(Difference between pages)

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

Content deleted Content addedVisualWikitext

Revision as of 18:43, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 428761786 of page 8-Bromoguanosine_3',5'-cyclic_monophosphate for the Chem/Drugbox validation project (updated: 'CASNo').		Latest revision as of 01:59, 28 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name
Line 1:		Line 1:
	{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{Chembox		{{Chembox
			| Verifiedfields = changed
⚫	| verifiedrevid = 399342089
			| Watchedfields = changed
⚫	| ImageFile = 8-bromo cyclic GMP.png
		⚫	| verifiedrevid = 477227029
⚫	| ImageSize = 200px
			| Name = 8-Bromoguanosine 3′,5′-cyclic monophosphate
	| IUPACName = 2-amino-8-bromo-9-nonan-8-yl]-3''H''-purin-6-one
		⚫	| ImageFile = 8-Bromoguanosine 3',5'-cyclic monophosphate.svg
		⚫	| ImageSize = 240px
			| IUPACName = 8-Bromoguanosine 3′,5′-(hydrogen phosphate)
			| PIN = (4a''R'',6''R'',7''R'',7a''S'')-6-(2-Amino-8-bromo-6-oxo-1,6-dihydro-9''H''-purin-9-yl)-2,7-dihydroxytetrahydro-2''H'',4''H''-2λ<sup>5</sup>-furodioxaphosphinin-2-one
	| OtherNames = 8-Bromocyclic GMP;8-Bromo-cGMP; 8-Br-cyclic GMP; 8-Br-cGMP		| OtherNames = 8-Bromocyclic GMP;8-Bromo-cGMP; 8-Br-cyclic GMP; 8-Br-cGMP
	| Section1 = {{Chembox Identifiers		|Section1={{Chembox Identifiers
	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
	| ChemSpiderID = 94575		| ChemSpiderID = 94575
			| ChEBI_Ref = {{ebicite|changed|EBI}}
			| ChEBI = 64108
	| InChI = 1/C10H11BrN5O7P/c11-9-13-3-6(14-10(12)15-7(3)18)16(9)8-4(17)5-2(22-8)1-21-24(19,20)23-5/h2,4-5,8,17H,1H2,(H,19,20)(H3,12,14,15,18)/t2-,4-,5-,8-/m1/s1		| InChI = 1/C10H11BrN5O7P/c11-9-13-3-6(14-10(12)15-7(3)18)16(9)8-4(17)5-2(22-8)1-21-24(19,20)23-5/h2,4-5,8,17H,1H2,(H,19,20)(H3,12,14,15,18)/t2-,4-,5-,8-/m1/s1
	| InChIKey = YUFCOOWNNHGGOD-UMMCILCDBZ		| InChIKey = YUFCOOWNNHGGOD-UMMCILCDBZ
Line 16:		Line 21:
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}		| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChIKey = YUFCOOWNNHGGOD-UMMCILCDSA-N		| StdInChIKey = YUFCOOWNNHGGOD-UMMCILCDSA-N
			| CASNo_Ref = {{cascite|changed|??}}
	| CASNo = <!-- blanked - oldvalue: 31356-94-2 -->		| CASNo = 31356-94-2
	| PubChem = 104767		| PubChem = 104767
	| SMILES = C12(((O2)N3C4=C(C(=O)N=C(N4)N)N=C3Br)O)OP(=O)(O1)O		| SMILES = C12(((O2)N3C4=C(C(=O)N=C(N4)N)N=C3Br)O)OP(=O)(O1)O
	}}		}}
	| Section2 = {{Chembox Properties		|Section2={{Chembox Properties
	| C=10|H=11|Br=1|N=5|O=7|P=1		| C=10 | H=11 | Br=1 | N=5 | O=7 | P=1
	| Appearance =		| Appearance =
	| Density =		| Density =
Line 27:		Line 33:
	| BoilingPt =		| BoilingPt =
	| Solubility = }}		| Solubility = }}
	| Section3 = {{Chembox Hazards		|Section3={{Chembox Hazards
	| MainHazards =		| MainHazards =
	| FlashPt =		| FlashPt =
	| Autoignition = }}		| AutoignitionPt = }}
	}}		}}
			'''8-Bromoguanosine 3′,5′-cyclic monophosphate''' is a ] derivative of ] (cGMP).<ref>{{cite journal | doi = 10.1073/pnas.79.21.6470 | pmid = 6292902 |date=Nov 1982 | last1 = Rapoport | first1 = RM | last2 = Draznin | last3 = Murad | title = Sodium nitroprusside-induced protein phosphorylation in intact rat aorta is mimicked by 8-bromo cyclic GMP | volume = 79 | issue = 21 | pages = 6470–4 | issn = 0027-8424 | journal = Proceedings of the National Academy of Sciences of the United States of America | format = Free full text | first2 = MB | first3 = F | pmc = 347148 | bibcode = 1982PNAS...79.6470R | doi-access = free }}</ref> It acts as an activator of cGMP-dependent ]s.<ref></ref>
			== See also ==
			* ] (8-Br-cAMP)
			==References==
			{{reflist}}
			{{DEFAULTSORT:Bromoguanosine 3',5'-cyclic monophosphate, 8-}}
			]
			]
			]
			]
			]