Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Bibrocathol: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 10:49, 9 April 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 448002428 of page Bibrocathol for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CAS_number').  Latest revision as of 16:34, 5 December 2024 edit Marbletan (talk | contribs)Extended confirmed users5,415 edits Bibrocathol structure a.svg 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 486407352
| IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole | IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole
| image = Bibrocathol structure.svg | image = Bibrocathol structure a.svg


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename = Noviform, Posiformin
| Drugs.com = {{drugs.com|international|bibrocathol}} | Drugs.com = {{drugs.com|international|bibrocathol}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = | legal_status =
| routes_of_administration = Topical (eye ointment) | routes_of_administration = Topical (eye ointment)


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = | protein_bound =
| metabolism = | metabolism =
| elimination_half-life = | elimination_half-life =
| excretion = | excretion =


<!--Identifiers--> <!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 6915-57-7 --> | CAS_number = 6915-57-7
| ATC_prefix = S01 | ATC_prefix = S01
| ATC_suffix = AX05 | ATC_suffix = AX05
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3 | StdInChI = 1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VTAVFIZOZUAKKE-UHFFFAOYSA-K | StdInChIKey = VTAVFIZOZUAKKE-UHFFFAOYSA-K
| PubChem = 16683103 | PubChem = 16683103
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = | DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 11232581 | ChemSpiderID = 11232581
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0KJ20H1BLJ | UNII = 0KJ20H1BLJ
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 44875 | ChEMBL = 44875


<!--Chemical data--> <!--Chemical data-->
| chemical_formula = | chemical_formula =
| C=6 | H=1 | Bi=1 | Br=4 | O=3 | C=6 | H=1 | Bi=1 | Br=4 | O=3
| molecular_weight = 650.675 g/mol
| smiles = O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1 | smiles = O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1
| InChI = 1/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3/rC6HBiBr4O3/c8-1-2(9)4(11)6-5(3(1)10)13-7(12)14-6/h12H
| InChIKey = VTAVFIZOZUAKKE-AJXSUKGNAS
| synonyms = Bibrocathin<br>Tetrabromopyrocatechol&nbsp;bismuth | synonyms = Bibrocathin<br>Tetrabromopyrocatechol&nbsp;bismuth
}} }}
'''Bibrocathol''' (]; trade names '''Noviform''' and '''Posiformin''') is a pharmaceutical ]. Its chemical name is 4,5,6,7-tetrabrom-1,3,2-benzodioxabismol-2-ol. It contains ] and is used to treat eye infections and control swelling.<ref>{{cite book | vauthors = Gurtler L | chapter = Chapter 2: The Eye and Conjunctiva as Target of Entry for Infectious Agents: Prevention by Protection and by Antiseptic Prophylaxis | veditors = Kramer A, Behrens-Baumann W |title=Antiseptic prophylaxis and therapy in ocular infections: principles, clinical practice, and infection control | series = Developments in Ophthalmology |date= January 2002 | volume = 33 | pages = 9–13 |publisher=Karger |location=Basel |isbn=978-3-8055-7316-0 | doi = 10.1159/000065934 | pmid = 12236131 | chapter-url = https://books.google.com/books?id=JkQOSAnOIhoC&dq=Bibrocathol&pg=PA96 }}</ref>

== References ==
{{Reflist}}

==External links==
* {{Commonscatinline}}

{{Bismuth compounds}}

]
]
]
]
]

{{antiinfective-drug-stub}}