| Revision as of 21:54, 29 October 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 11:53, 29 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Nitrobenzene derivatives; added Category:2-Nitrophenyl compounds using HotCat |
| (19 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Antihypertensive drug of the calcium channel blocker class}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 443289552 |
|
| verifiedrevid = 458034815 |
|
| IUPAC_name = ''O''5-methyl ''O''3-(2-oxopropyl) |
|
| IUPAC_name = ''O''5-methyl ''O''3-(2-oxopropyl) |
|
| image = Aranidipine.svg |
|
| image = Aranidipine.svg |
|
|
| alt = Skeletal formula of aranidipine |
|
|
| image2 = Aranidipine-3D-balls.png |
|
|
| alt2 = Ball-and-stick model of the aranidipine molecule |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 22: |
Line 26: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 86780-90-7 |
|
| CAS_number = 86780-90-7 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 30: |
Line 35: |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 2225 |
|
| PubChem = 2225 |
|
|
| ChEMBL = 2104030 |
| ⚫ |
| ChemSpiderID = 2139 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 2139 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
| Line 40: |
Line 47: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=20 | N=2 | O=7 |
|
| C=19 | H=20 | N=2 | O=7 |
|
| molecular_weight = 388.37 g/mol |
|
|
| smiles = CC1=C(C(C(=C(N1)C)C(=O)OCC(=O)C)C2=CC=CC=C2(=O))C(=O)OC |
|
| smiles = CC1=C(C(C(=C(N1)C)C(=O)OCC(=O)C)C2=CC=CC=C2(=O))C(=O)OC |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI = 1/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3 |
|
| StdInChI = 1S/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3 |
|
| InChIKey = NCUCGYYHUFIYNU-UHFFFAOYAZ |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3 |
|
|
| StdInChIKey = NCUCGYYHUFIYNU-UHFFFAOYSA-N |
|
| StdInChIKey = NCUCGYYHUFIYNU-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
'''Aranidipine''' (], trade name '''Sapresta''') is a ]. It is a dihydropyridine derivative with two active metabolites (M-1α and M-1β). It was developed by Maruko Seiyaku and has the formula methyl 2-oxopropyl 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylate. Its main use is as a hypotensive, reducing blood pressure.<ref>{{cite web |title=Aranidipine |url=https://pubchem.ncbi.nlm.nih.gov/compound/aranidipine#section=Top |website=PubMed |access-date=23 December 2018}}</ref><ref>{{cite book | vauthors = Gelatsis P | chapter = To Market, to Market – 1996| veditors = Bristol JA, Robertson DW, Doherty AM, Hagmann WK, Plattner JJ, Wong WW, Trainor GL |title=Annual Reports in Medicinal Chemistry |date=1997 |publisher=Academic Press |location=San Diego |isbn=978-0-08-058376-1 |page=306 | chapter-url=https://books.google.com/books?id=oJY8LrP_JysC&dq=Aranidipine&pg=PA306}}</ref> |
|
'''Aranidipine''' (], trade name '''Sapresta''') is a ]. |
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Calcium channel blockers}} |
|
{{Calcium channel blockers}} |
| Line 55: |
Line 64: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|