| Revision as of 14:47, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 471583837 of page Biocytin for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo'). |
Latest revision as of 15:52, 17 September 2023 edit KoIobok (talk | contribs)Extended confirmed users1,350 edits Added Category:Alpha-Amino acids |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 433052834 |
|
|
|
| Watchedfields = changed |
|
|Reference=<ref> at ]</ref> |
|
|
⚫ |
| verifiedrevid = 477372713 |
| ⚫ |
|ImageFile=Biocytin.svg |
|
|
|
| Name = |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile = Biocytin.svg |
|
|IUPACName=(2''S'')-6-imidazol-4-yl]pentanoylamino]-2-aminohexanoic acid |
|
|
⚫ |
| ImageSize = 200px |
|
|IUPACName_hidden=yes |
|
|
|
| IUPACName = ''N''<sup>6</sup>-{5-imidazol-4-yl]pentanoyl}-<small>L</small>-lysine |
| ⚫ |
|OtherNames=Biotinyl-<small>L</small>-lysine; N<sub>ε</sub>-(+)-Biotinyl-<small>L</small>-lysine |
|
|
|
| SystematicName = (2''S'')-2-Amino-6-<nowiki/>{5-imidazol-4-yl]pentanamido}hexanoic acid |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
⚫ |
| OtherNames = Biotinyl-<small>L</small>-lysine; N<sub>ε</sub>-(+)-Biotinyl-<small>L</small>-lysine |
|
| Abbreviations = Bct |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| CASNo = <!-- blanked - oldvalue: 576-19-2 --> |
|
|
| ChEBI = 27870 |
|
| Abbreviations = Bct |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=576-19-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = G6D6147J22 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 27870 |
|
| PubChem = 7098660 |
|
| PubChem = 7098660 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 75634 |
|
| ChemSpiderID = 75634 |
|
| SMILES = O=C1N2(SC2N1)CCCCC(=O)NCCCC(C(=O)O)N |
|
| SMILES = O=C1N2(SC2N1)CCCCC(=O)NCCCC(C(=O)O)N |
|
| InChI = 1/C16H28N4O4S/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24)/t10-,11-,12-,14-/m0/s1 |
|
| InChI = 1/C16H28N4O4S/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24)/t10-,11-,12-,14-/m0/s1 |
|
| InChIKey = BAQMYDQNMFBZNA-MNXVOIDGBH |
|
| InChIKey = BAQMYDQNMFBZNA-MNXVOIDGBH |
| ⚫ |
| StdInChI = 1S/C16H28N4O4S/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24)/t10-,11-,12-,14-/m0/s1 |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| StdInChIKey = BAQMYDQNMFBZNA-MNXVOIDGSA-N |
|
|
⚫ |
| StdInChI = 1S/C16H28N4O4S/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24)/t10-,11-,12-,14-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = BAQMYDQNMFBZNA-MNXVOIDGSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=16|H=28|N=4|O=4|S=1 |
|
| C=16 | H=28 | N=4 | O=4 | S=1 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt=~245 °C |
|
| MeltingPt=~245 °C |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
|
| Section4 = |
|
|
| Section5 = |
|
|
| Section6 = |
|
}} |
|
}} |
|
|
|
|
|
'''Biocytin''' is a ] compound that is an ] formed from the ] ] and the ] ]. As an intermediate in the ] of biotin, biocytin occurs naturally in ] and ]. |
|
|
|
|
|
The ] ] cleaves biocytin and makes biotin available to be reused by other enzymes. Because biocytin is the natural ] of the enzyme biotinidase, biocytin can be used to measure the biotinidase activity and therefore diagnose ]. |
|
|
|
|
|
Biocytin is also used in scientific research as a ] for nerve cells.<ref>{{Cite journal | doi=10.1021/cn900010d | title=Improved Neuronal Tract Tracing with Stable Biocytin-Derived Neuroimaging Agents | year=2010 | last1=Mishra | first1=Anurag | last2=Dhingra | first2=Kirti | last3=Schüz | first3=Almut | last4=Logothetis | first4=Nikos K. | author4-link = Nikos Logothetis | last5=Canals | first5=Santiago | journal=ACS Chemical Neuroscience | volume=1 | pages=129–38 | issue=2| pmc=3368650 | pmid=22778821}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |