| Revision as of 18:42, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 461357800 of page 7-PET for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 13:35, 29 December 2023 edit Boghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,805 edits consistent citation formatting |
| Line 1: |
Line 1: |
|
|
{{Short description|Opioid analgesic drug}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 447991324 |
|
|
|
| Watchedfields = changed |
|
| IUPAC_name = 7-endoethenotetrahydrothebaine |
|
|
⚫ |
| verifiedrevid = 477226838 |
| ⚫ |
| image = 7-PET_structure.png |
|
|
|
| IUPAC_name = (2''R'')-2-((4''R'',7''S'',7a''R'',12b''S'',14''R'')-7,9-dimethoxy-3-methyl-1,2,3,4,7,7a-hexahydro-7,4a-ethano-4,12-methanobenzofuroisoquinolin-14-yl)-4-phenylbutan-2-ol |
|
⚫ |
| image = 7-PET.svg |
|
|
| width = 150px |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| legal_status = |
|
| legal_status = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 13965-63-4 --> |
|
| CAS_number = 13965-63-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = EA1GYF2V3I |
|
| PubChem = 203125 |
|
| PubChem = 203125 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| Line 18: |
Line 23: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=31 | H=39 | N=1 | O=4 |
|
| C=31 | H=39 | N=1 | O=4 |
|
|
| smiles = O(C)(CCc1ccccc1)7CC64\C=C/7(OC)5Oc2c3c(ccc2OC)C6N(CC345)C |
|
| molecular_weight = 487.64 g/mol |
|
|
| smiles = CN5CCC16c4c2OC1C3(OC)C=CC6(C5Cc4ccc2OC)CC3C(O)(C)CCc7ccccc7 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C31H39NO4/c1-28(33,13-12-20-8-6-5-7-9-20)23-19-29-14-15-31(23,35-4)27-30(29)16-17-32(2)24(29)18-21-10-11-22(34-3)26(36-27)25(21)30/h5-11,23-24,27,33H,12-19H2,1-4H3/t23?,24-,27?,28?,29-,30+,31-/m1/s1 |
|
| StdInChI = 1S/C31H39NO4/c1-28(33,13-12-20-8-6-5-7-9-20)23-19-29-14-15-31(23,35-4)27-30(29)16-17-32(2)24(29)18-21-10-11-22(34-3)26(36-27)25(21)30/h5-11,23-24,27,33H,12-19H2,1-4H3/t23?,24-,27?,28?,29-,30+,31-/m1/s1 |
| Line 25: |
Line 29: |
|
| StdInChIKey = CSZMZMPPNJFGRW-TZBHJBKBSA-N |
|
| StdInChIKey = CSZMZMPPNJFGRW-TZBHJBKBSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''7-PET''' is an ] ] drug that has 300 times the potency of ] by weight.<ref>{{cite journal | vauthors = Lewis JW, Bentley KW, Cowan A | title = Narcotic analgesics and antagonists | journal = Annual Review of Pharmacology | volume = 11 | pages = 241–270 | year = 1971 | pmid = 4948499 | doi = 10.1146/annurev.pa.11.040171.001325 }}</ref> It was discovered by K.W. Bentley<ref>{{cite journal | vauthors = Bentley KW, Hardy DG, Meek B | title = Novel analgesics and molecular rearrangements in the morphine-thebaine group. II. Alcohols derived from 6,14-endo-etheno- and 6,14-endo-ethanotetrahydrothebaine | journal = Journal of the American Chemical Society | volume = 89 | issue = 13 | pages = 3273–3280 | date = June 1967 | pmid = 6042763 | doi = 10.1021/ja00989a031 }}</ref> and is related to the more well known ] derivative ], which is used as a ] painkiller and ] medication for the sedation of large animals such as elephants, giraffes, and rhinos. 7-PET itself has a 3-''O''-methyl ether which reduces potency, but the 3-OH derivative is around 2200 times more potent than morphine, almost the same potency as etorphine as a ] ],<ref>{{cite journal | vauthors = Feinberg AP, Creese I, Snyder SH | title = The opiate receptor: a model explaining structure-activity relationships of opiate agonists and antagonists | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 73 | issue = 11 | pages = 4215–4219 | date = November 1976 | pmid = 186791 | pmc = 431391 | doi = 10.1073/pnas.73.11.4215 | doi-access = free | bibcode = 1976PNAS...73.4215F }}</ref><ref>{{ cite book | vauthors = Bentley KW, Lewis JW | veditors = Kosterlitz HW, Collier HO, Villarreal JE | title = Agonist and Antagonist Actions of Narcotic Analgesic Drugs | pages = 7–16 | publisher = University Park Press | location = Baltimore | year = 1973 | isbn = 978-0839107255 | lccn = 72012612 }}</ref> and unexpectedly the 3-hydrogen compound is also around the same potency of 2000 times morphine.<ref>{{cite journal | vauthors = Lewis JW, Readhead MJ | title = Novel analgetics and molecular rearrangements in the morphine-thebaine group. 18. 3-deoxy-6,14-endo-etheno-6,7,8,14-tetrahydrooripavines | journal = Journal of Medicinal Chemistry | volume = 13 | issue = 3 | pages = 525–527 | date = May 1970 | pmid = 5441135 | doi = 10.1021/jm00297a041 }}</ref> |
|
|
|
|
|
Unlike etorphine, 7-PET is not controlled under the UN drug conventions, but it might still be considered to be a ] of etorphine on the grounds of its related chemical structure in some jurisdictions such as the United States, Canada, Australia, and New Zealand. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |