| Revision as of 16:08, 10 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').← Previous edit |
Latest revision as of 00:20, 10 December 2024 edit undoCitation bot (talk | contribs)Bots5,428,806 edits Alter: journal, template type. | Use this bot. Report bugs. | Suggested by Dominic3203 | Linked from User:Marbletan/sandbox | #UCB_webform_linked 773/2664 |
| (38 intermediate revisions by 26 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 396303666 |
|
| verifiedrevid = 459985078 |
|
| IUPAC_name = (''RS'')-1--4- piperazine |
|
| IUPAC_name = (''RS'')-1--4- piperazine |
|
| image = Buclizine.svg |
|
| image = Buclizine.svg |
|
| width = 280px |
|
| width = 280px |
|
| imagename = 1 : 1 mixture (racemate) |
|
| chirality = ] |
|
| drug_name = Buclizine |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|CONS|buclizine}} |
|
| Drugs.com = {{drugs.com|CONS|buclizine}} |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7134 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 82-95-1 |
|
| CAS_number = 82-95-1 |
| Line 25: |
Line 23: |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 0C94V6X681 |
|
| UNII = 0C94V6X681 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 3205 |
|
| ChEBI = 3205 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1201271 --> |
|
| ChEMBL = 1201271 |
|
|
<!--Chemical data--> |
|
| C=28 | H=33 | Cl=1 | N=2 |
|
| C=28 | H=33 | Cl=1 | N=2 |
|
| molecular_weight = 433.028 g/mol |
|
|
| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)Cc4ccc(cc4)C(C)(C)C |
|
| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)Cc4ccc(cc4)C(C)(C)C |
|
| InChI = 1/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
|
|
| InChIKey = MOYGZHXDRJNJEP-UHFFFAOYAM |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
|
| StdInChI = 1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
| Line 40: |
Line 36: |
|
}} |
|
}} |
|
|
|
|
|
'''Buclizine''' is an ] and ] of the ] derivative family. It is considered to be an ], similar to ]. |
|
'''Buclizine''' is an ] and ] of the ] group. It is considered to be an ], similar to ].<ref name="pmid22469258">{{cite book | vauthors = Mostafa GA, Al-Badr AA | title = Buclizine | journal = Profiles of Drug Substances, Excipients, and Related Methodology | volume = 36 | pages = 1–33 | year = 2011 | pmid = 22469258 | doi = 10.1016/B978-0-12-387667-6.00001-4 | series = Profiles of Drug Substances, Excipients and Related Methodology | isbn = 9780123876676 }}</ref> |
|
|
|
|
|
In the ], buclizine is one of three drugs contained in tablets, marketed by ] at ] sufferers. |
|
In the ], buclizine is one of three drugs contained in ] tablets, marketed by ] for ]s.<ref name="pmid4070325">{{cite journal | vauthors = Behrendt WA, Cserepes J | title = Acute toxicity and analgesic action of a combination of buclizine, codeine and paracetamol ('Migraleve') in tablet and suppository form in rats | journal = Pharmatherapeutica | volume = 4 | issue = 5 | pages = 322–31 | year = 1985 | pmid = 4070325 }}</ref> |
|
|
|
|
|
== See also == |
|
==References== |
|
⚫ |
{{Reflist}} |
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
|
|
{{Antihistamines}} |
|
== References == |
|
|
|
{{Histamine receptor modulators}} |
| ⚫ |
{{Reflist|2}} |
|
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
|
|
{{Cholinergics}} |
|
|
{{Histaminergics}} |
|
|
{{Piperazines}} |
|
{{Piperazines}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
{{respiratory-system-drug-stub}} |
|
{{respiratory-system-drug-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|