| Revision as of 18:40, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443358361 of page 7-Dehydrodesmosterol for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 22:35, 27 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move semisystematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443356992 |
|
| verifiedrevid = 477226533 |
|
|ImageFile=7-Dehydrodesmosterol.png |
|
| ImageFile=7-Dehydrodesmosterol.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
| ⚫ |
|IUPACName=(3''S'',9''S'',10''R'',13''R'',14''R'',17''R'')-10,13-Dimethyl-17--2,3,4,9,11,12,14,15,16,17-decahydro-1''H''-cyclopentaphenanthren-3-ol |
|
|
|OtherNames=24-Dehydroprovitamin D3; Cholest-5''Z'',7''Z'',24-trien-3β-ol |
|
| IUPACName=Cholesta-5,7,24-trien-3β-ol |
|
⚫ |
| SystematicName=(1''R'',3a''R'',7''S'',9a''R'',9b''S'',11a''R'')-9a,11a-Dimethyl-1--2,3,3a,6,7,8,9,9a,9b,10,11,11a-dodecahydro-1''H''-cyclopentaphenanthren-7-ol |
|
|
| OtherNames=24-Dehydroprovitamin D3 |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 389458 |
|
| ChemSpiderID = 389458 |
|
| InChI = 1/C27H42O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,9-10,19,21,23-25,28H,6,8,11-17H2,1-5H3/t19-,21+,23-,24+,25+,26+,27-/m1/s1 |
|
| InChI = 1/C27H42O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,9-10,19,21,23-25,28H,6,8,11-17H2,1-5H3/t19-,21+,23-,24+,25+,26+,27-/m1/s1 |
| Line 16: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RUSSPKPUXDSHNC-DDPQNLDTSA-N |
|
| StdInChIKey = RUSSPKPUXDSHNC-DDPQNLDTSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 143982-69-8 --> |
|
|
|
| CASNo=143982-69-8 |
|
| PubChem=440558 |
|
| PubChem=440558 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 27910 |
|
| ChEBI = 27910 |
|
| SMILES=C(CCC=C(C)C)1CC21(CC3C2=CC=C43(CC(C4)O)C)C |
|
| SMILES=C(CCC=C(C)C)1CC21(CC3C2=CC=C43(CC(C4)O)C)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>27</sub>H<sub>42</sub>O |
|
| Formula=C<sub>27</sub>H<sub>42</sub>O |
|
| MolarMass=382.62 g/mol |
|
| MolarMass=382.62 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''7-Dehydrodesmosterol''' (or '''cholesta-5,7,24-trien-3-beta-ol''') is a ] intermediate.<ref name="SLOS novel met">{{cite journal |doi=10.1034/j.1399-0004.2001.590601.x |title=The Smith-Lemli-Opitz syndrome: A novel metabolic way of understanding developmental biology, embryogenesis, and dysmorphology |year=2001 |last1=Nowaczyk |first1=MJM |last2=Waye |first2=JS |journal=Clinical Genetics |volume=59 |issue=6 |pages=375–86 |pmid=11453964|s2cid=9146017 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Cholesterol and steroid intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Dehydrodesmosterol, 7-}} |
|
|
] |
|
|
|
|
|
|
|
|
{{steroid-stub}} |