| Revision as of 18:42, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 471743035 of page 7-Spiroindanyloxymorphone for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 18:23, 21 October 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 454432745 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (4aR-(4aα,7aα,8α,9cα))- 1',3',7,7a,8,9- Hexahydro- 3,7a-dihydroxy- 12-methylspiro (6H-8,9c- (iminoethano) phenanthro (4,5-bcd) furan- 6,2'- (2H)inden)- 5(4aH)- one |
|
|
⚫ |
| verifiedrevid = 477226864 |
|
⚫ |
| IUPAC_name = (4a''R''-(4aα,7aα,8α,9cα))-1',3',7,7a,8,9-Hexahydro-3,7a-dihydroxy-12-methylspiro(iminoethano)phenanthrofuran-6,2'-(2''H'')inden)-5(4a''H'')-one |
|
| image = 7-Spiroindanyloxymorphone.svg |
|
| image = 7-Spiroindanyloxymorphone.svg |
|
|
| width = 150 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 10: |
Line 13: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 150380-34-0 --> |
|
| CAS_number = 150380-34-0 |
|
| PubChem = 5487084 |
|
| PubChem = 5487084 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| Line 18: |
Line 21: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=25 | H=25 | N=1 | O=4 |
|
| C=25 | H=25 | N=1 | O=4 |
|
| molecular_weight = 403.470 g/mol |
|
|
| smiles = CN1CCC234C(=O)C5(CC6=CC=CC=C6C5)C2(1CC7=C3C(=C(C=C7)O)O4)O |
|
| smiles = CN1CCC234C(=O)C5(CC6=CC=CC=C6C5)C2(1CC7=C3C(=C(C=C7)O)O4)O |
|
| InChI = 1/C25H25NO4/c1-26-9-8-24-19-14-6-7-17(27)20(19)30-22(24)21(28)23(13-25(24,29)18(26)10-14)11-15-4-2-3-5-16(15)12-23/h2-7,18,22,27,29H,8-13H2,1H3/t18?,22-,24-,25+/m0/s1 |
|
|
| InChIKey = YJWDKWRVFJZBCJ-OVKCVFHGBV |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C25H25NO4/c1-26-9-8-24-19-14-6-7-17(27)20(19)30-22(24)21(28)23(13-25(24,29)18(26)10-14)11-15-4-2-3-5-16(15)12-23/h2-7,18,22,27,29H,8-13H2,1H3/t18?,22-,24-,25+/m0/s1 |
|
| StdInChI = 1S/C25H25NO4/c1-26-9-8-24-19-14-6-7-17(27)20(19)30-22(24)21(28)23(13-25(24,29)18(26)10-14)11-15-4-2-3-5-16(15)12-23/h2-7,18,22,27,29H,8-13H2,1H3/t18?,22-,24-,25+/m0/s1 |
| Line 27: |
Line 27: |
|
| StdInChIKey = YJWDKWRVFJZBCJ-OVKCVFHGSA-N |
|
| StdInChIKey = YJWDKWRVFJZBCJ-OVKCVFHGSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''7-Spiroindanyloxymorphone''' ('''SIOM''') is a drug that is used in scientific research. It is a selective ] ]. It is a derivative of ].<ref>{{cite journal | vauthors = Portoghese PS, Moe ST, Takemori AE | title = A selective delta 1 opioid receptor agonist derived from oxymorphone. Evidence for separate recognition sites for delta 1 opioid receptor agonists and antagonists | journal = Journal of Medicinal Chemistry | volume = 36 | issue = 17 | pages = 2572–4 | date = August 1993 | pmid = 8394935 | doi = 10.1021/jm00069a017 | authorlink1 = Philip S. Portoghese }}</ref><ref>{{cite journal | vauthors = Fang X, Larson DL, Portoghese PS | title = 7-spirobenzocyclohexyl derivatives of naltrexone, oxymorphone, and hydromorphone as selective opioid receptor ligands | journal = Journal of Medicinal Chemistry | volume = 40 | issue = 19 | pages = 3064–70 | date = September 1997 | pmid = 9301669 | doi = 10.1021/jm970283e }}</ref><ref>{{cite journal | vauthors = Ohkawa S, DiGiacomo B, Larson DL, Takemori AE, Portoghese PS | title = 7-Spiroindanyl derivatives of naltrexone and oxymorphone as selective ligands for delta opioid receptors | journal = Journal of Medicinal Chemistry | volume = 40 | issue = 11 | pages = 1720–5 | date = May 1997 | pmid = 9171881 | doi = 10.1021/jm9700880 }}</ref><ref>{{cite journal | vauthors = Kshirsagar TA, Fang X, Portoghese PS | title = 14-Desoxy analogues of naltrindole and 7-spiroindanyloxymorphone: the role of the 14-hydroxy group at delta opioid receptors | journal = Journal of Medicinal Chemistry | volume = 41 | issue = 14 | pages = 2657–60 | date = July 1998 | pmid = 9651172 | doi = 10.1021/jm980209b }}</ref><ref>{{cite journal | vauthors = Shenderovich MD, Liao S, Qian X, Hruby VJ | title = A three-dimensional model of the delta-opioid pharmacophore: comparative molecular modeling of peptide and nonpeptide ligands | journal = Biopolymers | volume = 53 | issue = 7 | pages = 565–80 | date = June 2000 | pmid = 10766952 | doi = 10.1002/(SICI)1097-0282(200006)53:7<565::AID-BIP4>3.0.CO;2-5 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
{{DEFAULTSORT:Spiroindanyloxymorphone, 7-}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{analgesic-stub}} |