| Revision as of 15:50, 6 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII').← Previous edit |
Latest revision as of 15:49, 8 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Anilines; added Category:4-Aminophenyl compounds using HotCat |
| (23 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{one source |date=March 2024}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 413290537 |
|
| verifiedrevid = 443362293 |
|
| IUPAC_name = 2-(amino)acetic acid |
|
| IUPAC_name = 2-(amino)acetic acid |
|
| image = Acediasulfone.png |
|
| image = Acediasulfone Structure.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 80-03-5 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 66451 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB08926 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 59823 |
|
| ChemSpiderID = 59823 |
|
|
| KEGG = D07061 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 30YP2YHH8W |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 48396 |
|
| ChEMBL = 48396 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
⚫ |
| C=14 | H=14 | N=2 | O=4 | S=1 |
|
⚫ |
| smiles = C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)NCC(=O)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H14N2O4S/c15-10-1-5-12(6-2-10)21(19,20)13-7-3-11(4-8-13)16-9-14(17)18/h1-8,16H,9,15H2,(H,17,18) |
|
| StdInChI = 1S/C14H14N2O4S/c15-10-1-5-12(6-2-10)21(19,20)13-7-3-11(4-8-13)16-9-14(17)18/h1-8,16H,9,15H2,(H,17,18) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FKKUMFTYSTZUJG-UHFFFAOYSA-N |
|
| StdInChIKey = FKKUMFTYSTZUJG-UHFFFAOYSA-N |
|
| smiles1 = O=S(=O)(c1ccc(NCC(=O)O)cc1)c2ccc(N)cc2 |
|
| ⚫ |
| CAS_number = 80-03-5 |
|
|
| CAS_supplemental = |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| ATC_supplemental = |
|
| ⚫ |
| UNII = 30YP2YHH8W |
|
| ⚫ |
| PubChem = 66451 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| chemical_formula = |
|
| ⚫ |
| C=14 | H=14 | N=2 | O=4 | S=1 |
|
|
| molecular_weight = 306.337 g/mol |
|
| ⚫ |
| smiles = C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)NCC(=O)O |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Acediasulfone''' (]) is an ] drug, which also has ] activity. It is a long-acting ] of ], which is used for treating ]. |
|
'''Acediasulfone''' (]) is an ] drug, which also has ] activity. It is a long-acting ] of ], which is used for treating ]. |
|
|
== Synthesis == |
|
|
Dapsone is somewhat inconvenient to administer to patients because of its rather low water solubility. |
|
|
] Ltd.); Rawlins, {{US patent|2589211}} (1952 to ]).]] |
|
|
In the search for more easily administered drugs, dapsone ('''1''') was reacted with ] to give acediasulfone ('''2''') which can be administered as a water-soluble salt. |
|
|
|
|
|
==References== |
|
== References == |
|
<references/> |
|
<references /> |
|
|
|
|
|
⚫ |
] |
| ⚫ |
{{antimicrobial-stub}} |
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
| ⚫ |
] |
|
|
⚫ |
{{antimicrobial-stub}} |