| Revision as of 23:48, 6 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 12:28, 19 June 2024 edit undoCitation bot (talk | contribs)Bots5,433,135 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Abductive | Category:Articles with dead external links from March 2019 | #UCB_Category 227/819 |
| (15 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443425352 |
|
| verifiedrevid = 443426693 |
|
| ImageFile = Bornesitol.svg |
|
| ImageFile = Bornesitol.svg |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
|
| IUPACName = 1<small>D</small>-1-''O''-Methyl-''myo''-inositol |
|
| IUPACName = (1''R'',2''R'',3''S'',4''S'',5''R'',6''S'')-6-Methoxycyclohexane-1,2,3,4,5-pentol |
|
| SystematicName = (1''R'',2''R'',3''S'',4''S'',5''R'',6''S'')-6-Methoxycyclohexane-1,2,3,4,5-pentol |
|
| OtherNames = <small>D</small>-1-''O''-Methyl-''myo''-inositol; <small>D</small>-(-)-Bornesitol |
|
|
|
| OtherNames = <small>D</small>-(−)-Bornesitol |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 484-71-9 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 484-71-9 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = RW8AP5YP8U |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| PubChem = 440078 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10254649 |
|
| ChemSpiderID = 10254649 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 18427 |
|
| ChEBI = 18427 |
|
|
| KEGG = C03659 |
|
| SMILES = O1(O)(O)(OC)(O)1O |
|
| SMILES = O1(O)(O)(OC)(O)1O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4+,5-,6-,7-/m1/s1 |
|
| StdInChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4+,5-,6-,7-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DSCFFEYYQKSRSV-AGZHHQKVSA-N |
|
| StdInChIKey = DSCFFEYYQKSRSV-AGZHHQKVSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=7|H=14|O=6 |
|
| C=7 | H=14 | O=6 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Bornesitol''' is a ]. It can be found in the ] and ] plant families.<ref>{{cite journal | doi = 10.1016/S0031-9422(00)94463-7 | url = http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6TH7-42H2X19-139&_user=10&_coverDate=12%2F31%2F1976&_alid=1051876094&_rdoc=22&_fmt=high&_orig=search&_cdi=5275&_docanchor=&view=c&_ct=34&_acct=C000050221&_version=1&_urlVersion=0&_userid=10&md5=6668979240fc097b416fd4cc2ae8b12c | title = Distribution of l-(+)-bornesitol in the gentianaceae and menyanthaceae | author = Norbert Schilling | journal = Phytochemistry | volume = 15 | issue = 5 | year = 1976 | pages = 824–826}}</ref> Chemically, it is a ] ] of <small>D</small>-]. |
|
'''Bornesitol''' is a ]. It can be found in the ] and ] plant families.<ref>{{cite journal | doi = 10.1016/S0031-9422(00)94463-7 | title = Distribution of l-(+)-bornesitol in the gentianaceae and menyanthaceae | author = Norbert Schilling | journal = Phytochemistry | volume = 15 | issue = 5 | year = 1976 | pages = 824–826| bibcode = 1976PChem..15..824S }}{{dead link|date=March 2019|bot=medic}}{{cbignore|bot=medic}}</ref> Chemically, it is a ] ] of <small>D</small>-]. |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |