| Revision as of 18:24, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 426422969 of page 5,10-Methenyltetrahydrofolate for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 10:11, 31 December 2024 edit YuniToumei (talk | contribs)Extended confirmed users1,943 edits add hatnote: distinguish from 5,10-Methylenetetrahydrofolate based on similar names |
| Line 1: |
Line 1: |
|
|
{{distinguish|5,10-Methylenetetrahydrofolate}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 408391878 |
|
| verifiedrevid = 477223671 |
|
|ImageFile=5,10-Methenyltetrahydrofolate.svg |
|
| ImageFile=5,10-Methenyltetrahydrofolate.svg |
|
|ImageSize= |
|
| ImageSize=260 |
|
⚫ |
| ImageAlt = Skeletal formula of 5,10-methenyltetrahydrofolate |
| ⚫ |
|IUPACName= ''N''-pteridin-10-ium-8-yl)benzoyl]-<small>L</small>-glutamic acid |
|
|
|
| ImageFile1 = 5,10-Methenyltetrahydrofolate-cation-3D-spacefill.png |
| ⚫ |
|OtherNames= 5,10-CH=THF |
|
|
|
| ImageSize1 = 250 |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Space-filling model of the 5,10-methenyltetrahydrofolate cation |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| IUPACName= ''N''-pteridin-10-ium-8-yl)benzoyl]-<small>L</small>-glutamic acid |
|
⚫ |
| OtherNames= 5,10-CH=THF |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 133 |
|
| ChemSpiderID = 133 |
|
| InChI = 1/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p+1 |
|
| InChI = 1/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p+1 |
| Line 18: |
Line 23: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MEANFMOQMXYMCT-UHFFFAOYSA-O |
|
| StdInChIKey = MEANFMOQMXYMCT-UHFFFAOYSA-O |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 7444-29-3 --> |
|
|
|
| CASNo=7444-29-3 |
|
| PubChem=644350 |
|
| PubChem=644350 |
|
| SMILES = O=C(O)C(NC(=O)c1ccc(cc1)N4/C=3/C2=C(/N\C(=N/C2=O)N)NCC3C4)CCC(=O)O |
|
| SMILES = O=C(O)C(NC(=O)c1ccc(cc1)N4/C=3/C2=C(/N\C(=N/C2=O)N)NCC3C4)CCC(=O)O |
| ⚫ |
| MeSHName=5,10-methenyltetrahydrofolate |
|
|
|
| MeSHName=5,10-methenyltetrahydrofolate |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>20</sub>H<sub>213</sub>N<sub>7</sub>O<sub>6</sub> |
|
| Formula=C<sub>20</sub>H<sub>21</sub>N<sub>7</sub>O<sub>6</sub> |
|
| MolarMass=455.42 g/mol |
|
| MolarMass=455.42 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''5,10-Methenyltetrahydrofolate''' ('''5,10-CH=THF''') is a form of ] that is an intermediate in ]. 5,10-CH=THF is a ] that accepts and donates methenyl (CH=) groups. |
|
|
|
|
|
It is produced from ] by either a ], or a ].<ref>{{cite journal |author=Fowler B |title=The folate cycle and disease in humans |journal=Kidney Int. Suppl. |volume=78 |pages=S221–9 |date=February 2001 |pmid=11169015 |doi=10.1046/j.1523-1755.2001.07851.x}}</ref> It can also be produced as an intermediate in ] catabolism, by ], from ]. |
|
|
|
|
|
5,10-CH=THF is a substrate for ], which converts it into ]. |
|
|
|
|
|
== Interactive pathway map == |
|
|
{{FluoropyrimidineActivity WP1601|highlight=5,10-Methenyltetrahydrofolate}} |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Methenyltetrahydrofolate, 5,10-}} |
|
|
] |
|
|
] |