Misplaced Pages

Albaconazole: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 15:12, 11 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|errors← Previous edit Latest revision as of 15:06, 16 March 2023 edit undoOzzie10aaaa (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers213,564 editsm Cleaned up using AutoEd 
(31 intermediate revisions by 23 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Unreferenced|date=November 2009}}
{{Drugbox {{Drugbox
| verifiedrevid = 413306373 | verifiedrevid = 437205813
| IUPAC_name = 7-chloro-3-quinazolin-4-one | IUPAC_name = 7-Chloro-3-quinazolin-4-one
| image = Albaconazole.svg | image = Albaconazole.svg

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 187949-02-6
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 208952
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 181045 | ChemSpiderID = 181045
| UNII_Ref = {{fdacite|correct|FDA}}
| InChI = 1/C20H16ClF2N5O2/c1-12(28-11-25-18-6-13(21)2-4-15(18)19(28)29)20(30,8-27-10-24-9-26-27)16-5-3-14(22)7-17(16)23/h2-7,9-12,30H,8H2,1H3/t12-,20-/m1/s1
| UNII = YDW24Y8IAB
| InChIKey = UHIXWHUVLCAJQL-MPBGBICIBS
| KEGG_Ref = {{keggcite|correct|kegg}}
| smiles = Fc1ccc(c(F)c1)(O)((N3\C=N/c2cc(Cl)ccc2C3=O)C)Cn4ncnc4
| KEGG = D09702
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 298817 | ChEMBL = 298817

<!--Chemical data-->
| chemical_formula =
| C=20 | H=16 | Cl=1 | F=2 | N=5 | O=2
| smiles = Fc1ccc(c(F)c1)(O)((N3\C=N/c2cc(Cl)ccc2C3=O)C)Cn4ncnc4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H16ClF2N5O2/c1-12(28-11-25-18-6-13(21)2-4-15(18)19(28)29)20(30,8-27-10-24-9-26-27)16-5-3-14(22)7-17(16)23/h2-7,9-12,30H,8H2,1H3/t12-,20-/m1/s1 | StdInChI = 1S/C20H16ClF2N5O2/c1-12(28-11-25-18-6-13(21)2-4-15(18)19(28)29)20(30,8-27-10-24-9-26-27)16-5-3-14(22)7-17(16)23/h2-7,9-12,30H,8H2,1H3/t12-,20-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UHIXWHUVLCAJQL-MPBGBICISA-N | StdInChIKey = UHIXWHUVLCAJQL-MPBGBICISA-N
| CAS_number = 187949-02-6
| CAS_supplemental =
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 208952
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D09702
| chemical_formula =
| C=20 | H=16 | Cl=1 | F=2 | N=5 | O=2
| molecular_weight = 431.823146 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}} }}


'''Albaconazole (UR-9825)''' is a ] antifungal. It has potential broad-spectrum activity. '''Albaconazole''' (development code '''UR-9825''') is an experimental ] antifungal.<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800009452 | title = Albaconazole | work = Adis Insight | publisher = Springer Nature Switzerland AG }}</ref> It has potential broad-spectrum activity. The drug blocks a number of ] liver enzymes.{{cn|date=December 2022}}


It has also been studied as an ] agent.<ref>{{cite journal | vauthors = Guedes PM, Urbina JA, de Lana M, Afonso LC, Veloso VM, Tafuri WL, Machado-Coelho GL, Chiari E, Bahia MT | display-authors = 6 | title = Activity of the new triazole derivative albaconazole against Trypanosoma (Schizotrypanum) cruzi in dog hosts | journal = Antimicrobial Agents and Chemotherapy | volume = 48 | issue = 11 | pages = 4286–92 | date = November 2004 | pmid = 15504854 | pmc = 525424 | doi = 10.1128/AAC.48.11.4286-4292.2004 }}</ref>
]
]
]
]
]
]
]


== References ==
{{Reflist}}

{{Antifungals}}

]
]
]
]
]
]
]
]


{{antiinfective-agent-stub}} {{antiinfective-agent-stub}}