Misplaced Pages

PRO-LAD and 6-Isopropyl-6-nor-lysergic acid diethylamide: Difference between pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 15:51, 7 March 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.  Latest revision as of 11:20, 9 November 2024 edit Graeme Bartlett (talk | contribs)Administrators249,752 edits added Category:Diethylamino compounds using HotCat 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox | verifiedrevid = 400840595
{{Drugbox
|
| Watchedfields = changed
| image = PROLAD.svg
| verifiedrevid = 417615822
| width = 150
| IUPAC_name = ()- ''N,N''- diethyl- 6-propyl- 9,10- didehydroergoline- 8- carboxamide | IUPAC_name = (6a''R'',9''R'')-''N'',''N''-Diethyl-7-propan-2-yl-6,6a,8,9-tetrahydro-4''H''-indoloquinoline-9-carboxamide
| image = IP-LAD.png
| C=22 | H=29 | N=3 | O=1
| width = 170
| molecular_weight = 351.50 g/mol

| synonyms = <small>PRO-LAD,<br/>6-propyl- 6-nor- Lysergic acid diethylamide,<br/> (6a''R'',9''R'')- ''N,N''- diethyl- 7-propyl- 4,6,6a,7,8,9- hexahydroindolo- quinoline- 9- carboxamide</small>
<!--Clinical data-->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| tradename =
| ChemSpiderID = 21106361
| legal_AU =
| InChI = 1/C22H29N3O/c1-4-10-25-14-16(22(26)24(5-2)6-3)11-18-17-8-7-9-19-21(17)15(13-23-19)12-20(18)25/h7-9,11,13,16,20,23H,4-6,10,12,14H2,1-3H3/t16-,20-/m1/s1
| legal_CA =
| InChIKey = HZKYLVLOBYNKKM-OXQOHEQNBI
| legal_DE = NpSG
| smiles = CCN(CC)C(=O)2/C=C1/c3cccc4ncc(C1N(C2)CCC)c34
| ChEMBL = 22258 | legal_UK = Class A
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H29N3O/c1-4-10-25-14-16(22(26)24(5-2)6-3)11-18-17-8-7-9-19-21(17)15(13-23-19)12-20(18)25/h7-9,11,13,16,20,23H,4-6,10,12,14H2,1-3H3/t16-,20-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HZKYLVLOBYNKKM-OXQOHEQNSA-N
| CAS_number = 65527-63-1
| PubChem = 44457803
| metabolism = hepatic
| excretion = renal
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US = | legal_US =
| routes_of_administration = ]
| legal_status = Controlled in the ] via the ] but only if it is intended for human consumption.
| routes_of_administration = ]}}


<!--Identifiers-->
'''PRO-LAD''' is an analogue of ]. It is described by ] in the book ]. PRO-LAD is a hallucinogenic drug similar to LSD, and is around as potent as LSD itself with an active dose reported at between 100 and 200 micrograms.<ref name="pmid4032428">{{cite journal |author=Hoffman AJ, Nichols DE |title=Synthesis and LSD-like discriminative stimulus properties in a series of N(6)-alkyl norlysergic acid N,N-diethylamide derivatives |journal=Journal of Medicinal Chemistry |volume=28 |issue=9 |pages=1252–5 |year=1985 |month=September |pmid=4032428 |doi= |url=}}</ref>
| CAS_number =
| UNII =
| PubChem = 44458092
| ChemSpiderID = 23120596
| ChEMBL = 22893


<!--Chemical data-->
PRO-LAD has been sold by some ] suppliers but might be considered illegal in some countries due to its structural similarity to LSD.
| C=22 | H=29 | N=3 | O=1
| molecular_weight =
| smiles = CCN(CC)C(=O)1CN(2CC3=CNC4=CC=CC(=C34)C2=C1)C(C)C
| StdInChI = 1S/C22H29N3O/c1-5-24(6-2)22(26)16-10-18-17-8-7-9-19-21(17)15(12-23-19)11-20(18)25(13-16)14(3)4/h7-10,12,14,16,20,23H,5-6,11,13H2,1-4H3/t16-,20-/m1/s1
| StdInChIKey = GLNOSFGSNDKLOC-OXQOHEQNSA-N
}}


'''6-Isopropyl-6-nor-lysergic acid diethylamide''' ('''IP-LAD''') is an ] of ] (LSD) developed by the team of ]. In studies on mice, it was found to be approximately 40% the potency of LSD, compared to the 60% increase in potency seen with ], 2-fold potency increase of ], and roughly equivalent potency of ].<ref>{{cite journal | vauthors = Hoffman AJ, Nichols DE | title = Synthesis and LSD-like discriminative stimulus properties in a series of N(6)-alkyl norlysergic acid N,N-diethylamide derivatives | journal = Journal of Medicinal Chemistry | volume = 28 | issue = 9 | pages = 1252–1255 | date = September 1985 | pmid = 4032428 | doi = 10.1021/jm00147a022 }}</ref>
==References==

== References ==
{{reflist}} {{reflist}}


{{Hallucinogens}}
==External links==
{{Serotonin receptor modulators}}
*
{{Ergolines}}
*

{{TiHKAL}}
{{Hallucinogenic lysergamides}}


{{DEFAULTSORT:Isopropyl-6-nor-lysergic acid diethylamide, 6-}}
] ]
] ]
]

]
]


{{hallucinogen-stub}} {{hallucinogen-stub}}

]