| Revision as of 10:41, 11 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit |
Latest revision as of 11:24, 23 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,388 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (10 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{drugbox | verifiedrevid = 399333546 |
|
|
|
{{Drugbox |
|
| |
|
|
⚫ |
| verifiedrevid = 413277905 |
|
| IUPAC_name = 2-(5-methoxy-2-methyl-H-indol-3-yl)-N,N-dimethylethanamine |
|
| IUPAC_name = 2-(5-methoxy-2-methyl-H-indol-3-yl)-N,N-dimethylethanamine |
|
| image = 5-MeO-2,N,N-TMT.svg |
|
| image = 5-MeO-2,N,N-TMT.svg |
|
| width = 200 |
|
| width = 200 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = |
|
⚫ |
| pregnancy_US = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = |
|
⚫ |
| legal_CA = |
|
|
| legal_DE = NpSG |
|
⚫ |
| legal_UK = Class A |
|
⚫ |
| legal_US = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 67292-68-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = XZ2CCP18I2 |
|
|
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 49756 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 45143 |
|
| ChemSpiderID = 45143 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| InChI = 1/C14H20N2O/c1-10-12(7-8-16(2)3)13-9-11(17-4)5-6-14(13)15-10/h5-6,9,15H,7-8H2,1-4H3 |
|
|
| InChIKey = ACEHBQPPDDGCGZ-UHFFFAOYAA |
|
|
| smiles1 = O(c1cc2c(cc1)nc(c2CCN(C)C)C)C |
|
|
| ChEMBL = 7143 |
|
| ChEMBL = 7143 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=14 | H=20 | N=2 | O=1 |
|
⚫ |
| smiles = CC1=C(C2=C(N1)C=CC(=C2)OC)CCN(C)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H20N2O/c1-10-12(7-8-16(2)3)13-9-11(17-4)5-6-14(13)15-10/h5-6,9,15H,7-8H2,1-4H3 |
|
| StdInChI = 1S/C14H20N2O/c1-10-12(7-8-16(2)3)13-9-11(17-4)5-6-14(13)15-10/h5-6,9,15H,7-8H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ACEHBQPPDDGCGZ-UHFFFAOYSA-N |
|
| StdInChIKey = ACEHBQPPDDGCGZ-UHFFFAOYSA-N |
|
⚫ |
| melting_point = |
| ⚫ |
| CAS_number = 67292-68-6 |
|
|
| ATC_prefix = |
|
| melting_high = |
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = 49756 |
|
| ⚫ |
| C=14 | H=20 | N=2 | O=1 |
|
|
| molecular_weight = 232.321 g/mol |
|
| ⚫ |
| smiles = CC1=C(C2=C(N1)C=CC(=C2)OC)CCN(C)C |
|
| ⚫ |
| melting_point = |
|
|
| melting_high = |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = |
|
| ⚫ |
| pregnancy_US = |
|
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_AU = |
|
| ⚫ |
| legal_CA = |
|
| ⚫ |
| legal_UK = |
|
| ⚫ |
| legal_US = |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''5-Methoxy-2,''N'',''N''-trimethyltryptamine''' ('''5-MeO-2,''N'',''N''-TMT''', '''5-MeO-TMT''') is a ] of the ] ] which acts as a ]. It was first ] by ] and reported in his book ] ("Tryptamines i Have Known And Loved").<ref></ref> 5-MeO-TMT is claimed to show psychoactive effects at a dosage of 75-150 mg orally, but these are relatively mild compared to those of other similar ]s. This suggests that while the ] ] on the 2-position of the ] has impaired the ] of ] ]s like ] (MAO), it is also interfering with binding to and/or activation of the ] ] ], the target responsible for mediating the ]ic effects of such compounds. |
|
'''5-Methoxy-2,''N'',''N''-trimethyltryptamine''' ('''5-MeO-2,''N'',''N''-TMT''', '''5-MeO-TMT''') is a ] of the ] ] which acts as a ]. It was first ] by ] and reported in his book ] ("Tryptamines i Have Known And Loved").<ref></ref> 5-MeO-TMT is claimed to show psychoactive effects at a dosage of 75–150 mg orally, but these are relatively mild compared to those of other similar ]s. This suggests that while the ] ] on the 2-position of the ] has impaired the ] of ] ]s like ] (MAO), it is also interfering with binding to and/or activation of the ] ] ], the target responsible for mediating the ]ic effects of such compounds. |
|
|
|
|
|
== See also == |
|
== See also == |
| Line 54: |
Line 64: |
|
{{Tryptamines}} |
|
{{Tryptamines}} |
|
{{Hallucinogenic tryptamines}} |
|
{{Hallucinogenic tryptamines}} |
|
{{TiHKAL}} |
|
|
|
|
|
|
{{DEFAULTSORT:5-Methoxy-2,N,N-Trimethyltryptamine}} |
|
{{DEFAULTSORT:5-Methoxy-2, N, N-Trimethyltryptamine}} |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|