| Revision as of 13:53, 28 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Latest revision as of 01:39, 30 May 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,373 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (17 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 457818666 |
|
| IUPAC_name = (5a''S'',6''R'',8a''S'',9''R'',10''S'',12''R'',12a''R'')-10-ethoxy-3,6,9-trimethyldecahydro-3,12-epoxydioxepinoisochromene |
|
| IUPAC_name = (5a''S'',6''R'',8a''S'',9''R'',10''S'',12''R'',12a''R'')-10-ethoxy-3,6,9-trimethyldecahydro-3,12-epoxydioxepinoisochromene |
|
| image = Artemotil.svg |
|
| image = Artemotil.svg |
| Line 22: |
Line 26: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 75887-54-6 --> |
|
| CAS_number = 75887-54-6 |
|
| ATC_prefix = P01 |
|
| ATC_prefix = P01 |
|
| ATC_suffix = BE04 |
|
| ATC_suffix = BE04 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| ⚫ |
| PubChem = 72416 |
|
|
| DrugBank = |
|
| DrugBank = |
|
⚫ |
| PubChem = 3000469 |
| ⚫ |
| ChemSpiderID = 16735673 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
⚫ |
| ChemSpiderID = 2272064 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = XGL7GFB9YI |
|
| UNII = XGL7GFB9YI |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 301267 --> |
|
|
|
| ChEMBL = 301267 |
|
|
|
|
|
<!--Chemical data--> |
|
| C=17 | H=28 | O=5 |
|
| C=17 | H=28 | O=5 |
|
⚫ |
| smiles = CCO1(2CC(324(O1)O(CC3)(OO4)C)C)C |
|
| molecular_weight = 312.401 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| smiles = C1CC3C42OO(C)(CC12)O4O(OCC)3C |
|
|
| InChI = 1/C17H28O5/c1-5-18-14-11(3)13-7-6-10(2)12-8-9-16(4)20-15(19-14)17(12,13)22-21-16/h10-15H,5-9H2,1-4H3/t10-,11-,12+,13+,14+,15-,16-,17?/m1/s1 |
|
| StdInChI = 1S/C17H28O5/c1-5-18-14-11(3)13-7-6-10(2)12-8-9-16(4)20-15(19-14)17(12,13)22-21-16/h10-15H,5-9H2,1-4H3/t10-,11-,12+,13+,14+,15-,16-,17-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| InChIKey = NLYNIRQVMRLPIQ-LCAQWSNOBS |
|
| StdInChIKey = NLYNIRQVMRLPIQ-XQLAAWPRSA-N |
|
| StdInChI = 1S/C17H28O5/c1-5-18-14-11(3)13-7-6-10(2)12-8-9-16(4)20-15(19-14)17(12,13)22-21-16/h10-15H,5-9H2,1-4H3/t10-,11-,12+,13+,14+,15-,16-,17?/m1/s1 |
|
|
| StdInChIKey = NLYNIRQVMRLPIQ-LCAQWSNOSA-N |
|
|
}} |
|
}} |
|
'''Artemotil''' (]; also known as '''β-arteether'''), is a fast acting blood ] specifically indicated for the treatment of ]-resistant ] and ] cases. It is a semi-synthetic derivative of ], a ] of the Chinese plant '']''. It is currently only used as a second line drug in severe cases of malaria. |
|
'''Artemotil''' (]; also known as '''β-arteether'''<ref>{{cite web|url=https://www.who.int/medicines/publications/pharmacopoeia/Artemotil.pdf?ua=1 |accessdate=10 April 2019 |title=The International Pharmacopoeia - Sixth Edition - Artemotil |date=2016}}</ref>), is a fast acting blood ] specifically indicated for the treatment of ]-resistant ] and ] cases.<ref name="Yeates_2002">{{cite journal | vauthors = Yeates RA | title = Artemotil Artecef | journal = Current Opinion in Investigational Drugs | location = London, England | volume = 3 | issue = 4 | pages = 545–9 | date = April 2002 | pmid = 12090721 | doi = | url = }}</ref> It is a semi-synthetic derivative of ], a ] of the Chinese plant '']''. It is currently only used as a second line drug in severe cases of malaria. |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Antimalarials}} |
|
{{Antimalarials}} |
| Line 47: |
Line 59: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
{{antimicrobial-stub}} |
|
{{antimicrobial-stub}} |
|
|
|
|
] |
|