
|
|
==Effects== |
|
|
Very little data exists about the pharmacological properties, metabolism, and toxicity of 4-HO-MPT. In a single trial of 8 mg orally of 4-HO-MPT HCl from TiHKAL, it is described as producing visual distortion, ], and slight ].<ref name="TiHKAL" /> |
|
|
|
|
|
==Legal status== |
|
|
4-HO-MPT is not scheduled by the ]' ].<ref name="UNCPS">{{Cite web |url=https://www.unodc.org/unodc/en/commissions/CND/conventions.html |title=Convention on Psychotropic Substances, 1971 |access-date=2016-06-10 |archive-date=2022-01-19 |archive-url=https://web.archive.org/web/20220119014500/http://www.unodc.org/unodc/en/commissions/CND/conventions.html |url-status=dead }}</ref> |
|
|
|
|
|
===United States=== |
|
|
4-HO-MPT is not ] at the ] in the ],<ref name="PART 1308 — SCHEDULES OF CONTROLLED SUBSTANCES - 1308.11 Schedule I">{{Cite web |url=http://www.deadiversion.usdoj.gov/21cfr/cfr/1308/1308_11.htm |title=§1308.11 Schedule I. |access-date=2016-06-10 |archive-date=2009-08-27 |archive-url=https://web.archive.org/web/20090827043725/http://www.deadiversion.usdoj.gov/21cfr/cfr/1308/1308_11.htm |url-status=dead }}</ref> but it is possible that 4-HO-MPT could legally be considered an ] of ], in which case, sales or ] with intent for human consumption could potentially be prosecuted under the ].<ref></ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
* |
|
|
|
|
|
{{Tryptamines}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |