| Revision as of 20:15, 20 March 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits removed Category:Decalines; added Category:Decalins using HotCat← Previous edit |
Latest revision as of 13:01, 27 February 2024 edit undoKofi Meija (talk | contribs)Extended confirmed users5,156 edits Fixed some formatting issues and improved the overall clarity of the content. |
| (40 intermediate revisions by 29 users not shown) |
| Line 1: |
Line 1: |
|
{{orphan|date=December 2009}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 399503456 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Ambrein.svg |
|
|
⚫ |
| verifiedrevid = 419851613 |
| ⚫ |
|ImageSize=160 |
|
|
⚫ |
| ImageFile = Ambrein.svg |
| ⚫ |
|IUPACName=(1R,2R,8aS)-1--4-methylhex-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|
|
⚫ |
| ImageSize = 160 |
| ⚫ |
|OtherNames=Ambrein |
|
|
⚫ |
| IUPACName = (1''R'',2''R'',4a''S'',8a''S'')-1-<nowiki/>{(3''E'')-6--4-methylhex-3-en-1-yl}-2,5,5,8a-tetramethyldecahydronaphthalen-2-ol |
|
⚫ |
| OtherNames = Ambrein |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10000763 |
|
| ChemSpiderID = 10000763 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 78306 |
|
| InChI = 1/C30H52O/c1-22(15-16-24-23(2)13-10-18-27(24,3)4)12-9-14-26-29(7)20-11-19-28(5,6)25(29)17-21-30(26,8)31/h12,24-26,31H,2,9-11,13-21H2,1,3-8H3/b22-12+/t24-,25?,26-,29+,30-/m1/s1 |
|
| InChI = 1/C30H52O/c1-22(15-16-24-23(2)13-10-18-27(24,3)4)12-9-14-26-29(7)20-11-19-28(5,6)25(29)17-21-30(26,8)31/h12,24-26,31H,2,9-11,13-21H2,1,3-8H3/b22-12+/t24-,25?,26-,29+,30-/m1/s1 |
|
| InChIKey = BIADSXOKHZFLSN-CQDHYIGWBE |
|
| InChIKey = BIADSXOKHZFLSN-CQDHYIGWBE |
| Line 17: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BIADSXOKHZFLSN-CQDHYIGWSA-N |
|
| StdInChIKey = BIADSXOKHZFLSN-CQDHYIGWSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=473-03-0 |
|
| CASNo = 473-03-0 |
| ⚫ |
| PubChem= 11826112 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES= C/C(=C\CC12(CCCC(C2CC1(C)O)(C)C)C)/CC3C(=C)CCCC3(C)C |
|
|
|
| UNII = 1N9JB373FJ |
|
⚫ |
| PubChem = 11826112 |
|
⚫ |
| SMILES = C/C(=C\CC12(CCCC(C2CC1(C)O)(C)C)C)/CC3C(=C)CCCC3(C)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=30 | H=52 | O=1 |
|
| C = 30 | H = 52 | O = 1 |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Ambrein''' is a fragrant substance that is used in the perfume industry. It is the chief constituent of ], a secretion from the digestive system of the ], and has been suggested as the possible active component producing the supposed ] effects of ambergris.<ref>Sandroni P. Aphrodisiacs past and present: a historical review. ''Clinical Autonomic Research''. 2001 Oct;11(5):303-7. {{DOI|10.1007/BF02332975}} PMID 11758796</ref> |
|
'''Ambrein''' is a ] alcohol that is the chief constituent of ], a secretion from the digestive system of the ]. It has been suggested as the possible active component producing the supposed ] effects of ambergris.<ref>{{cite journal | vauthors = Sandroni P | title = Aphrodisiacs past and present: a historical review | journal = Clinical Autonomic Research | volume = 11 | issue = 5 | pages = 303–7 | date = October 2001 | pmid = 11758796 | doi = 10.1007/BF02332975 | s2cid = 40455528 }}</ref> Although ambrein itself is odorless, it serves as the biological precursor for aromatic derivatives such as ] and is thought to possess fixative properties for other odorants. |
|
|
|
|
|
⚫ |
