| Revision as of 18:34, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 449354726 of page 5-O-Methylmyricetin for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 16:09, 27 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| Line 1: |
Line 1: |
|
|
{{DISPLAYTITLE:5-''O''-Methylmyricetin}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 423617520 |
|
| verifiedrevid = 477225433 |
|
| Name = 5-''O''-Methylmyricetin |
|
| Name = 5-''O''-Methylmyricetin |
|
| ImageFile = 5-O-methylmyricetin.PNG |
|
| ImageFile = 5-O-Methylmyricetin.svg |
|
⚫ |
| ImageName = Chemical structure of 5-''O''-methylmyricetin |
|
| ImageSize = 200px |
|
|
|
| IUPACName = 3,3′,4′,5′,7-Pentahydroxy-5-methoxyflavone |
| ⚫ |
| ImageName = Chemical structure of 5-O-methylmyricetin |
|
|
| IUPACName = 3,7-dihydroxy-5-methoxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|
| SystematicName = 3,7-Dihydroxy-5-methoxy-2-(3,4,5-trihydroxyphenyl)-4''H''-1-benzopyran-4-one |
|
| OtherNames = 5-Methylmyricetin<!-- <br> --> |
|
| OtherNames = 5-Methylmyricetin |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChI = 1/C16H12O8/c1-23-10-4-7(17)5-11-12(10)14(21)15(22)16(24-11)6-2-8(18)13(20)9(19)3-6/h2-5,17-20,22H,1H3 |
|
| InChI = 1/C16H12O8/c1-23-10-4-7(17)5-11-12(10)14(21)15(22)16(24-11)6-2-8(18)13(20)9(19)3-6/h2-5,17-20,22H,1H3 |
|
| InChIKey = DDVGNSDGGWHPQZ-UHFFFAOYAT |
|
| InChIKey = DDVGNSDGGWHPQZ-UHFFFAOYAT |
| Line 16: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DDVGNSDGGWHPQZ-UHFFFAOYSA-N |
|
| StdInChIKey = DDVGNSDGGWHPQZ-UHFFFAOYSA-N |
|
| CASNo = |
|
| CASNo = 19077-84-0 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{Cascite|changed|CAS}} |
|
| CASOther = |
|
| ChEMBL = 4470965 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4477964 |
|
| ChemSpiderID = 4477964 |
|
| PubChem = 5319731 |
|
| PubChem = 5319731 |
|
| SMILES = COC1=C2C(=CC(=C1)O)OC(=C(C2=O)O)C3=CC(=C(C(=C3)O)O)O |
|
| SMILES = COC1=C2C(=CC(=C1)O)OC(=C(C2=O)O)C3=CC(=C(C(=C3)O)O)O |
|
| InChI = |
|
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=12 | O=8 |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>8</sub> |
|
|
| MolarMass = 332.26 g/mol |
|
|
| ExactMass = 332.053217 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = 1.731 g/mL |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''5-''O''-Methylmyricetin''' is an ], a type of ]. It is the 5-''O''-] derivative of ]. It occurs naturally and can also be synthesized.<ref>{{cite journal | title = Synthesis of naturally occurring partial methyl ethers of myricetin | author = P. N. Sarma, G. Srimannarayana and N. V. Subba Rao | journal = Proceedings Mathematical Sciences | volume = 80 | issue = 4 | pages = 168–173 | year = 1974| doi = 10.1007/BF03046674 | s2cid = 92325935 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{flavonol}} |
|
|
|
|
|
{{DEFAULTSORT:Methylmyricetin, 5-O-}} |
|
|
] |
|
|
] |
|
|
|
|
|
{{aromatic-stub}} |