Misplaced Pages

Butyl PBD: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 18:08, 21 June 2011 editRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers932,073 editsm Journal cites:, added 1 Bibcode, using AWB (7751)← Previous edit Latest revision as of 21:43, 26 April 2023 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,071 editsmNo edit summary 
(14 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{Chembox {{Chembox
| Verifiedfields = changed
| verifiedrevid = 396123365 | verifiedrevid = 435499048
| ImageFile = Butyl PBD.png | ImageFile = Butyl PBD.svg
| IUPACName = 2-(4-''tert''-Butylphenyl)-5-(4-phenylphenyl)-1,3,4-oxadiazole
| OtherNames = 2-(4-''tert''-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole<br/>2-(4-Biphenylyl)-5-(4-''tert''-butylphenyl)-1,3,4-oxadiazole | PIN = 2-(-4-yl)-5-(4-''tert''-butylphenyl)-1,3,4-oxadiazole
| OtherNames = 2-(4-''tert''-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole<br/>2-(4-Biphenylyl)-5-(4-''tert''-butylphenyl)-1,3,4-oxadiazole
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| InChI=1/C24H22N2O/c1-24(2,3)21-15-13-20(14-16-21)23-26-25-22(27-23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16H,1-3H3 | InChI = 1/C24H22N2O/c1-24(2,3)21-15-13-20(14-16-21)23-26-25-22(27-23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16H,1-3H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C24H22N2O/c1-24(2,3)21-15-13-20(14-16-21)23-26-25-22(27-23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16H,1-3H3 | StdInChI = 1S/C24H22N2O/c1-24(2,3)21-15-13-20(14-16-21)23-26-25-22(27-23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16H,1-3H3
⚫ | InChIKey = XZCJVWCMJYNSQO-UHFFFAOYAT
| StdInChIKey = XZCJVWCMJYNSQO-UHFFFAOYSA-N | InChIKey = XZCJVWCMJYNSQO-UHFFFAOYAT
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | ChemSpiderID = 76483
⚫ | StdInChIKey = XZCJVWCMJYNSQO-UHFFFAOYSA-N
⚫ | SMILES = CC(C)(C)c1ccc(cc1)c2nnc(o2)c3ccc(cc3)c4ccccc4
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 76483
| PubChem = 84782
⚫ | SMILES = CC(C)(C)c1ccc(cc1)c2nnc(o2)c3ccc(cc3)c4ccccc4
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 15082-28-7 | CASNo = 15082-28-7
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | EC-number = 239-135-7
| UNII = YKR9AP6LRZ
⚫ | EC_number = 239-135-7
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>24</sub>H<sub>22</sub>N<sub>2</sub>O | Formula = C<sub>24</sub>H<sub>22</sub>N<sub>2</sub>O
| MolarMass = 354.44 g mol<sup>−1</sup> | MolarMass = 354.44 g mol<sup>−1</sup>
}} }}
}} }}


'''Butyl PBD''' or '''b-PBD''' is a ] organic compound used in the ] (LSND) at ], USA.<ref name="LSND">{{citation | title = The Liquid Scintillator Neutrino Detector and LAMPF Neutrino Source | first1 = C. | last1 = Athanassopoulos | first2 = L. B. | last2 = Auerbach | first3 = D. | last3 = Bauer | first4 = R. D. | last4 = Bolton | first5 = R. L. | last5 = Burman | first6 = I. | last6 = Cohen | first7 = D. O. | last7 = Caldwell | first8 = B. D. | last8 = Dieterle | first9 = J. B. | last9 = Donahue | first10 = A. M. | last10 = Eisner | first11 = A. | last11 = Fazely | first12 = F. J. | last12 = Federspiel | first13 = G. T. Garvey | last13 = M. Gray | first14 = R. M. | last14 = Gunasingha | first15 = V. | last15 = Highland | first16 = R. | last16 = Imlay | first17 = K. | last17 = Johnston | first18 = H. J. | last18 = Kim | first19 = W. C. | last19 = Louis | first20 = A. | last20 = Lu | first21 = J. | last21 = Margulies | first22 = G. B. | last22 = Mills | first23 = K. | last23 = McIlhany | first24 = W. | last24 = Metcalf | first25 = R. A. | last25 = Reeder | first26 = V. | last26 = Sandberg | first27 = M. | last27 = Schillaci | first28 = D. | last28 = Smith | first29 = I. | last29 = Stancu | first30 = W. | last30 = Strossman | first31 = R. | last31 = Tayloe | first32 = G. J. | last32 = Van Dalen | first33 = W. | last33 = Vernon | first34 = Y-X. | last34 = Wang | first35 = D. H. | last35 = White | first36 = D. | last36 = Whitehouse | first37 = D. | last37 = Works | first38 = Y. | last38 = Xiao | first39 = S. | last39 = Yellin | journal = Nucl. Instrum. Meth. A | volume = 388 | pages = 149–72 | year = 1997 | doi = 10.1016/S0168-9002(96)01155-2 | arxiv = nucl-ex/9605002v1 | bibcode=1997NIMPA.388..149A}}.</ref> '''Butyl PBD''' or '''b-PBD''' (short for butyl-phenyl-bipheny-oxydiazole<ref name="LSND"/>) is a ] organic compound used in the ] (LSND) at ], USA.<ref name="LSND">{{citation | title = The Liquid Scintillator Neutrino Detector and LAMPF Neutrino Source | first1 = C. | last1 = Athanassopoulos | first2 = L. B. | last2 = Auerbach | first3 = D. | last3 = Bauer | first4 = R. D. | last4 = Bolton | first5 = R. L. | last5 = Burman | first6 = I. | last6 = Cohen | first7 = D. O. | last7 = Caldwell | first8 = B. D. | last8 = Dieterle | first9 = J. B. | last9 = Donahue | first10 = A. M. | last10 = Eisner | first11 = A. | last11 = Fazely | first12 = F. J. | last12 = Federspiel | first13 = G. T. Garvey | last13 = M. Gray | first14 = R. M. | last14 = Gunasingha | first15 = V. | last15 = Highland | first16 = R. | last16 = Imlay | first17 = K. | last17 = Johnston | first18 = H. J. | last18 = Kim | first19 = W. C. | last19 = Louis | first20 = A. | last20 = Lu | first21 = J. | last21 = Margulies | first22 = G. B. | last22 = Mills | first23 = K. | last23 = McIlhany | first24 = W. | last24 = Metcalf | first25 = R. A. | last25 = Reeder | first26 = V. | last26 = Sandberg | first27 = M. | last27 = Schillaci | first28 = D. | last28 = Smith | first29 = I. | last29 = Stancu | first30 = W. | last30 = Strossman | first31 = R. | last31 = Tayloe | first32 = G. J. | last32 = Van Dalen | first33 = W. | last33 = Vernon | first34 = Y-X. | last34 = Wang | first35 = D. H. | last35 = White | first36 = D. | last36 = Whitehouse | first37 = D. | last37 = Works | first38 = Y. | last38 = Xiao | first39 = S. | last39 = Yellin | journal = Nucl. Instrum. Methods A | volume = 388 | pages = 149–72 | year = 1997 | doi = 10.1016/S0168-9002(96)01155-2 | arxiv = nucl-ex/9605002v1 | bibcode=1997NIMPA.388..149A}}.</ref>


The fluorescent emission of b-PBD is at ''λ''<sub>em</sub>&nbsp;= 364&nbsp;nm for excitation at ''λ''<sub>ex</sub>&nbsp;= 305&nbsp;nm (in ] solution).<ref>{{citation | title = B8378 2-(4-tert-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole ≥99% | url = http://www.sigmaaldrich.com/catalog/ProductDetail.do?D7=0&N5=Product%20No.|BRAND_KEY&N4=B8378|Sigma&N25=0&QS=ON&F=SPEC | publisher = Sigma-Aldrich | accessdate = 2010-05-22}}.</ref> As a ] in the LSND, it was used at a concentration of 31&nbsp;mg/l (87&nbsp;µmol/l) dissolved in ].<ref name="LSND"/> The fluorescent emission of b-PBD is at ''λ''<sub>em</sub>&nbsp;= 364&nbsp;nm for excitation at ''λ''<sub>ex</sub>&nbsp;= 305&nbsp;nm (in ] solution).<ref>{{citation | title = B8378 2-(4-tert-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole ≥99% | url = http://www.sigmaaldrich.com/catalog/ProductDetail.do?D7=0&N5=Product%20No.%7CBRAND_KEY&N4=B8378%7CSigma&N25=0&QS=ON&F=SPEC | publisher = Sigma-Aldrich | accessdate = 2010-05-22}}.</ref> As a ] in the LSND, it was used at a concentration of 31&nbsp;mg/L (87&nbsp;μmol/L) dissolved in ].<ref name="LSND"/>


==References== ==References==
Line 29: Line 36:


] ]
]