| Revision as of 20:12, 10 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII').← Previous edit |
Latest revision as of 18:20, 28 November 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,418 editsNo edit summary |
| (35 intermediate revisions by 27 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{Drugbox| verifiedrevid = 378286631 |
|
|
|
{{Drugbox |
|
| |
|
|
⚫ |
| verifiedrevid = 444128206 |
|
|IUPAC_name = ''N''-oct-3-yl]-1-benzofuran-2-carboxamide |
|
| IUPAC_name = ''N''-oct-3-yl]-1-benzofuran-2- carboxamide |
| ⚫ |
| image=TC-5619.png |
|
|
|
| image = Bradanicline structure.svg |
|
| width= 240 |
|
| width = |
| ⚫ |
| CAS_number= |
|
|
|
|
|
| ATC_prefix= |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_suffix= |
|
|
|
| tradename = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 639489-84-2 |
|
⚫ |
| ATC_suffix = None |
|
⚫ |
| PubChem = 16727410 |
|
|
| ChEMBL = 1258006 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = UM3821998K |
|
| UNII = UM3821998K |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| PubChem= 16727410 |
|
|
|
| KEGG = D10613 |
|
| DrugBank= |
|
|
⚫ |
| synonyms = TC-5619 |
| ⚫ |
| C=22 | H=23 | N=3 | O=2 |
|
|
|
|
|
| molecular_weight = 361.437 |
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=22 | H=23 | N=3 | O=2 |
|
| smiles = C1CN2CCC1(2CC3=CN=CC=C3)NC(=O)C4=CC5=CC=CC=C5O4 |
|
| smiles = C1CN2CCC1(2CC3=CN=CC=C3)NC(=O)C4=CC5=CC=CC=C5O4 |
|
| bioavailability= |
|
|
| metabolism = |
|
|
| elimination_half-life= |
|
|
| excretion = |
|
|
| pregnancy_category = |
|
|
| legal_status = |
|
| ⚫ |
| routes_of_administration= |
|
|
}} |
|
}} |
|
|
|
|
|
'''TC-5619''' is a drug developed by ] that acts as a ] at the ] subtype of the neural ]s. It showed cognitive enhancing effects in animal studies, and is currently being developed through a collaboration between Targacept and ] as a potential treatment for ].<ref>have been completed successfully, and it is currently in Phase II trials.<ref> |
|
'''Bradanicline''' (];<ref name="INN">{{cite web | title = International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names: List 73 | url =https://www.who.int/medicines/publications/druginformation/innlists/RL73.pdf | publisher = World Health Organization | access-date = 3 January 2017 | pages = 68–9}}</ref> development code '''TC-5619''') is a drug which was being ] by ] that acts as a ] at the ] subtype of the neural ]s. It showed cognitive enhancing effects in animal studies, and was being developed through a collaboration between Targacept and ] as a potential treatment for ] and ].<ref>{{cite web | title = TC-5619 Cognitive Dysfunction in Schizophrenia | work = Catalyst Biosciences | url = http://www.targacept.com/wt/page/tc_5619 | archive-url = https://web.archive.org/web/20080820060552/http://www.targacept.com/wt/page/tc_5619 | archive-date=August 20, 2008 }}</ref> Phase I ] were completed successfully, and it was in phase II trials.<ref>{{cite journal | vauthors = Drahl C | title = Rethinking Schizophrenia | journal = Chemical & Engineering News | date = September 2008 | volume = 86 | issue= 37 | pages = 38–40 | doi = 10.1021/cen-v086n037.p038 | url = http://pubs.acs.org/cen/science/86/8637sci2.html }}</ref> |
|
|
|
|
|
|
In May 2011, ] declined to exercise its right to license the compound.<ref>{{cite news | url = http://www.fiercebiotech.com/press-releases/targacept-retain-full-rights-tc-5619-0 | title = Targacept retains full development rights for TC-5619 | work = Fierce Biotech | date = 2 May 2011 }}</ref> In September 2012, Targacept ended its development of badanicline for the purpose of treating ADHD in adults.<ref>{{cite web | url = http://www.marketwatch.com/story/targacept-ends-development-of-adhd-drug-2012-09-17 | title = Targacept ends development of ADHD drug | work = Market Watch }}</ref> It was being studied for cognitive and memory enhancement.<ref>{{cite web | url = http://www.ama-assn.org//resources/doc/usan/bradanicline.pdf | title = Statement on a Nonproprietary Name Adopted by the USAN Council | date =November 27, 2013 }}</ref> |
|
In May 2011, AstraZeneca declined to exercise its right to license the compound. |
|
|
<ref></ref> |
|
|
|
|
|
|
|
Bradanicline was discontinued for ] and cognitive impairment in schizophrenia in late-2013.<ref name="AdisInsight">{{Cite web | url=http://adisinsight.springer.com/drugs/800026693 | title=Bradanicline - Attenua | work = AdisInsight | publisher = Springer Nature Switzerland AG }}</ref> It was also discontinued for ADHD.<ref name="AdisInsight" /> |
| ⚫ |
== References == |
|
|
|
|
|
⚫ |
==References== |
|
{{Reflist|2}} |
|
{{Reflist|2}} |
|
|
|
|
|
|
|
|
{{Stimulants}} |
|
{{Stimulants}} |
|
|
|
|
{{Nootropics}} |
|
|
|
{{Nicotinic acetylcholine receptor modulators}} |
|
{{Cholinergics}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |