| Revision as of 00:34, 25 November 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 23:09, 3 December 2022 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,371 edits +sd |
| (18 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 424776990 |
|
| verifiedrevid = 462336653 |
|
| IUPAC_name = 5,7-Bis(1,1-dimethylethyl)-3-hydroxy-3(trifluoromethyl)-2(3H)-benzofuranone |
|
| IUPAC_name = 5,7-Bis(1,1-dimethylethyl)-3-hydroxy-3(trifluoromethyl)-2(3H)-benzofuranone |
|
| image = BHFF_structure.png |
|
| image = BHFF_structure.png |
| Line 24: |
Line 25: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 123557-91-5 |
|
| CAS_number = 123557-91-5 |
|
| ATC_prefix = |
|
| ATC_prefix = |
| Line 31: |
Line 33: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3537035 |
|
| ChemSpiderID = 3537035 |
|
| InChI = 1/C17H21F3O3/c1-14(2,3)9-7-10(15(4,5)6)12-11(8-9)16(22,13(21)23-12)17(18,19)20/h7-8,22H,1-6H3 |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| InChIKey = RVNOANDLZIIFHB-UHFFFAOYAJ |
|
|
| StdInChI = 1S/C17H21F3O3/c1-14(2,3)9-7-10(15(4,5)6)12-11(8-9)16(22,13(21)23-12)17(18,19)20/h7-8,22H,1-6H3 |
|
| StdInChI = 1S/C17H21F3O3/c1-14(2,3)9-7-10(15(4,5)6)12-11(8-9)16(22,13(21)23-12)17(18,19)20/h7-8,22H,1-6H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RVNOANDLZIIFHB-UHFFFAOYSA-N |
|
|
⚫ |
| StdInChIKey = RVNOANDLZIIFHB-UHFFFAOYSA-N |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = K3W3822BMV |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=17 | H=21 | F=3 | O=3 |
|
| C=17 | H=21 | F=3 | O=3 |
|
| molecular_weight = 330.341 g/mol |
|
|
| smiles = FC(F)(F)C2(O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OC2=O |
|
| smiles = FC(F)(F)C2(O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OC2=O |
|
}} |
|
}} |
|
|
|
|
|
'''BHFF''' is a compound used in scientific research which acts as a ] at the ] ]. It has ] effects in animal studies, and good oral bioavailability.<ref>{{cite journal | last1 = Malherbe | first1 = P | last2 = Masciadri | first2 = R | last3 = Norcross | first3 = RD | last4 = Knoflach | first4 = F | last5 = Kratzeisen | first5 = C | last6 = Zenner | first6 = MT | last7 = Kolb | first7 = Y | last8 = Marcuz | first8 = A | last9 = Huwyler | first9 = J | title = Characterization of (R,S)-5,7-di-tert-butyl-3-hydroxy-3-trifluoromethyl-3H-benzofuran-2-one as a positive allosteric modulator of GABAB receptors | journal = British journal of pharmacology | volume = 154 | issue = 4 | pages = 797–811 | year = 2008 | pmid = 18536733 | pmc = 2439845 | doi = 10.1038/bjp.2008.135 }}</ref> |
|
'''BHFF''' is a compound used in scientific research which acts as a ] at the ] ]. It has ] effects in animal studies, and good oral bioavailability.<ref>{{cite journal | vauthors = Malherbe P, Masciadri R, Norcross RD, Knoflach F, Kratzeisen C, Zenner MT, Kolb Y, Marcuz A, Huwyler J, Nakagawa T, Porter RH, Thomas AW, Wettstein JG, Sleight AJ, Spooren W, Prinssen EP | display-authors = 6 | title = Characterization of (R,S)-5,7-di-tert-butyl-3-hydroxy-3-trifluoromethyl-3H-benzofuran-2-one as a positive allosteric modulator of GABAB receptors | journal = British Journal of Pharmacology | volume = 154 | issue = 4 | pages = 797–811 | date = June 2008 | pmid = 18536733 | pmc = 2439845 | doi = 10.1038/bjp.2008.135 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
|
*{{Commonscatinline}} |
|
|
|
|
|
{{GABAergics}} |
|
{{GABAergics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Anxiolytic-stub}} |