| Revision as of 02:37, 12 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,605 editsmNo edit summary← Previous edit |
Latest revision as of 10:07, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits added Category:4-Hydroxyphenyl compounds using HotCat |
| (24 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{Wikify|date=December 2010}} |
|
|
|
|
|
{{DISPLAYTITLE:5-''O''-Methylgenistein}} |
|
{{DISPLAYTITLE:5-''O''-Methylgenistein}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 405875267 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 423620570 |
|
| Name = 5-''O''-Methylgenistein |
|
| Name = 5-''O''-Methylgenistein |
|
| ImageFile = 5-O-methylgenistein.PNG |
|
| ImageFile = 5-O-methylgenistein.svg |
|
| ImageSize = 200px |
|
| ImageSize = 220px |
|
| ImageName = Chemical structure of 5-O-methylgenistein |
|
| ImageName = Chemical structure of 5-O-methylgenistein |
|
|
| ImageFile1 = 5-O-Methylgenistein-3D-balls.png |
| ⚫ |
| IUPACName = 7-hydroxy-3-(4-hydroxyphenyl)-5-methoxychromen-4-one |
|
|
|
| ImageSize1 = 220 |
|
| OtherNames = 7-Hydroxy-3-(4-hydroxyphenyl)-5-methoxy-4''H''-1-benzopyran-4-one<br>Isoprunetin<ref></ref> |
|
|
|
| ImageAlt1 = 5-O-Methylgenistein molecule |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| IUPACName = 4′,7-Dihydroxy-5-methoxyisoflavone |
|
⚫ |
| SystematicName = 7-Hydroxy-3-(4-hydroxyphenyl)-5-methoxy-4''H''-1-benzopyran-4-one |
|
|
| OtherNames = Isoprunetin<ref>{{cite web |url=http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00009452 |title=5-O-methylgenistein on kanaya.naist.jp/knapsack_jsp |access-date=2010-02-26 |archive-url=https://web.archive.org/web/20120226204858/http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00009452 |archive-date=2012-02-26 |url-status=dead }}</ref> |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| CASNo = 4569-98-6 |
|
| CASNo = 4569-98-6 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}}= |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = Q2UG76ML8U |
|
| PubChem = 5748551 |
|
| PubChem = 5748551 |
|
| SMILES = COC1=C2C(=CC(=C1)O)OC=C(C2=O)C3=CC=C(C=C3)O |
|
| SMILES = COC1=C2C(=CC(=C1)O)OC=C(C2=O)C3=CC=C(C=C3)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 4678012 |
|
|
| InChI = 1/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
|
|
| InChIKey = YSINCDVRUMTOPK-UHFFFAOYAD |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YSINCDVRUMTOPK-UHFFFAOYSA-N |
|
|
|
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>5</sub> |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>5</sub> |
|
| MolarMass = 284.26 g/mol |
|
| MolarMass = 284.26 g/mol |
|
| ExactMass = 284.068473 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''5-''O''-Methylgenistein''' is an ]. It can be found in '']''<ref>. |
|
'''5-''O''-Methylgenistein''' is an ]. It can be found in '']'', a tropical legume.<ref>{{cite journal|doi=10.1016/S0031-9422(00)88486-1|title=5-O-methylgenistein from Ormosia excelsa|journal=Phytochemistry|volume=11|issue=3|pages=1183|year=1972|last1=Gottlieb|first1=O.R.|last2=Da Rocha|first2=A.I.|bibcode=1972PChem..11.1183G }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
| Line 39: |
Line 52: |
|
|
|
|
|
{{DEFAULTSORT:Methylgenistein, 5-O-}} |
|
{{DEFAULTSORT:Methylgenistein, 5-O-}} |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |