| Revision as of 14:43, 24 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Latest revision as of 22:24, 7 January 2024 edit undoMichael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Chlorobenzenes to Chlorobenzene derivatives |
| (19 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 456243962 |
|
| verifiedrevid = 457153232 |
|
| IUPAC_name = 9--6-purinamine |
|
| IUPAC_name = 9--6-purinamine |
|
| image = arprinocid.png |
|
| image = arprinocid.png |
|
|
| image2 = Arprinocid molecule ball.png |
|
|
| alt2 = Ball-and-stick model of the arprinocid molecule |
|
|
| width2 = 240 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 55779-18-5 --> |
|
| CAS_number = 55779-18-5 |
|
| ATCvet = yes |
|
| ATCvet = yes |
|
| ATC_prefix = P51 |
|
| ATC_prefix = P51 |
|
| ATC_suffix = AX11 |
|
| ATC_suffix = AX11 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 321993 |
|
| ChEMBL = 321993 |
|
| PubChem = 41574 |
|
| PubChem = 41574 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 6A0XTA8ZUH |
|
| UNII = 6A0XTA8ZUH |
| Line 38: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=9 | Cl=1 | F=1 | N=5 |
|
| C=12 | H=9 | Cl=1 | F=1 | N=5 |
|
| molecular_weight = 277.68 g/mol |
|
|
| smiles = C1=CC(=C(C(=C1)Cl)CN2C=NC3=C2N=CN=C3N)F |
|
| smiles = C1=CC(=C(C(=C1)Cl)CN2C=NC3=C2N=CN=C3N)F |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 37936 |
|
| ChemSpiderID = 37936 |
|
| InChI = 1/C12H9ClFN5/c13-8-2-1-3-9(14)7(8)4-19-6-18-10-11(15)16-5-17-12(10)19/h1-3,5-6H,4H2,(H2,15,16,17) |
|
|
| InChIKey = NAPNOSFRRMHNBJ-UHFFFAOYAV |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H9ClFN5/c13-8-2-1-3-9(14)7(8)4-19-6-18-10-11(15)16-5-17-12(10)19/h1-3,5-6H,4H2,(H2,15,16,17) |
|
| StdInChI = 1S/C12H9ClFN5/c13-8-2-1-3-9(14)7(8)4-19-6-18-10-11(15)16-5-17-12(10)19/h1-3,5-6H,4H2,(H2,15,16,17) |
| Line 51: |
Line 55: |
|
}} |
|
}} |
|
|
|
|
|
|
'''Arprinocid''' is a ] (or more likely a coccidiocide, i.e. a drug killing '']'' parasites) used in veterinary medicine.<ref>{{cite journal | vauthors = McQuistion TE, McDougald LR | title = Anticoccidial activity of arprinocid and halofuginone | journal = Veterinary Parasitology | volume = 9 | issue = 1 | pages = 27–33 | date = October 1981 | pmid = 7201182 | doi = 10.1016/0304-4017(81)90004-2 }}</ref> |
|
'''Arprinocid''' is a ] used in veterinary medicine. |
|
|
|
==Synthesis== |
|
|
|
|
|
] R. J. Tull, G. D. Hartman, and L. M. Weinstock, {{US Patent|4,098,787}} (1978).]] |
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antiinfective-drug-stub}} |
|
{{antiinfective-drug-stub}} |