| Revision as of 09:26, 22 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified and watched fields - added verified revid - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProjec← Previous edit |
Latest revision as of 10:56, 13 September 2024 edit undoTom.Reding (talk | contribs)Autopatrolled, Extended confirmed users, Page movers, Template editors3,879,760 editsm WP:STUBSPACING followupTag: AWB |
| (35 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
|
{{For|Indian IT Company Abcence|Abcence}} |
|
{{dablink|For the Australian TV station, see ].}} |
|
{{For|the Australian TV station|ABN (TV station)}} |
|
|
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
|Verifiedfields = changed |
|
| Watchedfields = changed |
|
|Watchedfields = changed |
|
| verifiedrevid = 394145532 |
|
|verifiedrevid = 477235009 |
|
| ImageFileL1 = ABCN-2D-skeletal.png |
|
|ImageFile1 = ABCN-2D-skeletal.png |
|
| ImageFileL1_Ref = {{chemboximage|correct|??}} |
|
|ImageFile1_Ref = {{chemboximage|correct|??}} |
|
⚫ |
|ImageName1 = Stereo, skeletal formula of (''Z'')-ABCN |
|
| ImageSizeL1 = 121 |
|
|
⚫ |
|ImageFile2 = ABCN-3D-sticks.png |
| ⚫ |
| ImageNameL1 = Stereo skeletal formula of ABCN (1-) |
|
|
⚫ |
|ImageFile2_Ref = {{chemboximage|correct|??}} |
| ⚫ |
| ImageFileR1 = ABCN-3D-vdW.png |
|
|
⚫ |
|ImageName2 = Stick model of (''Z'')-ABCN |
|
| ImageFileR1_Ref = {{chemboximage|correct|??}} |
|
|
⚫ |
|ImageFile3 = ABCN-3D-vdW.png |
|
| ImageSizeR1 = 121 |
|
|
⚫ |
|ImageFile3_Ref = {{chemboximage|correct|??}} |
|
| ImageNameR1 = Spacefill model of ABCN (1-) |
|
|ImageName3 = Spacefill model of (''Z'')-ABCN |
| ⚫ |
| ImageFile2 = ABCN-3D-sticks.png |
|
|
⚫ |
|SystematicName = 1,1′-Diazene-1,2-diyldicyclohexanecarbonitrile |
| ⚫ |
| ImageFile2_Ref = {{chemboximage|correct|??}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| ImageSize2 = 244 |
|
|
⚫ |
|Abbreviations = ACHN |
| ⚫ |
| ImageName2 = Stick model of ABCN (1-) |
|
|
⚫ |
|CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| IUPACName = 1,1'-diazene-1,2-diyldicyclohexanecarbonitrile |
|
|
⚫ |
|CASNo = 2094-98-6 |
|
| SystematicName = 1-cyclohexane-1-carbonitrile{{Reference necessary|date=February 2011}} |
|
|
|
|UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
|UNII = 9Y0B93KKUS |
| ⚫ |
| Abbreviations = ACCN |
|
|
⚫ |
|PubChem = 74978 |
| ⚫ |
| CASNo = 2094-98-6 |
|
|
⚫ |
|ChemSpiderID = 21159585 |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
⚫ |
|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| PubChem = 74978 |
|
|
⚫ |
|ChemSpiderID2 = 21427655 |
|
| PubChem_Ref = {{Pubchemcite|correct|PubChem}} |
|
|
⚫ |
|ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| ChemSpiderID = 21159585 |
|
|
⚫ |
|ChemSpiderID2_Comment = <small>(''Z'')</small> |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID1 = 67533 |
|
|ChemSpiderID1 = 67533 |
|
⚫ |
|ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID1_Comment = 1- |
|
|ChemSpiderID1_Comment = <small>(''E'')</small> |
| ⚫ |
| ChemSpiderID1_Ref = {{chemspidercite|correct|ChemSpider}} |
