| Revision as of 09:18, 8 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|erro← Previous edit |
Latest revision as of 20:01, 23 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Phenol ethers; added Category:4-Methoxyphenyl compounds using HotCat |
| (18 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 443649688 |
|
⚫ |
| IUPAC_name = 5,6-bis(4-methoxyphenyl)-3-methyl-1,2,4-triazine |
|
⚫ |
| image = Anitrazafen structure.png |
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| metabolism = |
|
⚫ |
| excretion = |
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 63119-27-7 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| PubChem = 44410 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEMBL = 2105947 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 40409 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 2Y065P7MYR |
|
| UNII = 2Y065P7MYR |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| verifiedrevid = 443210436 |
|
|
⚫ |
| KEGG = D02948 |
| ⚫ |
|IUPAC_name = 5,6-bis(4-methoxyphenyl)-3-methyl-1,2,4-triazine |
|
|
⚫ |
| synonyms = |
| ⚫ |
| image=Anitrazafen structure.png |
|
|
|
<!--Chemical data--> |
|
| width= |
|
|
⚫ |
| C=18 | H=17 |
|
|
| N=3 | O=2 |
|
⚫ |
| smiles = n2c(nnc(c1ccc(OC)cc1)c2c3ccc(OC)cc3)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H17N3O2/c1-12-19-17(13-4-8-15(22-2)9-5-13)18(21-20-12)14-6-10-16(23-3)11-7-14/h4-11H,1-3H3 |
|
| StdInChI = 1S/C18H17N3O2/c1-12-19-17(13-4-8-15(22-2)9-5-13)18(21-20-12)14-6-10-16(23-3)11-7-14/h4-11H,1-3H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HDNJXZZJFPCFHG-UHFFFAOYSA-N |
|
| StdInChIKey = HDNJXZZJFPCFHG-UHFFFAOYSA-N |
| ⚫ |
| CAS_number=63119-27-7 |
|
|
| CASNo_Ref = {{cascite|??|??}} |
|
| ⚫ |
| ATC_prefix= |
|
|
| ATC_suffix= |
|
|
| ATC_supplemental= |
|
| ⚫ |
| PubChem=44410 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank= |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID=40409 |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = D02948 |
|
| ⚫ |
| C=18 | H=17 | N=3 | O=2 |
|
|
| molecular_weight = 307.35 g/mol |
|
| ⚫ |
| synonyms = |
|
| ⚫ |
| bioavailability= |
|
| ⚫ |
| metabolism = |
|
|
| elimination_half-life= |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration= |
|
| ⚫ |
| smiles = n2c(nnc(c1ccc(OC)cc1)c2c3ccc(OC)cc3)C |
|
|
}} |
|
}} |
|
|
|
|
|
Anitrazifen is a drug displaying ] activity. See also for ]. |
|
Anitrazifen is a drug displaying ] activity.<ref name="pmid6429314">{{cite journal | vauthors = Cullen E | title = Novel anti-inflammatory agents | journal = Journal of Pharmaceutical Sciences | volume = 73 | issue = 5 | pages = 579–89 | date = May 1984 | pmid = 6429314 | doi = 10.1002/jps.2600730503 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{NSAIDs}} |
|
|
{{Analgesics}} |
|
{{Analgesics}} |
|
|
{{Prostanoidergics}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |