| Revision as of 20:31, 9 May 2011 editMystBot (talk | contribs)177,678 editsm r2.7.1) (robot Adding: pl:Aurantynidyna← Previous edit |
Latest revision as of 02:33, 30 April 2023 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,468 edits USer:LegionMammal978: the chembox field is "SystematicName" not "Systematicname" (need capital 'N') |
| (9 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 399534181 |
|
| verifiedrevid = 428309186 |
|
|ImageFile=Aurantinidin2.svg |
|
| ImageFile=Aurantinidin2.svg |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName=2-(4-Hydroxyphenyl)chromenylium-3,5,6,7-tetrol |
|
|
|
| IUPACName=3,4′,5,6,7-Pentahydroxyflavylium |
| ⚫ |
|OtherNames=6-Hydroxypelargonidine |
|
|
|
| SystematicName=3,5,6,7-Tetrahydroxy-2-(4-hydroxyphenyl)-1λ<sup>4</sup>-benzopyran-1-ylium |
|
⚫ |
| OtherNames=6-Hydroxypelargonidine |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 390278 |
|
| ChemSpiderID = 390278 |
|
| InChI = 1/C15H10O6/c16-8-3-1-7(2-4-8)15-11(18)5-9-12(21-15)6-10(17)14(20)13(9)19/h1-6H,(H4-,16,17,18,19,20)/p+1 |
|
| InChI = 1/C15H10O6/c16-8-3-1-7(2-4-8)15-11(18)5-9-12(21-15)6-10(17)14(20)13(9)19/h1-6H,(H4-,16,17,18,19,20)/p+1 |
| Line 14: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VGONRPRFJVEJKB-UHFFFAOYSA-O |
|
| StdInChIKey = VGONRPRFJVEJKB-UHFFFAOYSA-O |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=25041-66-1 |
|
| CASNo=25041-66-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=441648 |
|
|
|
| UNII = D53KRD9FB8 |
| ⚫ |
| SMILES = Oc1ccc(cc1)c3c2cc(O)c(O)c(O)c2cc3O |
|
|
⚫ |
| PubChem=441648 |
|
⚫ |
| SMILES = Oc1ccc(cc1)c3c2cc(O)c(O)c(O)c2cc3O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>11</sub>O<sub>6</sub><sup>+</sup> |
|
| Formula = C<sub>15</sub>H<sub>11</sub>O<sub>6</sub><sup>+</sup> |
|
| MolarMass = 287.24 g/mol |
|
| MolarMass = 287.24 g/mol |
|
|
| Appearance= |
|
| ExactMass = 287.0555626 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Aurantinidin''' is a water soluble, red plant dye. It is a member of the class of compounds known as ]s and is a ] derivative of ]. Aurantinidin has been reported to occur in '']'' (]), and also in cultivars from genus '']''.<ref>''FLAVONOIDS: Chemistry, biochemistry and applications'' by Oyvind M. Andersen and Kenneth R.Markham</ref> |
|
'''Aurantinidin''' is a water-soluble, red plant dye. It is a member of the class of compounds known as ]s and is a ] derivative of ]. Aurantinidin has been reported to occur in '']'' (]), and also in cultivars from genus '']''.<ref>''FLAVONOIDS: Chemistry, biochemistry and applications'' by Oyvind M. Andersen and Kenneth R.Markham</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 45: |
Line 49: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|