Revision as of 18:14, 11 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: {{cascite}} {{fdacite}} StdInChI StdInChIKey.← Previous edit |
Latest revision as of 07:42, 10 September 2024 edit undoOblivy (talk | contribs)Extended confirmed users4,149 edits Reverted 1 edit by Rita466uk (talk): Changed references to spam linksTags: Twinkle Undo |
(51 intermediate revisions by 34 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Antibiotic}} |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
|
{{Refimprove|date=August 2013}} |
|
|
|
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 387735901 |
|
| verifiedrevid = 458972860 |
|
| IUPAC_name = (2''S'',5''R'',6''R'')-3,3-dimethyl-7-oxo-6-{amino}-2-phenylacetyl]amino}-4-thia-1-azabicycloheptane-2-carboxylic acid |
|
| IUPAC_name = (2''S'',5''R'',6''R'')-3,3-dimethyl-7-oxo-6-<nowiki/>{amino}-2-phenylacetyl]amino}-4-thia-1-azabicycloheptane-2-carboxylic acid |
|
| image = Azlocillin skeletal.svg |
|
| image = Azlocillin skeletal.svg |
|
|
<!-- Clinical data --> |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| tradename = |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| Drugs.com = {{drugs.com|international|azlocillin}} |
⚫ |
| UNII = HUM6H389W0 |
|
|
|
<!-- Identifiers --> |
⚫ |
| InChI = 1/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/t11-,12-,13+,16-/m1/s1 |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
⚫ |
| InChIKey = JTWOMNBEOCYFNV-NFFDBFGFBS |
|
|
| StdInChI = 1S/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/t11-,12-,13+,16-/m1/s1 |
|
|
| StdInChIKey = JTWOMNBEOCYFNV-NFFDBFGFSA-N |
|
|
| CAS_number = 37091-66-0 |
|
| CAS_number = 37091-66-0 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
|
| ATC_suffix = CA09 |
|
| ATC_suffix = CA09 |
|
| ATC_supplemental = |
|
|
| PubChem = 6479523 |
|
| PubChem = 6479523 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = APRD00814 |
|
| DrugBank = DB01061 |
⚫ |
| ChemSpiderID=4980416 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4980416 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = HUM6H389W0 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D02339 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 2956 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1537 |
|
|
<!-- Chemical data --> |
|
| C=20 | H=23 | N=5 | O=6 | S=1 |
|
| C=20 | H=23 | N=5 | O=6 | S=1 |
|
| molecular_weight = 461.491 g/mol |
|
|
| smiles = O=C(O)3N4C(=O)(NC(=O)(c1ccccc1)NC(=O)N2C(=O)NCC2)4SC3(C)C |
|
| smiles = O=C(O)3N4C(=O)(NC(=O)(c1ccccc1)NC(=O)N2C(=O)NCC2)4SC3(C)C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| bioavailability = |
|
|
⚫ |
| StdInChI = 1S/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/t11-,12-,13+,16-/m1/s1 |
|
| protein_bound = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| metabolism = |
|
|
⚫ |
| StdInChIKey = JTWOMNBEOCYFNV-NFFDBFGFSA-N |
|
| elimination_half-life = |
|
|
| pregnancy_category = |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
'''Azlocillin''' is an ]] ] with an extended spectrum of activity and greater ] potency than the carboxy ]s. |
|
|
Azlocillin is similar to ] and ]. It demonstrates antibacterial activity against a broad spectrum of ], including '']'' and, in contrast to most ]s, exhibits activity against ]. |
|
'''Azlocillin''' is an ] ] ] with an extended spectrum of activity and greater '']'' potency than the carboxy ]s. |
|
|
Azlocillin is similar to ] and ]. It demonstrates antibacterial activity against a broad spectrum of ], including '']'' and, in contrast to most ]s, exhibits activity against ]. |
|
|
|
|
|
== Spectrum of bacterial susceptibility == |
|
|
Azlocillin is considered a broad spectrum antibiotic and can be used against a number of Gram positive and Gram negative bacteria. The following represents MIC susceptibility data for a few medically significant organisms.<ref>{{cite web | title = Azlocillin sodium salt Susceptibility and Minimum Inhibitory and Concentration (MIC) Data | work = The Antimicrobial Index | publisher = toku-e.com | url = http://www.toku-e.com/Assets/MIC/Azlocillin%20sodium%20salt.pdf}}</ref> |
|
|
* ''Escherichia coli'' 1 μg/mL – 32 μg/mL |
|
|
* ''Haemophilus'' spp. 0.03 μg/mL – 2 μg/mL |
|
|
* ''Pseudomonas aeruginosa'' 4 μg/mL – 6.25 μg/mL |
|
|
|
|
|
== Synthesis == |
|
|
] |
|
|
] |
|
|
An interesting alternative synthesis of azlocillin involves activation of the substituted ] analogue '''1''' with 1,3-dimethyl-2-chloro-1-imidazolinium chloride ('''2''') and then condensation with ]. |
|
|
{{clear}} |
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist|30em}} |
|
|
|
|
|
{{PenicillinAntiBiotics}} |
|
{{PenicillinAntiBiotics}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Antibiotic-stub}} |
|
{{Antibiotic-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|