| Revision as of 13:41, 1 October 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added PubchemID, CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 07:24, 5 November 2024 edit undoCitation bot (talk | contribs)Bots5,429,316 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Dominic3203 | #UCB_webform 90/166 |
| (31 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 453369718 |
|
| IUPAC_name = 4-(3-{Ethylamino}-2-hydroxypropoxy)benzonitrile |
|
| IUPAC_name = 4-(3-{Ethylamino}-2-hydroxypropoxy)benzonitrile |
|
| image = almokalant.svg |
|
| image = almokalant.svg |
|
| alt = |
|
| alt = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 14: |
Line 17: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 21: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 123955-10-2 |
|
| CAS_number = 123955-10-2 |
|
| ATCvet = |
|
| ATCvet = |
|
| ATC_prefix = None |
|
| ATC_prefix = None |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = I9NG89L275 |
|
| UNII = I9NG89L275 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 362103 |
|
| ChEMBL = 362103 |
|
| PubChem = 3033962 |
|
| PubChem = 3033962 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2298526 |
|
| ChemSpiderID = 2298526 |
|
| SMILES = O=S(CCC)CCCN(CC)CC(O)COc1ccc(C#N)cc1 |
|
| smiles = O=S(CCC)CCCN(CC)CC(O)COc1ccc(C#N)cc1 |
|
| InChI = 1/C18H28N2O3S/c1-3-11-24(22)12-5-10-20(4-2)14-17(21)15-23-18-8-6-16(13-19)7-9-18/h6-9,17,21H,3-5,10-12,14-15H2,1-2H3 |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| InChIKey = ZMHOBBKJBYLXFR-UHFFFAOYAP |
|
|
| StdInChI = 1S/C18H28N2O3S/c1-3-11-24(22)12-5-10-20(4-2)14-17(21)15-23-18-8-6-16(13-19)7-9-18/h6-9,17,21H,3-5,10-12,14-15H2,1-2H3 |
|
| StdInChI = 1S/C18H28N2O3S/c1-3-11-24(22)12-5-10-20(4-2)14-17(21)15-23-18-8-6-16(13-19)7-9-18/h6-9,17,21H,3-5,10-12,14-15H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZMHOBBKJBYLXFR-UHFFFAOYSA-N |
|
|
⚫ |
| StdInChIKey = ZMHOBBKJBYLXFR-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=18 | H=28 | N=2 | O=3 | S=1 |
|
| C=18 | H=28 | N=2 | O=3 | S=1 |
|
| molecular_weight = 352.5 g/mol |
|
|
}} |
|
}} |
|
|
|
|
|
'''Almokalant''' is drug used to treat ].<ref>{{cite journal | author = Wiesfeld A C; Crijns H J; Bergstrand R H; Almgren O; Hillege H L; Lie K I | title = Torsades de pointes with Almokalant, a new class III antiarrhythmic drug | journal = American heart journal | year = 1993 | volume = 126 | issue = 4 | pages = 1008–1011}}</ref> It is a ]. It has been found to have teratogenic effects in rats.<ref>, wrongdiagnosis.com</ref> |
|
'''Almokalant''' is a ] used to treat ].<ref name="Wiesfeld">{{cite journal | vauthors = Wiesfeld AC, Crijns HJ, Bergstrand RH, Almgren O, Hillege HL, Lie KI | title = Torsades de pointes with Almokalant, a new class III antiarrhythmic drug | journal = American Heart Journal | volume = 126 | issue = 4 | pages = 1008–1011 | date = October 1993 | pmid = 8213422 | doi = 10.1016/0002-8703(93)90726-p }}</ref> It is a ].<ref name="Wiesfeld" /> It has been found to have ] effects in rats.<ref>{{cite journal | vauthors = Wellfelt K, Sköld AC, Wallin A, Danielsson BR | title = Teratogenicity of the class III antiarrhythmic drug almokalant. Role of hypoxia and reactive oxygen species | journal = Reproductive Toxicology | volume = 13 | issue = 2 | pages = 93–101 | date = 1999-04-01 | pmid = 10213516 | doi = 10.1016/s0890-6238(98)00066-5 | bibcode = 1999RepTx..13...93W }}</ref> |
|
|
|
|
|
==References== |
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |
|
{{cardiovascular-drug-stub}} |