| Revision as of 09:16, 17 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 14:59, 27 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (17 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 401006236 |
|
| verifiedrevid = 445301901 |
|
| ImageFile = Trimethoxyflavan.png |
|
| ImageFile = Trimethoxyflavan.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 5,7-Dimethoxy-2-(4-methoxy-phenyl)-chroman |
|
|
|
| IUPACName = 4′,5,7-Trimethoxyflavan |
|
| OtherNames = |
|
|
|
| SystematicName = 5,7-Dimethoxy-2-(4-methoxyphenyl)-3,4-dihydro-2''H''-1-benzopyran |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo = 4225-32-5 |
|
| OtherNames = |
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem = |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| SMILES = c(C(C3)Oc(c2C3)cc(OC)cc2OC)(c1)ccc(OC)c1 |
|
|
|
| CASNo = 4225-32-5 |
|
|
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
|
|
| UNII = XU599Q9S7C |
|
|
| ChemSpiderID = 10554881 |
|
⚫ |
| PubChem = 21813969 |
|
⚫ |
| SMILES = c(C(C3)Oc(c2C3)cc(OC)cc2OC)(c1)ccc(OC)c1 |
|
|
| StdInChI=1S/C18H20O4/c1-19-13-6-4-12(5-7-13)16-9-8-15-17(21-3)10-14(20-2)11-18(15)22-16/h4-7,10-11,16H,8-9H2,1-3H3 |
|
|
| StdInChIKey = NODOVAFZWHOGIU-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>18</sub>H<sub>20</sub>O<sub>4</sub> |
|
| Formula = C<sub>18</sub>H<sub>20</sub>O<sub>4</sub> |
|
| MolarMass = 300.34 g/mol |
|
| MolarMass = 300.34 g/mol |
|
|
| Appearance = |
|
| ExactMass = 300.136159 |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
'''5,7,4'-Trimethoxyflavan''' is a ], a type of flavonoid. It can be found in '']''.<ref>{{cite journal | url = http://www.publish.csiro.au/paper/CH9740331.htm | title = Some Constituents of the Resins of Xanthorrhoea preissii, australis and hastile | author = AJ Birch and CJ Dahl | journal = Australian Journal of Chemistry | volume = 27 | issue = 2 | pages = 331–334}}</ref> |
|
'''5,7,4'-Trimethoxyflavan''' is a ], a type of flavonoid. It can be found in '']''.<ref>{{cite journal | url = http://www.publish.csiro.au/paper/CH9740331.htm | title = Some Constituents of the Resins of Xanthorrhoea preissii, australis and hastile | author = AJ Birch and CJ Dahl | journal = Australian Journal of Chemistry | volume = 27 | issue = 2 | pages = 331–334 | doi=10.1071/ch9740331| year = 1974 }}</ref> |
|
|
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
== External links == |
|
* |
|
*{{cite web |url= http://metabolomics.jp/FL6FDBNS0001 |title=5,7,4'-Trimethoxyflavan |first= |last= |work=metabolomics.jp |year=2008 |publisher=}} |
|
|
|
|
|
{{Flavan}} |
|
{{Flavan}} |
|
|
|
|
|
{{DEFAULTSORT:Trimethoxyflavan, 5,7,4'-}} |
|
{{DEFAULTSORT:Trimethoxyflavan, 5,7,4'-}} |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{aromatic-stub}} |