Revision as of 09:17, 30 November 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: StdInChI StdInChIKey.← Previous edit |
Latest revision as of 10:10, 12 August 2024 edit undoKormiSK (talk | contribs)Extended confirmed users923 editsNo edit summaryTag: Visual edit |
(49 intermediate revisions by 30 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
⚫ |
| Name = Bicinchoninic acid |
|
|
|
| verifiedrevid = 413897454 |
|
| ImageFile = Bicinchoninic acid.svg |
|
|
⚫ |
| Name = Bicinchoninic acid |
|
<!-- | ImageSize = 200px --> |
|
|
|
| ImageFile = Structure of bicinchoninic acid.png |
|
| ImageName = |
|
| ImageName = |
|
| IUPACName = 2-(4-carboxyquinolin-2-yl)quinoline-4-carboxylic acid |
|
|
|
| PIN = -4,4′-dicarboxylic acid |
|
| OtherNames = Bicinchoninic acid</br>4,4'-Dicarboxy-2,2'-Biquinoline |
|
| OtherNames = Bicinchoninic acid<br>4,4′-Dicarboxy-2,2′-biquinoline<br>2,2'-Biquinoline-4,4'-dicarboxylic acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
⚫ |
| ChemSpiderID = 64223 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| InChI = 1/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) |
|
|
⚫ |
| ChemSpiderID = 64223 |
|
| SMILES = O=C(O)c1cc(nc2c1cccc2)c3nc4ccccc4c(c3)C(=O)O |
|
| SMILES = O=C(O)c1cc(nc2c1cccc2)c3nc4ccccc4c(c3)C(=O)O |
|
| InChIKey = AFYNADDZULBEJA-UHFFFAOYAF |
|
|
| PubChem = 71068 |
|
| PubChem = 71068 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 431482 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) |
|
| StdInChI = 1S/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = AFYNADDZULBEJA-UHFFFAOYSA-N |
|
| StdInChIKey = AFYNADDZULBEJA-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 1245-13-2 |
|
| CASNo = 1245-13-2 |
|
|
| CASNo_Comment = (free acid) |
⚫ |
| RTECS = |
|
|
|
| CASNo2_Ref = {{cascite|unknown|CAS}} |
|
|
| CASNo2 = 979-88-4 |
|
|
| CASNo2_Comment = (disodium salt) |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = CX56TX9Y1I |
|
⚫ |
| RTECS = |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=20|H=12|N=2|O=4 |
|
| Formula = (HO<sub>2</sub>CC<sub>9</sub>H<sub>5</sub>N)<sub>2</sub> |
|
|
|
| Appearance = Cream colored powder |
|
| MolarMass = 344.33 g/mol |
|
|
| Appearance = Cream powder. Characteristic odor. |
|
| Odor = Characteristic odor{{vague|date=October 2013}} |
|
|
| Density = |
|
| Density = Solid in pure form.</br>Density not available. |
|
|
| Solubility = Partially soluble in cold water, hot water. |
|
| Solubility = Partially soluble in cold water, hot water{{vague|date=October 2013}} |
|
|
| MeltingPtC = 352 |
|
| MeltingPt = 365 to 367 °C |
|
|
|
| MeltingPt_notes = decomposes |
|
| BoilingPt = Not available. |
|
|
| pKa = |
|
| BoilingPt = |
|
|
| pKa = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Structure |
|
|Section3={{Chembox Structure |
|
| CrystalStruct = |
|
| CrystalStruct = |
|
| Dipole = |
|
| Dipole = |
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| ExternalMSDS = |
|
| ExternalSDS = |
|
|
| MainHazards = Will irritate eyes and mucous membranes. |
|
| MainHazards = Will irritate eyes and mucous membranes.<br />The chemical, physical and toxicological<br />properties have not been fully investigated.<br />Presume moderate toxicity internally. LD/TD<br />no data. OSHA PEL/ACGIH TLV not established.<br />No evidence of carcinogenicity. |
|
|
| NFPA-H = 1 |
|
| NFPA-H = 1 |
|
| NFPA-R = |
|
| NFPA-R = |
|
| NFPA-F = |
|
| NFPA-F = |
|
| FlashPt = N/A |
|
| FlashPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Bicinchoninic acid''' ({{IPAc-en|b|aɪ|s|ɪ|n|k|ɔː|n|ɪ|n|ɪ|k}}) or '''BCA''' is a ] composed of two ]ated ] rings. It is an organic compound with the formula (C<sub>9</sub>H<sub>5</sub>NCO<sub>2</sub>H)<sub>2</sub>. The molecule consists of a pair of ] rings, each bearing a ] group. Its ] forms a purple complex with ] ions.<ref>{{Cite journal|year=1985|title=Measurement of Protein Using Bicinchoninic Acid|journal=Analytical Biochemistry|volume=150|issue=1|pages=76–85|doi=10.1016/0003-2697(85)90442-7|last1=Smith |first1=P.K. |last2=Krohn |first2=R.I. |last3=Hermanson |first3=G.T. |last4=Mallia |first4=A.K. |last5=Gartner |first5=F.H. |last6=Provenzano |first6=M.D. |last7=Fujimoto |first7=E.K. |last8=Goeke |first8=N.M. |last9=Olson |first9=B.J. |last10=Klenk |first10=D.C. |pmid=3843705 }}</ref><ref>{{cite journal |doi=10.1016/0003-2697(89)90101-2|title=Protein measurement using bicinchoninic acid: Elimination of interfering substances |year=1989 |last1=Brown |first1=Rhoderick E. |last2=Jarvis |first2=Kari L. |last3=Hyland |first3=Kristi J. |journal=Analytical Biochemistry |volume=180 |issue=1 |pages=136–139 |pmid=2817336 }}</ref><ref>{{cite book |doi=10.1016/S0076-6879(09)63008-1|chapter=Chapter 8 Quantitation of Protein |title=Guide to Protein Purification, 2nd Edition |series=Methods in Enzymology |year=2009 |last1=Noble |first1=James E. |last2=Bailey |first2=Marc J.A. |volume=463 |pages=73–95 |pmid=19892168 |isbn=9780123745361 }}</ref> |
|
'''Bicinchoninic acid''' is a weak acid composed of two ]ated ] rings. |
|
|
|
|
|
|
Bicinchoninic acid is most commonly employed by biochemists in the ], which is used to determine the total level of protein in a solution. In this assay, two molecules of bicinchoninic acid ] a single ]<sup>1+</sup> ion, forming a purple water-soluble complex that strongly absorbs light at 562 ].<ref></ref> |
|
Bicinchoninic acid is most commonly employed in the ], which is used to determine the total concentration of ] in a solution. Bicinchoninic acid is used to detect the presence of cuprous ions, due to its purple coloration via a ]. In this assay, two molecules of bicinchoninic acid ] a single ]<sup>+</sup> ion, forming a purple water-soluble complex that strongly absorbs light at 562 ].<ref></ref> |
|
|
|
|
|
==References== |
|
==References== |
Line 50: |
Line 62: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
] |
|