| Revision as of 18:35, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443357027 of page 6,7-Dimethyl-8-ribityllumazine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 21:51, 27 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443355767 |
|
| verifiedrevid = 477225507 |
|
|ImageFile=6,7-dimethyl-8-ribityllumazine.svg |
|
| ImageFile=6,7-dimethyl-8-ribityllumazine.svg |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName= |
|
|
|
| IUPACName=8-(1-Deoxy-<small>D</small>-ribitol-1-yl)-6,7-dimethylpteridine-2,4(3''H'',8''H'')-dione |
| ⚫ |
|OtherNames= |
|
|
|
| SystematicName=6,7-Dimethyl-8-pteridine-2,4(3''H'',8''H'')-dione |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 147805 |
|
| ChemSpiderID = 147805 |
|
| InChI = 1/C13H18N4O6/c1-5-6(2)17(3-7(19)10(21)8(20)4-18)11-9(14-5)12(22)16-13(23)15-11/h7-8,10,18-21H,3-4H2,1-2H3,(H,16,22,23)/t7-,8+,10-/m0/s1 |
|
| InChI = 1/C13H18N4O6/c1-5-6(2)17(3-7(19)10(21)8(20)4-18)11-9(14-5)12(22)16-13(23)15-11/h7-8,10,18-21H,3-4H2,1-2H3,(H,16,22,23)/t7-,8+,10-/m0/s1 |
| Line 15: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SXDXRJZUAJBNFL-XKSSXDPKSA-N |
|
| StdInChIKey = SXDXRJZUAJBNFL-XKSSXDPKSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 5118-16-1 --> |
|
|
|
| CASNo=5118-16-1 |
| ⚫ |
| PubChem=168989 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = O1DSD0WC7M |
|
⚫ |
| PubChem=168989 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 17601 |
|
| ChEBI = 17601 |
|
| SMILES = O=C2/N=C\1/N(\C(=C(/N=C/1C(=O)N2)C)C)C(O)(O)(O)CO |
|
| SMILES = O=C2/N=C\1/N(\C(=C(/N=C/1C(=O)N2)C)C)C(O)(O)(O)CO |
|
| MeSHName=6,7-dimethyl-8-ribityllumazine |
|
| MeSHName=6,7-dimethyl-8-ribityllumazine |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>13</sub>H<sub>18</sub>N<sub>4</sub>O<sub>6</sub> |
|
| Formula=C<sub>13</sub>H<sub>18</sub>N<sub>4</sub>O<sub>6</sub> |
|
| MolarMass=326.305 g/mol |
|
| MolarMass=326.305 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''6,7-Dimethyl-8-ribityllumazine''' is a precursor for ]. It is acted upon by ]. |
|
|
|
|
|
{{DEFAULTSORT:Dimethyl-8-ribityllumazine, 6,7-}} |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{biochem-stub}} |