Revision as of 18:27, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 467652880 of page 5-Benzyloxytryptamine for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 17:22, 12 June 2024 edit Augmented Seventh (talk | contribs)Extended confirmed users13,336 edits →Legality: unsourcedTags: Manual revert Mobile edit Mobile web edit Advanced mobile edit |
Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 451561330 |
|
| verifiedrevid = 477224082 |
|
| IUPAC_name = 2-(5-phenylmethoxy-1''H''-indol-3-yl)ethanamine |
|
| IUPAC_name = 2-(5-phenylmethoxy-1''H''-indol-3-yl)ethanamine |
|
| image = 5-benzyloxytryptamine.png |
|
| image = 5-benzyloxytryptamine.png |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|??|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = 20776-45-8 |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 20776-45-8 --> |
|
|
| PubChem = 89576 |
|
| PubChem = 89576 |
|
| IUPHAR_ligand = |
|
| IUPHAR_ligand = 265 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 80845 |
|
| ChemSpiderID = 80845 |
|
|
| legal_status = Illegal in Singapore |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=18 | N=2 | O=1 |
|
| C=17 | H=18 | N=2 | O=1 |
|
| molecular_weight = 266.34 g/mol |
|
|
| smiles = NCCC1=CNC2=CC=C(OCC3=CC=CC=C3)C=C21 |
|
| smiles = NCCC1=CNC2=CC=C(OCC3=CC=CC=C3)C=C21 |
|
| InChI = 1/C17H18N2O/c18-9-8-14-11-19-17-7-6-15(10-16(14)17)20-12-13-4-2-1-3-5-13/h1-7,10-11,19H,8-9,12,18H2 |
|
|
| InChIKey = |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H18N2O/c18-9-8-14-11-19-17-7-6-15(10-16(14)17)20-12-13-4-2-1-3-5-13/h1-7,10-11,19H,8-9,12,18H2 |
|
| StdInChI = 1S/C17H18N2O/c18-9-8-14-11-19-17-7-6-15(10-16(14)17)20-12-13-4-2-1-3-5-13/h1-7,10-11,19H,8-9,12,18H2 |
Line 28: |
Line 23: |
|
| StdInChIKey = WKPDXBXNJWWWGQ-UHFFFAOYSA-N |
|
| StdInChIKey = WKPDXBXNJWWWGQ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''5-Benzyloxytryptamine''' ('''5-BT'''), is a ] ] which acts as an ] at the ], ] and ] ] ],<ref name="pmid3350047">{{cite journal | vauthors = Lyon RA, Titeler M, Seggel MR, Glennon RA | title = Indolealkylamine analogs share 5-HT2 binding characteristics with phenylalkylamine hallucinogens | journal = European Journal of Pharmacology | volume = 145 | issue = 3 | pages = 291–297 | date = January 1988 | pmid = 3350047 | doi = 10.1016/0014-2999(88)90432-3 }}</ref><ref name="pmid1650872">{{cite journal | vauthors = Peroutka SJ, McCarthy BG, Guan XM | title = 5-benzyloxytryptamine: a relatively selective 5-hydroxytryptamine 1D/1B agent | journal = Life Sciences | volume = 49 | issue = 6 | pages = 409–418 | year = 1991 | pmid = 1650872 | doi = 10.1016/0024-3205(91)90582-V | doi-access = free }}</ref><ref name="pmid1319907">{{cite journal | vauthors = Cohen ML, Schenck K, Nelson D, Robertson DW | title = Sumatriptan and 5-benzyloxytryptamine: contractility of two 5-HT1D receptor ligands in canine saphenous veins | journal = European Journal of Pharmacology | volume = 211 | issue = 1 | pages = 43–46 | date = January 1992 | pmid = 1319907 | doi = 10.1016/0014-2999(92)90260-B }}</ref><ref name="pmid9225298">{{cite journal | vauthors = Boess FG, Monsma FJ, Carolo C, Meyer V, Rudler A, Zwingelstein C, Sleight AJ | title = Functional and radioligand binding characterization of rat 5-HT6 receptors stably expressed in HEK293 cells | journal = Neuropharmacology | volume = 36 | issue = 4–5 | pages = 713–720 | year = 1997 | pmid = 9225298 | doi = 10.1016/S0028-3908(97)00019-1 | s2cid = 41813873 }}</ref> and an antagonist of ].<ref>{{cite journal | vauthors = DeFalco J, Steiger D, Dourado M, Emerling D, Duncton MA | title = 5-benzyloxytryptamine as an antagonist of TRPM8 | journal = Bioorganic & Medicinal Chemistry Letters | volume = 20 | issue = 23 | pages = 7076–7079 | date = December 2010 | pmid = 20965726 | doi = 10.1016/j.bmcl.2010.09.099 }}</ref> |
|
|
|
|
|
==Legality== |
|
|
5-Benzyloxytryptamine is illegal in Singapore.<ref>{{cite web|title=Misuse of Drugs Act - Singapore Statutes Online|url=https://sso.agc.gov.sg/Act/MDA1973|website=sso.agc.gov.sg}}</ref> |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Serotonin receptor modulators}} |
|
|
{{Tryptamines}} |
|
|
|
|
|
{{DEFAULTSORT:Benzyloxytryptamine, 5-}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Nervous-system-drug-stub}} |