| Revision as of 18:17, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444773967 of page 4-Maleylacetoacetate for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 09:58, 19 July 2024 edit M97uzivatel (talk | contribs)Extended confirmed users6,578 edits →top |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443354260 |
|
| verifiedrevid = 477222438 |
|
|ImageFile=4-maleylacetoacetic acid.svg |
|
| ImageFile = 4-maleylacetoacetic acid.svg |
|
|ImageSize= |
|
| ImageSize = |
|
|IUPACName=(Z)-4,6-dioxooct-2-enedioic acid |
|
| PIN = (2''Z'')-4,6-Dioxooct-2-enedioic acid |
|
|OtherNames= |
|
|
|
| OtherNames = 4-Maleylacetoacetate |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C01036 |
|
| KEGG = C01036 |
|
| InChI = 1/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1- |
|
| InChI = 1/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1- |
| Line 15: |
Line 15: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = GACSIVHAIFQKTC-UPHRSURJSA-N |
|
| StdInChIKey = GACSIVHAIFQKTC-UPHRSURJSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 5698-52-2 --> |
|
|
|
| CASNo = 5698-52-2 |
| ⚫ |
| PubChem=5280393 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5ET93TW8TE |
|
⚫ |
| PubChem = 5280393 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1743220 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 47904 |
|
| ChEBI = 47904 |
|
| SMILES = O=C(/C=C\C(=O)O)CC(=O)CC(=O)O |
|
| SMILES = O=C(/C=C\C(=O)O)CC(=O)CC(=O)O |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4444078 |
|
| ChemSpiderID = 4444078 |
| ⚫ |
}} |
|
| ⚫ |
|Section2= {{Chembox Properties |
|
|
| Formula=C<sub>8</sub>H<sub>8</sub>O<sub>6</sub> |
|
|
| MolarMass=200.146 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
| ⚫ |
}} |
|
|
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
|
| C=8 | H=8 | O=6 |
|
⚫ |
}} |
|
⚫ |
}} |
|
|
|
|
|
'''4-Maleylacetoacetate''' ('''4-maleylacetoacetatic acid''') is an intermediate in the metabolism of ]. It is converted to ] by the ] ]. ] coenzymatically helps in conversion to fumarylacetoacetic acid. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Maleylacetoacetic acid, 4-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{alkene-stub}} |
|
|
{{biochem-stub}} |