Revision as of 14:39, 4 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Latest revision as of 19:52, 20 December 2023 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,753,713 editsm Moving Category:Merck brands to Category:Drugs developed by Merck per Misplaced Pages:Categories for discussion/Log/2023 December 9#Category:AstraZeneca brands |
(20 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 458977224 |
|
| IUPAC_name = 4-(2′-Aminoethyl)amino-1,8-dimethylimidazoquinoxaline |
|
| IUPAC_name = 4-(2′-Aminoethyl)amino-1,8-dimethylimidazoquinoxaline |
|
| image = BMS-345541.png |
|
| image = BMS-345541 structure.svg |
|
| alt = |
|
| alt = |
|
| caption = |
|
| caption = |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
Line 16: |
Line 19: |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
Line 23: |
Line 25: |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
⚫ |
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 5669 |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = 445430-58-0 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 26SU0NEF5F |
|
|
|
|
⚫ |
<!--Identifiers--> |
|
⚫ |
| CAS_number = |
|
|
| ATCvet = |
|
| ATCvet = |
|
| ATC_prefix = <!-- 'none' if uncategorised --> |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| PubChem = |
|
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 249697 --> |
|
|
|
| ChEMBL = 249697 |
|
| chemical_formula = C14 H17 N5 |
|
|
|
| PubChem = 9813758 |
|
|
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| molecular_weight = 255.3 |
|
|
|
| ChemSpiderID = 7989508 |
|
|
| smiles = n1c3c(n2c(cnc2c1NCCN)C)cc(cc3)C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H17N5/c1-9-3-4-11-12(7-9)19-10(2)8-17-14(19)13(18-11)16-6-5-15/h3-4,7-8H,5-6,15H2,1-2H3,(H,16,18) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PSPFQEBFYXJZEV-UHFFFAOYSA-N |
|
|
<!--Chemical data--> |
|
|
| C=14 | H=17 | N=5 |
|
}} |
|
}} |
|
|
|
|
|
'''BMS-345541''', marketed by ], is an ], cell-permeable ] compound. It is an ] site-binding inhibitor with a primary target of IKK-2 and blocks the NF-kB-dependent ] in mice.<ref>The Journal of Biological Chemistry. 2003. 278. 1450-1456.</ref> |
|
'''BMS-345541''', developed by ], is an ], cell-permeable ] compound. It is an ] site-binding inhibitor with a primary target of IKK-2 and blocks the NF-κB-dependent ] in mice.<ref>The Journal of Biological Chemistry. 2003. 278. 1450-1456.</ref> |
|
|
|
|
|
It has no approvals for human/medical use or for use in clinical trials. No clinical trials mention it.<ref name=NCT></ref> |
|
|
|
|
|
==References== |
|
==References== |
Line 43: |
Line 59: |
|
|
|
|
|
] |
|
] |
|
|
] |