Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 7-Dehydrositosterol: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 18:40, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 404018252 of page 7-Dehydrositosterol for the Chem/Drugbox validation project (updated: 'CASNo').  Latest revision as of 01:58, 12 January 2025 edit Arthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 399342192 | verifiedrevid = 477226560
| ImageFile = 7-dehydrositosterol.png | ImageFile = 7-dehydrositosterol.png
| ImageClass = skin-invert-image
| ImageSize = | ImageSize = 220
| IUPACName = (3β)-Stigmasta-5,7-dien-3-ol
| ImageFile1 = 7-Dehydrositosterol molecule ball.png
| ImageSize1 = 250
| ImageAlt1 = Ball-and-stick model of 7-dehydroepisterol
| IUPACName = Stigmasta-5,7-dien--ol
| SystematicName = (1''R'',3a''R'',7''S'',9a''R'',9b''S'',11a''R'')-1--9a,11a-dimethyl-2,3,3a,6,7,8,9,9a,9b,10,11,11a-dodecahydro-1''H''-cyclopentaphenanthren-7-ol
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4446728 | ChemSpiderID = 4446728
| InChI = 1/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10-11,19-21,23,25-27,30H,7-9,12-18H2,1-6H3/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1
| InChIKey = ARVGMISWLZPBCH-XHVHEOSNBI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10-11,19-21,23,25-27,30H,7-9,12-18H2,1-6H3/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1 | StdInChI = 1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10-11,19-21,23,25-27,30H,7-9,12-18H2,1-6H3/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ARVGMISWLZPBCH-XHVHEOSNSA-N | StdInChIKey = ARVGMISWLZPBCH-XHVHEOSNSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = <!-- blanked - oldvalue: 521-04-0 -->
| PubChem = 101740 | CASNo = 521-04-0
| UNII_Ref = {{fdacite|correct|FDA}}
| SMILES = O4C/C3=C/C=C1\(CC2(1CC2(C)CC(CC)C(C)C)C)3(C)CC4
| UNII = A6478ODO9X
}}
| PubChem = 101740
| Section2 = {{Chembox Properties
| SMILES = O4C/C3=C/C=C1\(CC2(1CC2(C)CC(CC)C(C)C)C)3(C)CC4
| Formula = C<sub>29</sub>H<sub>48</sub>O
}}
| MolarMass = 412.691
|Section2={{Chembox Properties
| Appearance =
| Formula = C<sub>29</sub>H<sub>48</sub>O
| Density =
| MeltingPt = | MolarMass = 412.691
| BoilingPt = | Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| Solubility = | MainHazards =
| MainHazards = | FlashPt =
| FlashPt = | AutoignitionPt =
| Autoignition =
}} }}
}} }}
'''7-Dehydrositosterol''' is a ] which serves as a precursor for ] (]).

==External links==
* {{MeshName|7-dehydrositosterol}}

{{DEFAULTSORT:Dehydrositosterol, 7-}}
]
]

{{biochemistry-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 7-Dehydrositosterol: Difference between pages Add topic