| Revision as of 05:58, 2 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoB← Previous edit |
Latest revision as of 06:47, 6 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Add: publisher. Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. |
| (33 intermediate revisions by 29 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443666762 |
|
| verifiedrevid = 447993914 |
|
| IUPAC_name = ethyl 1-- 4-phenylpiperidine- 4-carboxylate |
|
| IUPAC_name = ethyl 1-- 4-phenylpiperidine- 4-carboxylate |
|
| image = Benzethidine.svg |
|
| image = Benzethidine.svg |
|
| width = 160 |
|
| width = 160 |
|
|
| alt = Structural formula of benzethidine |
|
|
|
|
|
| image2 = Benzethidine 3D ball.png |
|
|
| alt2 = Ball-and-stick model of the benzethidine molecule |
|
|
| width2 = 260 |
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 10: |
Line 16: |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = S9 |
|
|
| legal_BR = A1 |
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
|
| legal_CA = Schedule I |
|
| legal_CA = Schedule I |
|
| legal_UK = Class A |
|
| legal_UK = Class A |
|
| legal_US = Schedule I |
|
| legal_US = Schedule I |
|
|
| legal_DE = Anlage I |
|
| legal_status = |
|
| legal_status = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
| Line 22: |
Line 30: |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|??|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 3691-78-9 |
|
| CAS_number = 3691-78-9 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 62516 |
|
| PubChem = 62516 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2104234 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01518 |
|
| DrugBank = DB01518 |
| Line 35: |
Line 44: |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = X0I74BAR02 |
|
| UNII = X0I74BAR02 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
|
|
|
| KEGG = D12685 |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=29 | N=1 | O=3 |
|
| C=23 | H=29 |
|
|
| N=1 | O=3 |
|
| molecular_weight = 367.481 g/mol |
|
|
| smiles = O=C(OCC)C3(c1ccccc1)CCN(CCOCc2ccccc2)CC3 |
|
| smiles = O=C(OCC)C3(c1ccccc1)CCN(CCOCc2ccccc2)CC3 |
|
| InChI = 1/C23H29NO3/c1-2-27-22(25)23(21-11-7-4-8-12-21)13-15-24(16-14-23)17-18-26-19-20-9-5-3-6-10-20/h3-12H,2,13-19H2,1H3 |
|
|
| InChIKey = UVTBZAWTRVBTMK-UHFFFAOYAQ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H29NO3/c1-2-27-22(25)23(21-11-7-4-8-12-21)13-15-24(16-14-23)17-18-26-19-20-9-5-3-6-10-20/h3-12H,2,13-19H2,1H3 |
|
| StdInChI = 1S/C23H29NO3/c1-2-27-22(25)23(21-11-7-4-8-12-21)13-15-24(16-14-23)17-18-26-19-20-9-5-3-6-10-20/h3-12H,2,13-19H2,1H3 |
| Line 48: |
Line 56: |
|
}} |
|
}} |
|
|
|
|
|
'''Benzethidine''' is a 4-]] derivative that is related to the ] ] drug ] (''meperidine'', or ''Demerol'').<ref>Maul C, Buschmann H, Sundermann B. Opioids: 3.3 Synthetic Opioids. ''Analgesics'' 2005; 159-169. ISBN 9783527304035</ref> |
|
'''Benzethidine''' is a 4-]] derivative that is related to the clinically used ] ] drug ] (''meperidine'', or ''Demerol'').<ref>{{cite book | vauthors = Maul C, Buschmann H, Sundermann B | chapter = Opioids: 3.3 Synthetic Opioids. | title = Analgesics | date = 2005 | pages = 159–169 | publisher = Wiley-VCH | isbn = 978-3-527-30403-5 }}</ref> |
|
|
|
|
|
Benzethidine is not currently used in medicine and is a ]/] drug which is controlled under UN drug conventions. It has similar effects to other opioid derivatives, such as ], ], ] and ].<ref>Cahal DA, Dare JG, Keith D. A Sequential Trial of Analgesics in Labour. ''International Journal of Obstetrics and Gynaecology'' 1961; 68(1): 88–93.</ref> |
|
Benzethidine is not currently used in medicine and is a ]/] drug which is controlled under UN drug conventions. It has similar effects to other opioid derivatives, such as ], ], ] and ].<ref name="pmid13689779">{{cite journal | vauthors = Cahal DA, Dare JG, Keith D | title = A sequential trial of analgesics in labour | journal = The Journal of Obstetrics and Gynaecology of the British Commonwealth | volume = 68 | pages = 88–93 | date = February 1961 | pmid = 13689779 | doi = 10.1111/j.1471-0528.1961.tb02689.x | s2cid = 27397119 }}</ref> In the United States, the drug is a ] with a DEA ACSCN of 9606 and 2014 annual aggregate manufacturing quota of nil.<ref>{{Cite web | url=http://deadiversion.usdoj.gov/quotas/conv_factor/index.html |title = Conversion Factors for Controlled Substances | work = Diversion Control Division | publisher = Drug Enforcement Agency, U.S. Department of Justice }}</ref> The most common salt in use is the hydrochloride, free base conversion ratio of 0.910. |
|
|
|
|
|
==Legal Status== |
|
|
|
|
|
===Australia=== |
|
|
Benzethidine is considered a Schedule 9 prohibited substance in Australia under the ] (February 2017).<ref name="Poisons Standard">{{cite web | title = Poisons Standard | date = October 2015 | url = https://www.legislation.gov.au/Details/F2017L00057 | publisher = Australian Government }}</ref> A Schedule 9 substance is a substance which may be abused or misused, the manufacture, possession, sale or use of which should be prohibited by law except when required for medical or scientific research, or for analytical, teaching or training purposes with approval of Commonwealth and/or State or Territory Health Authorities.<ref name="Poisons Standard" /> |
|
|
|
|
|
== References == |
|
== References == |
|
|
{{Reflist|2}} |
|
<references/> |
|
|
|
|
| ⚫ |
|
|
|
|
== External links == |
|
⚫ |
* |
|
|
|
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
| ⚫ |
{{analgesic-stub}} |
|
|
|
|
|
|
⚫ |
{{analgesic-stub}} |
|
] |
|
|
] |
|