| Revision as of 07:07, 31 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified and watched fields - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot← Previous edit |
Latest revision as of 19:59, 23 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Phenol ethers; added Category:4-Methoxyphenyl compounds using HotCat |
| (24 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 447616955 |
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 399503807 |
|
|
| IUPAC_name = 2-(dibutylamino)-2-(4-methoxyphenyl)acetamide |
|
| IUPAC_name = 2-(dibutylamino)-2-(4-methoxyphenyl)acetamide |
|
| image = Ambucetamide.svg |
|
| image = Ambucetamide.svg |
| Line 16: |
Line 16: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 23: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 519-88-0 |
|
| CAS_number = 519-88-0 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 10616 |
|
| PubChem = 10616 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2104638 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10171 |
|
| ChemSpiderID = 10171 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 131B408RZI |
|
| UNII = 131B408RZI |
|
|
|
|
| Line 40: |
Line 43: |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=17 | H=28 | N=2 | O=2 |
|
| C=17 | H=28 | N=2 | O=2 |
|
| molecular_weight = 292.417 g·mol<sup>−1</sup> |
|
|
| smiles = O=C(N)C(c1ccc(OC)cc1)N(CCCC)CCCC |
|
| smiles = O=C(N)C(c1ccc(OC)cc1)N(CCCC)CCCC |
|
| InChI = 1/C17H28N2O2/c1-4-6-12-19(13-7-5-2)16(17(18)20)14-8-10-15(21-3)11-9-14/h8-11,16H,4-7,12-13H2,1-3H3,(H2,18,20) |
|
|
| InChIKey = WUSAVCGXMSWMQM-UHFFFAOYAD |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H28N2O2/c1-4-6-12-19(13-7-5-2)16(17(18)20)14-8-10-15(21-3)11-9-14/h8-11,16H,4-7,12-13H2,1-3H3,(H2,18,20) |
|
| StdInChI = 1S/C17H28N2O2/c1-4-6-12-19(13-7-5-2)16(17(18)20)14-8-10-15(21-3)11-9-14/h8-11,16H,4-7,12-13H2,1-3H3,(H2,18,20) |
| Line 50: |
Line 50: |
|
}} |
|
}} |
|
|
|
|
|
'''Ambucetamide''' is an ] found to be particularly effective for the relief of ] pain. It was discovered in 1953 by ]. |
|
'''Ambucetamide''' is an ] found to be particularly effective for the relief of ]. It was discovered in 1953 by ]. |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{Reflist}} |
|
* Hoekstra JB, Fisher DS, Cull KM, Tisch DE, Dickison HL., Studies with a uterine antispasmodic, ambucetamide, J Am Pharm Assoc Am Pharm Assoc (Baltim). 1957 Sep;46(9):564-8. |
|
|
|
* {{cite journal | vauthors = Hoekstra JB, Fisher DS, Cull KM, Tisch DE, Dickison HL | title = Studies with a uterine antispasmodic, ambucetamide | journal = Journal of the American Pharmaceutical Association | volume = 46 | issue = 9 | pages = 564–568 | date = September 1957 | pmid = 13491452 | doi = 10.1002/jps.3030460915 }} |
|
* Pickles VR, Clitheroe HJ., The effects of ambucetamide on human myometrial and other preparations, and its antagonism to the menstrual stimulant, Br J Pharmacol Chemother. 1960 Mar;15:128-30. |
|
|
|
* {{cite journal | vauthors = Pickles VR, Clitheroe HJ | title = The effects of ambucetamide on human myometrial and other preparations, and its antagonism to the menstrual stimulant | journal = British Journal of Pharmacology and Chemotherapy | volume = 15 | issue = 1| pages = 128–30 | date = March 1960 | pmid = 14432761 | pmc = 1481989 | doi = 10.1111/j.1476-5381.1960.tb01220.x | url = }} |
|
|
|
| ⚫ |
{{drug-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
⚫ |
{{genito-urinary-drug-stub}} |
|
] |
|