Misplaced Pages

Alpinumisoflavone: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 08:58, 14 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit Latest revision as of 17:18, 11 March 2024 edit undoCitation bot (talk | contribs)Bots5,458,246 edits Add: pmid, pages, issue, volume, journal, date, title, authors 1-7. | Use this bot. Report bugs. | Suggested by Marbletan | #UCB_webform 
(17 intermediate revisions by 13 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 399499912 | verifiedrevid = 413847961
| Name = Alpinumisoflavone | Name = Alpinumisoflavone
| ImageFile = Alpinumisoflavone.PNG | ImageFile = Alpinumisoflavone.svg
| ImageSize = 200px | ImageSize = 200px
| ImageName = Chemical structure of alpinumisoflavone | ImageName = Chemical structure of alpinumisoflavone
| IUPACName = 4′,5-Dihydroxy-6′′,6′′-dimethyl-6′′''H''-pyranoisoflavone
⚫ | IUPACName = 5-hydroxy-3-(4-hydroxyphenyl)-8,8-dimethylpyranochromen-4-one
| OtherNames = 5-hydroxy-7-(p-hydroxyphenyl)-2,2-dimethyl-2H-6H-benzodipyran-6-one<!-- <br> --> | SystematicName = 5-Hydroxy-3-(4-hydroxyphenyl)-8,8-dimethyl-4''H'',8''H''-benzodipyran-4-one
⚫ | OtherNames = 5-Hydroxy-3-(4-hydroxyphenyl)-8,8-dimethylpyranochromen-4-one
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4590280 | ChemSpiderID = 4590280
| InChIKey = RQAMSFTXEFSBPK-UHFFFAOYAG | InChIKey = RQAMSFTXEFSBPK-UHFFFAOYAG
| SMILES1 = O=C2/C(c1ccc(O)cc1)=C\Oc4c2c(O)c3\C=C/C(Oc3c4)(C)C | SMILES1 = O=C2/C(c1ccc(O)cc1)=C\Oc4c2c(O)c3\C=C/C(Oc3c4)(C)C
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 238628 | ChEMBL = 238628
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 17: Line 20:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RQAMSFTXEFSBPK-UHFFFAOYSA-N | StdInChIKey = RQAMSFTXEFSBPK-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 34086-50-5 | CASNo = 34086-50-5
| CASNo_Ref = | CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| CASOther =
| UNII = 6Q33HOF94Z
| PubChem = 5490139 | PubChem = 5490139
| SMILES = CC1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C(=CO3)C4=CC=C(C=C4)O)C | SMILES = CC1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C(=CO3)C4=CC=C(C=C4)O)C
Line 25: Line 30:
| MeSHName = | MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>20</sub>H<sub>16</sub>O<sub>5</sub> | Formula = C<sub>20</sub>H<sub>16</sub>O<sub>5</sub>
| MolarMass = 336.33 g/mol | MolarMass = 336.33 g/mol
| ExactMass = 336.099774 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
}} }}
}} }}
'''Alpinumisoflavone''' is a ], a type of isoflavone. It can be found in the bark of '']''<ref></ref>. It can also be found in the ] plant '']'' and is thought to be an ] agent<ref></ref> since it has been shown to kill the snails which transmit the schistosomiasis and also the larvae of the parasite itself<ref></ref>. '''Alpinumisoflavone''' is a ], a type of isoflavone. It can be found in the bark of '']''.<ref>{{cite journal | doi = 10.1016/S0367-326X(00)00210-0 | title = Pyranoisoflavones from Rinorea welwitschii | date = 2000 | last1 = Stewart | first1 = M. | last2 = Bartholomew | first2 = B. | last3 = Currie | first3 = F. | last4 = Abbiw | first4 = D.K. | last5 = Latif | first5 = Z. | last6 = Sarker | first6 = S.D. | last7 = Nash | first7 = R.J. | journal = Fitoterapia | volume = 71 | issue = 5 | pages = 595–597 | pmid = 11449519 }}</ref> It can also be found in the ] plant '']'' and is thought to be an ] agent<ref>{{cite journal | doi = 10.1016/0378-8741(95)01253-a | title = The plant molluscicide Millettia thonningii (Leguminosae) as a topical antischistosomal agent | date = 1995 | last1 = Perrett | first1 = S. | last2 = Whitfield | first2 = P.J. | last3 = Sanderson | first3 = L. | last4 = Bartlett | first4 = A. | journal = Journal of Ethnopharmacology | volume = 47 | issue = 1 | pages = 49–54 | pmid = 7564421 }}</ref> since it has been shown to kill the snails which transmit the schistosomiasis and also the larvae of the parasite itself.<ref>{{cite journal | doi = 10.1002/ptr.2650090603| title = Aqueous degradation of isoflavonoids in an extract of ''Millettia thonningii'' (Leguminosae) which is larvicidal towards schistosomes| date = 1995| last1 = Perrett| first1 = Sheena| last2 = Whitfield| first2 = Philip J.| journal = Phytotherapy Research| volume = 9| issue = 6| pages = 401–404| s2cid = 85035592}}</ref>


==References== == References ==
{{reflist}} {{reflist}}


{{isoflavone}} {{isoflavone}}


]
]



{{polyphenol-stub}} {{aromatic-stub}}
Alpinumisoflavone: Difference between revisions Add topic