Revision as of 16:51, 11 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 04:12, 24 April 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct IUPAC name |
(12 intermediate revisions by 8 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 401797593 |
|
|
|
| Watchedfields = changed |
⚫ |
|ImageFile=Ambutonium bromide.png |
|
|
⚫ |
| verifiedrevid = 401799175 |
|
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Ambutonium bromide.png |
|
|IUPACName=(4-Amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium bromide |
|
|
|
| PIN=4-Amino-''N''-ethyl-''N'',''N''-dimethyl-4-oxo-3,3-diphenylbutan-1-aminium bromide |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7977 |
|
| ChemSpiderID = 7977 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2105972 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H26N2O.BrH/c1-4-22(2,3)16-15-20(19(21)23,17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14H,4,15-16H2,1-3H3,(H-,21,23);1H |
|
| StdInChI = 1S/C20H26N2O.BrH/c1-4-22(2,3)16-15-20(19(21)23,17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14H,4,15-16H2,1-3H3,(H-,21,23);1H |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VTAGVKVPFBOVRM-UHFFFAOYSA-N |
|
| StdInChIKey = VTAGVKVPFBOVRM-UHFFFAOYSA-N |
|
| SMILES1 = .O=C(N)C(c1ccccc1)(c2ccccc2)CC(CC)(C)C |
|
| SMILES = .O=C(N)C(c1ccccc1)(c2ccccc2)CC(CC)(C)C |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=115-51-5 |
|
| CASNo=115-51-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem=8276 |
|
|
|
| UNII = 9J8YA3ZT14 |
|
| SMILES=CC(C)(C)CCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N. |
|
|
⚫ |
| PubChem=8276 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>20</sub>H<sub>27</sub>BrN<sub>2</sub>O |
|
| Formula=C<sub>20</sub>H<sub>27</sub>BrN<sub>2</sub>O |
|
| MolarMass=391.35 g/mol |
|
| MolarMass=391.35 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
|
| ATCCode_prefix = A03 |
⚫ |
| MainHazards= |
|
|
|
| ATCCode_suffix = CA07 |
⚫ |
| FlashPt= |
|
|
|
| ATC_Supplemental = in combination with |
|
| Autoignition= |
|
|
|
}} |
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Ambutonium bromide''' is an ]. |
|
'''Ambutonium bromide''' is a ]. |
|
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
{{pharmacology-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |