| Revision as of 00:04, 16 January 2012 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 20:24, 7 November 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,731 editsm variable cols |
| (23 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| drug_name = BSPP |
|
| verifiedrevid = 428799225 |
|
| verifiedrevid = 471588151 |
|
| IUPAC_name = 2,6-di-tert-butyl-4-(3-hydroxy-2-spiropentylpropyl)-phenol |
|
| IUPAC_name =2,6-di-tert-butyl-4-<nowiki/>{methyl}phenol |
|
| image = BSPP_structure.png |
|
|
|
| image = Bspp.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 24: |
Line 26: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number = |
|
| CAS_number = 938174-18-6 |
|
|
| CAS_number_Ref = {{Cascite|changed|GSRS}} |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
| Line 31: |
Line 34: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 17238838 |
|
| ChemSpiderID = 17238838 |
| ⚫ |
| InChI = 1/C21H34O2/c1-19(2,3)16-11-15(12-17(18(16)23)20(4,5)6)13-21(14-22)9-7-8-10-21/h11-12,22-23H,7-10,13-14H2,1-6H3 |
|
|
|
| UNII = AN78SQ2WKC |
| ⚫ |
| InChIKey = CTFKOMUXSHQLLL-UHFFFAOYAG |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H34O2/c1-19(2,3)16-11-15(12-17(18(16)23)20(4,5)6)13-21(14-22)9-7-8-10-21/h11-12,22-23H,7-10,13-14H2,1-6H3 |
|
|
⚫ |
| StdInChI = 1S/C21H34O2/c1-19(2,3)16-11-15(12-17(18(16)23)20(4,5)6)13-21(14-22)9-7-8-10-21/h11-12,22-23H,7-10,13-14H2,1-6H3 |
|
| StdInChIKey = CTFKOMUXSHQLLL-UHFFFAOYSA-N |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = CTFKOMUXSHQLLL-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=21 | H=34 | O=2 |
|
| C=21 | H=34 | O=2 |
|
|
| smiles =C(C)(C)(C)C1=C(C(=CC(=C1)CC1(CCCC1)CO)C(C)(C)C)O |
|
| molecular_weight = 318.492 g/mol |
|
|
| smiles = C2CCCC2(CO)Cc(cc(C(C)(C)C)c1O)cc1C(C)(C)C |
|
|
}} |
|
}} |
|
|
|
|
|
'''BSPP''' is a compound used in scientific research which acts as a ] at the ] ].<ref>Kerr DIB, Khalafy J, Ong J, Perkins MV, Prager RH, Puspawati NM, Rimaz M. Synthesis and Biological Activity of Allosteric Modulators of GABAB Receptors, Part 2. 3-(2,6-Bis-tert-butyl-4-hydroxyphenyl)propanols. ''Australian Journal of Chemistry''. 2006;59:457-462.</ref> It has a synergistic effect with GABA<sub>B</sub> agonists such as ] at GABA<sub>B</sub> autoreceptors but not heteroreceptors, suggesting it may be useful for distinguishing between these GABA<sub>B</sub> receptor subtypes.<ref>Parker DA, Marino V, Ong J, Puspawati NM, Prager RH. The CGP7930 analogue 2,6-di-tert-butyl-4-(3-hydroxy-2-spiropentylpropyl)-phenol (BSPP) potentiates baclofen action at GABA(B) autoreceptors. ''Clinical and Experimental Pharmacology and Physiology''. 2008 Sep;35(9):1113-5. PMID 18430050</ref> |
|
'''BSPP''' is a compound used in scientific research which acts as a ] at the ] ].<ref>{{cite journal | vauthors = Kerr DI, Khalafy J, Ong J, Perkins MV, Prager RH, Puspawati NM, Rimaz M | title = Synthesis and biological activity of allosteric modulators of GABAB receptors, part 2. 3-(2, 6-bis-tert-butyl-4-hydroxyphenyl) propanols. | journal = Australian Journal of Chemistry | date = September 2006 | volume = 59 | issue = 7 | pages = 457–62 | doi = 10.1071/CH06164 }}</ref> It has a synergistic effect with GABA<sub>B</sub> agonists such as ] at GABA<sub>B</sub> autoreceptors but not heteroreceptors, suggesting it may be useful for distinguishing between these GABA<sub>B</sub> receptor subtypes.<ref name="pmid18430050">{{cite journal | vauthors = Parker DA, Marino V, Ong J, Puspawati NM, Prager RH | title = The CGP7930 analogue 2,6-di-tert-butyl-4-(3-hydroxy-2-spiropentylpropyl)-phenol (BSPP) potentiates baclofen action at GABA(B) autoreceptors | journal = Clinical and Experimental Pharmacology & Physiology | volume = 35 | issue = 9 | pages = 1113–5 | date = September 2008 | pmid = 18430050 | doi = 10.1111/j.1440-1681.2008.04948.x | s2cid = 25608408 }}</ref> |
|
|
|
|
|
⚫ |
==References== |
|
|
|
|
|
{{Reflist}} |
| ⚫ |
== References == |
|
|
{{reflist}} |
|
|
|
|
|
|
|
|
|
| Line 54: |
Line 57: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|