Revision as of 10:42, 12 November 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: StdInChI StdInChIKey.← Previous edit |
Latest revision as of 06:06, 17 June 2024 edit undoWhywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,178 editsm script-assisted date audit and style fixes per MOS:NUM |
(41 intermediate revisions by 28 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Cholesterol and blood pressure medication}} |
|
|
{{Use dmy dates|date=June 2024}} |
|
|
{{cs1 config |name-list-style=vanc |display-authors=6}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 424685654 |
|
| type = combo |
|
|
| image = Amlodipine.png |
|
| image = Atorvastatin.svg |
|
|
| width = 250 |
|
| image2 = Lipitor.png |
|
|
| component1 = Amlodipine |
|
| image2 = Amlodipine.svg |
|
|
| width2 = 185 |
⚫ |
| class1 = ] |
|
|
|
|
⚫ |
| component2 = Atorvastatin |
|
|
|
<!--Combo data--> |
⚫ |
| class2 = ] |
|
|
| ChemSpiderID = 7987512 |
|
| type = combo |
|
|
| component1 = Amlodipine |
|
| InChI = 1/C33H35FN2O5.C20H25ClN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);5-8,17,23H,4,9-11,22H2,1-3H3/t26-,27-;/m1./s1 |
|
|
⚫ |
| class1 = ] |
|
| smiles = Clc1ccccc1C2C(\C(=O)OC)=C(/N\C(=C2\C(=O)OCC)COCCN)C.O=C(O)C(O)C(O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C |
|
|
⚫ |
| component2 = Atorvastatin |
|
| InChIKey = PEAJXAZCGDWDGS-CNZCJKERBU |
|
|
⚫ |
| class2 = ] |
|
| StdInChI = 1S/C33H35FN2O5.C20H25ClN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);5-8,17,23H,4,9-11,22H2,1-3H3/t26-,27-;/m1./s1 |
|
|
|
|
|
| StdInChIKey = PEAJXAZCGDWDGS-CNZCJKERSA-N |
|
|
|
<!--Clinical data--> |
⚫ |
| CAS_number = |
|
|
|
| tradename = Caduet, Envacar, others |
⚫ |
| ATC_prefix = C10 |
|
|
|
| Drugs.com = {{drugs.com|ppa|amlodipine-and-atorvastatin}} |
⚫ |
| ATC_suffix = BX03 |
|
|
|
| DailyMedID = Caduet |
|
|
| pregnancy_AU = D |
|
⚫ |
| pregnancy_US = N |
|
⚫ |
| pregnancy_category = Contraindicated |
|
|
| legal_AU = S4 |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = Rx-only |
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = ] |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 858659-02-6 |
|
⚫ |
| ATC_prefix = C10 |
|
⚫ |
| ATC_suffix = BX03 |
|
| PubChem = 9811759 |
|
| PubChem = 9811759 |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| ChemSpiderID = 7987512 |
⚫ |
| pregnancy_US = X |
|
|
|
| KEGG = D08488 |
⚫ |
| pregnancy_category= |
|
|
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
<!--Chemical data--> |
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = Rx-only |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
|
|
|
The drug combination '''atorvastatin/amlodipine''' (trade names '''Caduet''' in the ] and '''Envacar''' elsewhere) is a medication approved by the ] (FDA) for the treatment of ] and ]. It is a ] drug containing the ] ] and the ] ]. It is being marketed by the ] ].<ref>{{cite web|url=http://www.fda.gov/Safety/MedWatch/SafetyInformation/ucm202933.htm|format=PDF|title=CADUET (amlodipine besylate/atorvastatin calcium) Tablets|month=February | year=2010|work=NDA 21-540/S-009|publisher=]|accessdate=2010-09-25}}</ref> |
|
|
|
'''Amlodipine/atorvastatin''', sold under the brand name '''Caduet''' among others, is a ] medication for the treatment of ] and ]. It contains a ] and a ].<ref name="Curran 2010 pp. 191–213">{{cite journal | last=Curran | first=Monique P. | title=Amlodipine/Atorvastatin | journal=Drugs | publisher=]| volume=70 | issue=2 | year=2010 | issn=0012-6667 | doi=10.2165/11204420-000000000-00000 | pages=191–213| pmid=20108992 | s2cid=209144335 }}</ref><ref>{{cite journal | vauthors = Devabhaktuni M, Bangalore S | title = Fixed combination of amlodipine and atorvastatin in cardiovascular risk management: patient perspectives | journal = Vascular Health and Risk Management | volume = 5 | issue = 1 | pages = 377–87 | date = 2009 | pmid = 19475775 | pmc = 2686256 | doi = 10.2147/vhrm.s3339 | doi-access = free }}</ref> |
|
|
|
|
|
== Society and culture == |
|
|
=== Brand names === |
|
|
Amlodipine/atorvastatin is marketed under the brand name Caduet in the United States, Australia, and Russia, and Envacar in the Philippines.<ref>{{cite web |url=https://www.drugs.com/international/caduet.html |url-status=dead |archive-url=https://web.archive.org/web/20140619222725/http://www.drugs.com/international/caduet.html |archive-date=19 June 2014 |title=Caduet - Drugs.com}}</ref><ref>{{cite web |url=https://www.drugs.com/international/envacar.html |url-status=dead |archive-url=https://web.archive.org/web/20140620180116/http://www.drugs.com/international/envacar.html |archive-date=20 June 2014 |title=Envacar - Drugs.com}}</ref> |
|
|
|
|
|
In some countries Caduet is marketed by ] after Upjohn was spun off from Pfizer.<ref>{{cite web | title=Pfizer Completes Transaction to Combine Its Upjohn Business with Mylan | publisher=Pfizer | via=Business Wire | date=16 November 2020 | url=https://www.businesswire.com/news/home/20201116005378/en/ | access-date=17 June 2024}}</ref><ref>{{cite web | title=Caduet | website=Pfizer | url=https://www.pfizer.com/products/product-detail/caduet | access-date=17 June 2024}}</ref><ref>{{cite web | title=Brands | website=Viatris | date=16 November 2020 | url=https://www.viatris.com/en/products/brands | access-date=17 June 2024}}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{Lipid modifying agents}} |
|
== External links == |
|
|
|
{{Portal bar|Medicine}} |
|
* (caduet.com) |
|
|
|
|
|
|
|
{{DEFAULTSORT:Amlodipine Atorvastatin}} |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|