|
|
⚫ |
|EINECS = 218-254-8 |
| ⚫ |
| ChemSpiderID2 = 21427655 |
|
|
⚫ |
|UNNumber = 3226 |
| ⚫ |
| ChemSpiderID2_Comment = 1- |
|
|
⚫ |
|Beilstein = 960744 |
| ⚫ |
| ChemSpiderID2_Ref = {{chemspidercite|correct|ChemSpider}} |
|
|
⚫ |
|SMILES = N#CC1(CCCCC1)N=NC1(CCCCC1)C#N |
| ⚫ |
| EINECS = 218-254-8 |
|
|
⚫ |
|StdInChI = 1S/C14H20N4/c15-11-13(7-3-1-4-8-13)17-18-14(12-16)9-5-2-6-10-14/h1-10H2 |
| ⚫ |
| UNNumber = 3226 |
|
|
⚫ |
|StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| Beilstein = 960744 |
|
|
⚫ |
|InChI = 1/C14H20N4/c15-11-13(7-3-1-4-8-13)17-18-14(12-16)9-5-2-6-10-14/h1-10H2 |
| ⚫ |
| SMILES = N#CC1(CCCCC1)N=NC1(CCCCC1)C#N |
|
|
⚫ |
|StdInChIKey = KYIKRXIYLAGAKQ-UHFFFAOYSA-N |
|
| SMILES1 = N#CC2(N=NC1(CCCCC1)C#N)CCCCC2 |
|
|
⚫ |
|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| StdInChI = 1S/C14H20N4/c15-11-13(7-3-1-4-8-13)17-18-14(12-16)9-5-2-6-10-14/h1-10H2 |
|
|
⚫ |
|InChIKey = KYIKRXIYLAGAKQ-UHFFFAOYAM |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| ⚫ |
| InChI = 1/C14H20N4/c15-11-13(7-3-1-4-8-13)17-18-14(12-16)9-5-2-6-10-14/h1-10H2 |
|
| ⚫ |
| StdInChIKey = KYIKRXIYLAGAKQ-UHFFFAOYSA-N |
|
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| ⚫ |
| InChIKey = KYIKRXIYLAGAKQ-UHFFFAOYAM |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C = 14 |
|
|C=14 | H=20 | N=4 |
|
|
|MeltingPtC = 114 to 118<ref name=SA> at ]</ref> |
|
| H = 20 |
|
|
|
|MeltingPt_notes = decomposes near 80 °C |
|
| N = 4 |
|
|
| ExactMass = 244.168796660 g mol<sup>-1</sup> |
|
|
| MeltingPtCL = 114 |
|
|
| MeltingPtCH = 118 |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| EUClass = {{Hazchem F}} {{Hazchem Xi}} |
|
|GHSPictograms = {{GHS flame}} {{GHS exclamation mark}} |
|
|
|GHSSignalWord = Danger |
|
| RPhrases = {{R11}}, {{R36/37/38}} |
|
|
|
|HPhrases = {{H-phrases|242|315|319|335}} |
|
| SPhrases = {{S26}} |
|
|
|
|PPhrases = {{P-phrases|261|305+351+338}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
1,1'-Azobis(cyclohexanecarbonitrile) or '''ABCN''' is a ]. The molecular formula is |
|
|
NCC<sub>6</sub>H<sub>10</sub>N=NC<sub>6</sub>H<sub>10</sub>CN. It is classified as highly flammable and an irritant. |
|
'''1,1′-Azobis(cyclohexanecarbonitrile)''' or '''ACHN''' is a ].<ref name=SA/> The molecular formula is NCC<sub>6</sub>H<sub>10</sub>N=NC<sub>6</sub>H<sub>10</sub>CN. It is a white solid that is soluble in aromatic solvents.<ref>{{cite journal|title=1,1'-Azobis-1-cyclohexanenitrile|author=Steven A. Kates, Fernando Albericio |
|
|
|journal=E-EROS Encyclopedia of Reagents for Organic Synthesis|year=2001|doi=10.1002/047084289X.ra120}}</ref> |
|
|
|
|
|
ACHN has a 10-hour ] in ] at 88 °C.<ref name=SA/> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 66: |
Line 63: |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{reflist}} |
|
{{Unreferenced|date =September 2007}} |
|
|
{{Reflist}} |
|
|
|
|
| ⚫ |
{{Organic-compound-stub}} |
|
|
|
|
|
{{DEFAULTSORT:Abcn}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
] |
|
|
⚫ |
{{Organic-compound-stub}} |