Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 5-Iodowillardiine: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 18:31, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444676636 of page 5-Iodowillardiine for the Chem/Drugbox validation project (updated: 'CASNo').  Latest revision as of 00:36, 5 October 2023 edit IntentionallyDense (talk | contribs)Extended confirmed users, New page reviewers, Pending changes reviewers34,627 editsNo edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed
⚫ | verifiedrevid = 443655568
| Watchedfields = changed
⚫ | ImageFile = 5-Iodowillardiine.png
⚫ | verifiedrevid = 477224748
⚫ | ImageSize = 150px
⚫ | ImageFile = 5-Iodowillardiine.svg
⚫ | ImageSize = 200px
| IUPACName = (2''S'')-2-Amino-3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid | IUPACName = (2''S'')-2-Amino-3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| IUPHAR_ligand = 4071
| InChI = 1/C7H8IN3O4/c8-3-1-11(2-4(9)6(13)14)7(15)10-5(3)12/h1,4H,2,9H2,(H,13,14)(H,10,12,15)/t4-/m0/s1 | InChI = 1/C7H8IN3O4/c8-3-1-11(2-4(9)6(13)14)7(15)10-5(3)12/h1,4H,2,9H2,(H,13,14)(H,10,12,15)/t4-/m0/s1
| InChIKey = AXXYLTBQIQBTES-BYPYZUCNBL | InChIKey = AXXYLTBQIQBTES-BYPYZUCNBL
| SMILES1 = O=C(O)(N)CN1/C=C(/I)C(=O)NC1=O | SMILES1 = O=C(O)(N)CN1/C=C(/I)C(=O)NC1=O
Line 16: Line 18:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AXXYLTBQIQBTES-BYPYZUCNSA-N | StdInChIKey = AXXYLTBQIQBTES-BYPYZUCNSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 140187-25-3 --> | CASNo = 140187-25-3
| PubChem = 447196 | PubChem = 447196
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02818 | DrugBank = DB02818
| SMILES = C1=C(C(=O)NC(=O)N1C(C(=O)O)N)I | SMILES = C1=C(C(=O)NC(=O)N1C(C(=O)O)N)I
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| InChI =
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 394358 | ChemSpiderID = 394358
| MeSHName = | MeSHName =
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=7|H=8|I=1|N=3|O=4 | C=7 | H=8 | I=1 | N=3 | O=4
| MolarMass = 325.061 g/mol | MolarMass = 325.061 g/mol
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| Solubility = | MainHazards =
| MainHazards = | FlashPt =
| FlashPt = | AutoignitionPt =
| Autoignition =
}} }}
}} }}

'''5-Iodowillardiine''' is a selective ] for the ], with only limited effects at the ].<ref>{{cite journal | last1 = Patneau | first1 = DK | last2 = Mayer | first2 = ML | last3 = Jane | first3 = DE | last4 = Watkins | first4 = JC | title = Activation and desensitization of AMPA/kainate receptors by novel derivatives of willardiine | journal = Journal of Neuroscience | volume = 12 | issue = 2 | pages = 595–606 | year = 1992 | pmid = 1371315 | doi = 10.1523/jneurosci.12-02-00595.1992 | pmc = 6575614 | doi-access = free }}</ref> It is selective for kainate receptors composed of GluR5 subunits.<ref>{{cite journal | last1 = Swanson | first1 = GT | last2 = Green | first2 = T | last3 = Heinemann | first3 = SF | title = Kainate receptors exhibit differential sensitivities to (S)-5-iodowillardiine | journal = Molecular Pharmacology | volume = 53 | issue = 5 | pages = 942–9 | year = 1998 | pmid = 9584222 }}</ref><ref>{{cite journal | last1 = Cui | first1 = C | last2 = Mayer | first2 = ML | title = Heteromeric kainate receptors formed by the coassembly of GluR5, GluR6, and GluR7 | journal = Journal of Neuroscience | volume = 19 | issue = 19 | pages = 8281–91 | year = 1999 | pmid = 10493729 | doi = 10.1523/JNEUROSCI.19-19-08281.1999 | pmc = 6782997 | doi-access = free }}</ref> It is an ] ] ''in vivo'',<ref>{{cite journal | last1 = Moldrich | first1 = RX | last2 = Cheung | first2 = NS | last3 = Pascoe | first3 = CJ | last4 = Beart | first4 = PM | title = Excitotoxic injury profiles of low-affinity kainate receptor agonists in cortical neuronal cultures | journal = European Journal of Pharmacology | volume = 378 | issue = 2 | pages = R1–3 | year = 1999 | pmid = 10478637 | doi=10.1016/S0014-2999(99)00456-2}}</ref><ref>{{cite journal | last1 = Moldrich | first1 = RX | last2 = Beart | first2 = PM | last3 = Pascoe | first3 = CJ | last4 = Cheung | first4 = NS | title = Low-affinity kainate receptor agonists induce insult-dependent apoptosis and necrosis in cultured murine cortical neurons | journal = Journal of Neuroscience Research | volume = 59 | issue = 6 | pages = 788–96 | year = 2000 | pmid = 10700016 | doi = 10.1002/(SICI)1097-4547(20000315)59:6<788::AID-JNR11>3.0.CO;2-K | s2cid = 21898801 }}</ref> but has proved highly useful for characterising the subtypes and function of the various kainate receptors in the ] and ].<ref>{{cite journal | last1 = Mascias | first1 = P | last2 = Scheede | first2 = M | last3 = Bloms-Funke | first3 = P | last4 = Chizh | first4 = B | title = Modulation of spinal nociception by GluR5 kainate receptor ligands in acute and hyperalgesic states and the role of gabaergic mechanisms | journal = Neuropharmacology | volume = 43 | issue = 3 | pages = 327–39 | year = 2002 | pmid = 12243762 | doi=10.1016/S0028-3908(02)00112-0| s2cid = 29126134 }}</ref><ref>{{cite journal | last1 = Alt | first1 = A | last2 = Weiss | first2 = B | last3 = Ogden | first3 = AM | last4 = Knauss | first4 = JL | last5 = Oler | first5 = J | last6 = Ho | first6 = K | last7 = Large | first7 = TH | last8 = Bleakman | first8 = D | title = Pharmacological characterization of glutamatergic agonists and antagonists at recombinant human homomeric and heteromeric kainate receptors in vitro | journal = Neuropharmacology | volume = 46 | issue = 6 | pages = 793–806 | year = 2004 | pmid = 15033339 | doi = 10.1016/j.neuropharm.2003.11.026 | s2cid = 23514969 }}</ref><ref>{{cite journal | last1 = Jane | first1 = DE | last2 = Lodge | first2 = D | last3 = Collingridge | first3 = GL | title = Kainate receptors: pharmacology, function and therapeutic potential | journal = Neuropharmacology | volume = 56 | issue = 1 | pages = 90–113 | year = 2009 | pmid = 18793656 | doi = 10.1016/j.neuropharm.2008.08.023 | s2cid = 25291377 }}</ref>

==References==
{{reflist|30em}}

{{Ionotropic glutamate receptor modulators}}

{{DEFAULTSORT:Iodowillardiine, 5-}}
]
]
]
]
]
]

{{pharma-stub}}