| Revision as of 20:10, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user tal← Previous edit |
Latest revision as of 06:33, 8 July 2023 edit undoIrruptive Creditor (talk | contribs)Extended confirmed users3,258 edits Removed outdated notice from 7 years ago.Tags: Visual edit Mobile edit Mobile web edit Advanced mobile edit |
| (24 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 451558531 |
|
| Watchedfields = changed |
|
|
⚫ |
| IUPAC_name = ''N''-acetamide |
| ⚫ |
| verifiedrevid = 449576556 |
|
|
|
| image = Aloracetam.svg |
| ⚫ |
| IUPAC_name = N-acetamide |
|
|
| image = Aloracetam_structure.png |
|
|
| width = 220 |
|
| width = 220 |
|
|
|
|
| Line 9: |
Line 9: |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_US = unscheduled |
|
| legal_status = Unscheduled |
|
|
|
| legal_US_comment = Not FDA approved |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 119610-26-3 |
|
| CAS_number = 119610-26-3 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 24: |
Line 26: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 155069 |
|
| ChemSpiderID = 155069 |
|
|
| ChEMBL = 2104637 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = U0RKZ75D0T |
|
| UNII = U0RKZ75D0T |
| Line 29: |
Line 32: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=11 | H=16 | N=2 | O=2 |
|
| C=11 | H=16 | N=2 | O=2 |
|
| molecular_weight = 208.257 g/mol |
|
|
| smiles = CC1=CC(=C(N1CCNC(=O)C)C)C=O |
|
| smiles = CC1=CC(=C(N1CCNC(=O)C)C)C=O |
|
| InChI = 1/C11H16N2O2/c1-8-6-11(7-14)9(2)13(8)5-4-12-10(3)15/h6-7H,4-5H2,1-3H3,(H,12,15) |
|
|
| InChIKey = ZUQSGZULKDDMEW-UHFFFAOYAU |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H16N2O2/c1-8-6-11(7-14)9(2)13(8)5-4-12-10(3)15/h6-7H,4-5H2,1-3H3,(H,12,15) |
|
| StdInChI = 1S/C11H16N2O2/c1-8-6-11(7-14)9(2)13(8)5-4-12-10(3)15/h6-7H,4-5H2,1-3H3,(H,12,15) |
| Line 39: |
Line 39: |
|
}} |
|
}} |
|
|
|
|
|
|
'''Aloracetam''' (]) is a ] described as a ] which is closely related to, but technically not of (as it lacks a ] ring), the ] family of compounds.<ref name="WHO2011">{{cite web | title = The Use of Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances | year = 2011 | publisher = World Health Organization | url =https://www.who.int/medicines/services/inn/StemBook_2011_Final.pdf | accessdate = 22 May 2015}}</ref><ref name="George1998">{{cite book| vauthors = George CF |title=Drug Therapy in Old Age|url=https://books.google.com/books?id=pTVsAAAAMAAJ|date=7 July 1998|publisher=Wiley|isbn=978-0-471-94149-1}}</ref><ref name="GanellinTriggle1996">{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=Z_mfTTIApVEC&pg=PA615|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=615–}}</ref> It was studied by ] for the treatment of ],<ref name="pmid16908974">{{cite journal | vauthors = Fischer F, Matthisson M, Herrling P | title = List of drugs in development for neurodegenerative diseases | journal = Neuro-Degenerative Diseases | volume = 1 | issue = 1 | pages = 50–70 | date = 2004 | pmid = 16908974 | doi = 10.1159/000077879 | doi-access = free }}</ref> but was never marketed. |
|
'''Aloracetam''' is a ] drug of the ] family, developed by ] for the treatment of ].<ref>Fischer F, Matthisson M, Herrling P. List of Drugs in Development for Neurodegenerative Diseases. ''Neurodegenerative Diseases'' 2004;1:50–70.</ref> |
|
|
|
|
|
|
|
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
==References== |
|
|
{{Reflist}} |
|
<references /> |
|
|
|
|
|
|
{{Racetams}} |
|
{{Racetams}} |
| Line 54: |
Line 52: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|