It has been shown to act as an ]<ref>{{cite journal | vauthors = Taha SA | title = Studies on the mode of action of ambrein as a new antinociceptive compound | journal = Japanese Journal of Pharmacology | volume = 60 | issue = 2 | pages = 67–71 | date = October 1992 | pmid = 1479744 | doi = 10.1254/jjp.60.67 | doi-access = free }}</ref> and has been proven to increase sexual behavior in rats,<ref>{{cite journal | vauthors = Taha SA, Islam MW, Ageel AM | title = Effect of ambrein, a major constituent of ambergris, on masculine sexual behavior in rats | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 329 | issue = 2 | pages = 283–94 | year = 1995 | pmid = 8540767 }}</ref> providing some support for its traditional aphrodisiac use. |
|
It is a ]. |
|
|
|
|
|
|
|
Apart from its supposed aphrodisiac effects, ambrein has been shown to decrease spontaneous contractions of smooth muscles in rats, guinea pigs, and rabbits. It reduces these contractions by serving as an antagonist and interfering with Ca<sup>2+</sup> ions from outside the cell.<ref>{{cite journal | vauthors = Taha SA, Raza M, El-Khawad IE | title = Effect of ambrein on smooth muscle responses to various agonists | journal = Journal of Ethnopharmacology | volume = 60 | issue = 1 | pages = 19–26 | date = February 1998 | pmid = 9533428 | doi = 10.1016/s0378-8741(97)00126-8 }}</ref> |
| ⚫ |
It has been shown to act as an ]<ref>Taha SA. Studies on the mode of action of ambrein as a new antinociceptive compound. ''Japanese Journal of Pharmacology''. 1992 Oct;60(2):67-71. PMID 1479744</ref> and increase sexual behaviour in rats,<ref>Taha SA, Islam MW, Ageel AM. Effect of ambrein, a major constituent of ambergris, on masculine sexual behavior in rats. ''Archives Internationales de Pharmacodynamie et de Therapie''. 1995 Mar-Apr;329(2):283-94. PMID 8540767</ref> providing some support for its traditional aphrodisiac use. |
|
|
|
|
|
|
==References== |
|
==Discovery== |
|
|
In 1946, ] and Lardon "established that the fragrance of ] is based on the ] (named) ambrein".<ref name=ruzicka46>{{cite journal |doi=10.1002/hlca.19460290414|title=Zur Kenntnis der Triterpene. (105. Mitteilung) Über das Ambreïn, einen Bestandteil des grauen Ambra|year=1946|last1=Ruzicka|first1=L.|last2=Lardon|first2=F.|journal=Helvetica Chimica Acta|volume=29|issue=4|pages=912–921}}</ref><ref name="frs">{{cite journal | last1 = Prelog | first1 = Vladimir | author-link1 = Vladimir Prelog| last2 = Jeger | first2 = Oskar | doi = 10.1098/rsbm.1980.0013 | title = Leopold Ruzicka (13 September 1887 – 26 September 1976) | journal = ] | volume = 26 | pages = 411–501 | year = 1980 | doi-access = free }}</ref><ref name="hillier19">{{cite journal |doi=10.1530/JOE-19-0084|title=Terpenes, hormones and life: Isoprene rule revisited|year=2019|last1=Hillier|first1=Stephen G.|last2=Lathe|first2=Richard|journal=Journal of Endocrinology|volume=242|issue=2|pages=R9–R22|pmid=31051473|doi-access=free}}</ref> |
|
<references/> |
|
|
|
|
|
|
== Biosynthesis == |
|
|
Ambrein is synthesized from the common triterpenoid precursor ]. The ] (SHC) catalyzes the cyclization of ] into the monocyclic 3-deoxyachilleol A. ] (BmeTC) converts 3-deoxyachilleol A into the tricyclic ambrein.<ref>{{Cite journal| vauthors = Di K, Qinggele C, Fanglong Z, Ting L, Wenyu L |title=Heterologous biosynthesis of triterpenoid ambrein in engineered Escherichia coli|journal=Biotechnology Letters|volume=40|issue=2|pages= 399–404 |date=February 2018 |doi= 10.1007/s10529-017-2483-2 |pmid=29204767|s2cid=3267910| issn= 1573-6776}}</ref> |
|
|
|
|
|
== References == |
|
|
] |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
| Line 49: |
Line 61: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
{{biochem-stub}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|