Revision as of 03:31, 20 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMo← Previous edit |
Latest revision as of 19:36, 25 October 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,946 edits consistent citation formatting |
(18 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{about|the FLAP inhibitor|the cannabinoid agonist|AM-679 (cannabinoid)}} |
|
{{about|the FLAP inhibitor|the cannabinoid agonist|AM-679 (cannabinoid)}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 426297736 |
|
| verifiedrevid = 440419865 |
|
| IUPAC_name = 3-(5--3-''t''-butylsulfanyl-1--1H-indol-2-yl)-2,2-dimethylpropionic acid |
|
| IUPAC_name = 3-(5--3-''t''-butylsulfanyl-1--1''H''-indol-2-yl)-2,2-dimethylpropionic acid |
|
| image = AM-679_FLAP_inhibitor.png |
|
| image = AM-679_FLAP_inhibitor.png |
|
| width = 240 |
|
| width = 240 |
⚫ |
| CAS_number = |
|
|
|
|
⚫ |
| ATC_prefix = |
|
|
|
<!--Clinical data--> |
⚫ |
| ATC_suffix = |
|
|
|
| tradename = |
⚫ |
| PubChem = 44627267 |
|
|
| DrugBank = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| C=40|H=44|N=4|O=5|S=1 |
|
|
⚫ |
| pregnancy_category = |
|
| molecular_weight = 692.864 g/mol |
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
⚫ |
| smiles = n5cc(OC)cnc5-c6ccc(cc6)Cn(c1CC(C)(C)C(=O)O)c4ccc(cc4c1SC(C)(C)C)OCC3Cc2ccccc2N3C(=O)C |
|
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 1206880-66-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 65KJ8P7M9D |
|
⚫ |
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 44627267 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 25991470 |
|
| ChemSpiderID = 25991470 |
|
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=40 | H=44 | N=4 | O=5 | S=1 |
|
⚫ |
| smiles = n5cc(OC)cnc5-c6ccc(cc6)Cn(c1CC(C)(C)C(=O)O)c4ccc(cc4c1SC(C)(C)C)OCC3Cc2ccccc2N3C(=O)C |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C39H42N4O5S/c1-24(44)43-28(18-27-10-8-9-11-32(27)43)23-48-29-16-17-33-31(19-29)34(49-38(2,3)4)35(39(5,6)37(45)46)42(33)22-25-12-14-26(15-13-25)36-40-20-30(47-7)21-41-36/h8-17,19-21,28H,18,22-23H2,1-7H3,(H,45,46)/t28-/m0/s1 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XTSOSRWDZSKOSB-NDEPHWFRSA-N |
|
| StdInChIKey = XTSOSRWDZSKOSB-NDEPHWFRSA-N |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI=1S/C39H42N4O5S/c1-24(44)43-28(18-27-10-8-9-11-32(27)43)23-48-29-16-17-33-31(19-29)34(49-38(2,3)4)35(39(5,6)37(45)46)42(33)22-25-12-14-26(15-13-25)36-40-20-30(47-7)21-41-36/h8-17,19-21,28H,18,22-23H2,1-7H3,(H,45,46)/t28-/m0/s1 |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''AM-679''' is a drug which acts as a selective inhibitor of ] (FLAP). This protein is involved in the production of ] ]s which are involved in ], and AM-679 has ] effects in animal studies.<ref name="pmid19914828">{{cite journal |author=Stock N, Baccei C, Bain G, Broadhead A, Chapman C, Darlington J, King C, Lee C, Li Y, Lorrain DS, Prodanovich P, Rong H, Santini A, Zunic J, Evans JF, Hutchinson JH, Prasit P |title=5-Lipoxygenase-activating protein inhibitors. Part 2: 3-{5-((S)-1-Acetyl-2,3-dihydro-1H-indol-2-ylmethoxy)-3-tert-butylsulfanyl-1--1H-indol-2-yl}-2,2-dimethyl-propionic acid (AM679)--a potent FLAP inhibitor |journal=Bioorganic & Medicinal Chemistry Letters |volume=20 |issue=1 |pages=213–7 |year=2010 |month=January |pmid=19914828 |doi=10.1016/j.bmcl.2009.10.131 |url=}}</ref><ref>{{Cite doi|10.1128/CVI.00220-09}}</ref> |
|
'''AM-679''' is a drug which acts as a selective inhibitor of ] (FLAP). This protein is involved in the production of ] ]s which are involved in ], and AM-679 has ] effects in animal studies.<ref name="pmid19914828">{{cite journal | vauthors = Stock N, Baccei C, Bain G, Broadhead A, Chapman C, Darlington J, King C, Lee C, Li Y, Lorrain DS, Prodanovich P, Rong H, Santini A, Zunic J, Evans JF, Hutchinson JH, Prasit P | display-authors = 6 | title = 5-Lipoxygenase-activating protein inhibitors. Part 2: 3-{5-((S)-1-Acetyl-2,3-dihydro-1H-indol-2-ylmethoxy)-3-tert-butylsulfanyl-1--1H-indol-2-yl}-2,2-dimethyl-propionic acid (AM679)--a potent FLAP inhibitor | journal = Bioorganic & Medicinal Chemistry Letters | volume = 20 | issue = 1 | pages = 213–217 | date = January 2010 | pmid = 19914828 | doi = 10.1016/j.bmcl.2009.10.131 }}</ref><ref>{{cite journal | vauthors = Musiyenko A, Correa L, Stock N, Hutchinson JH, Lorrain DS, Bain G, Evans JF, Barik S | display-authors = 6 | title = A novel 5-lipoxygenase-activating protein inhibitor, AM679, reduces inflammation in the respiratory syncytial virus-infected mouse eye | journal = Clinical and Vaccine Immunology | volume = 16 | issue = 11 | pages = 1654–1659 | date = November 2009 | pmid = 19759251 | pmc = 2772391 | doi = 10.1128/CVI.00220-09 }}</ref> |
|
|
|
|
⚫ |
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
|
{{Leukotrienergics}} |
⚫ |
==References== |
|
|
<references/> |
|
|
|
|
|
|
] |
|
] |
|
|
] |