| Revision as of 22:30, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Dr← Previous edit |
Latest revision as of 15:39, 7 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Chloroarenes; added Category:3-Chlorophenyl compounds using HotCat |
| (29 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 449581210 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 451224368 |
|
| IUPAC_name = 2--6-(1-piperazinyl)pyrazine |
|
| IUPAC_name = 2--6-(1-piperazinyl)pyrazine |
|
| image = CP-809,101_structure.png |
|
| image = CP-809101 Structure.svg |
|
| width = 220 |
|
| width = 220 |
|
|
|
|
| Line 15: |
Line 18: |
|
| legal_US = |
|
| legal_US = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 22: |
Line 25: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 479683-64-2 |
|
| CAS_number = 479683-64-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = A2EXW95647 |
|
| ATC_prefix = None |
|
| ATC_prefix = None |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| PubChem = 9901086 |
|
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8076740 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=15 | H=17 | Cl=1 | N=4 | O=1 |
|
| C=15 | H=17 | Cl=1 | N=4 | O=1 |
|
| molecular_weight = 304.774 g/mol |
|
|
| smiles = C2CNCCN2c(n3)cncc3OCc(c1)cccc1Cl |
|
| smiles = C2CNCCN2c(n3)cncc3OCc(c1)cccc1Cl |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H17ClN4O/c16-13-3-1-2-12(8-13)11-21-15-10-18-9-14(19-15)20-6-4-17-5-7-20/h1-3,8-10,17H,4-7,11H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PCWGGOVOEWHPMG-UHFFFAOYSA-N |
|
|
|
|
| melting_point = |
|
| melting_point = |
|
| melting_high = |
|
| melting_high = |
|
}} |
|
}} |
|
|
|
|
|
'''CP-809,101''' is a drug which acts as a potent and selective ] ] ].<ref name="pmid19037632">{{cite journal |author=Strong PV, Greenwood BN, Fleshner M |title=The effects of the selective 5-HT(2C) receptor antagonist SB 242084 on learned helplessness in male Fischer 344 rats |journal=Psychopharmacology |volume=203 |issue=4 |pages=665–75 |year=2009 |month=May |pmid=19037632 |doi=10.1007/s00213-008-1413-3 |url=}}</ref> It had promising results in animal models of obesity and psychosis, but associated with genotoxicity which means that future use will be restricted to scientific research applications only.<ref name="pmid16949622">{{cite journal |author=Siuciak JA, Chapin DS, McCarthy SA, Guanowsky V, Brown J, Chiang P, Marala R, Patterson T, Seymour PA, Swick A, Iredale PA |title=CP-809,101, a selective 5-HT2C agonist, shows activity in animal models of antipsychotic activity |journal=Neuropharmacology |volume=52 |issue=2 |pages=279–90 |year=2007 |month=February |pmid=16949622 |doi=10.1016/j.neuropharm.2006.07.024 |url=}}</ref><ref name="pmid17344339">{{cite journal |author=Kalgutkar AS, Dalvie DK, Aubrecht J, Smith EB, Coffing SL, Cheung JR, Vage C, Lame ME, Chiang P, McClure KF, Maurer TS, Coelho RV, Soliman VF, Schildknegt K |title=Genotoxicity of 2-(3-chlorobenzyloxy)-6-(piperazinyl)pyrazine, a novel 5-hydroxytryptamine2c receptor agonist for the treatment of obesity: role of metabolic activation |journal=Drug Metabolism and Disposition: the Biological Fate of Chemicals |volume=35 |issue=6 |pages=848–58 |year=2007 |month=June |pmid=17344339 |doi=10.1124/dmd.106.013649 |url=}}</ref> |
|
'''CP-809101''' is a drug which acts as a potent and selective ] ] ].<ref name="pmid19037632">{{cite journal |vauthors=Strong PV, Greenwood BN, Fleshner M |title=The effects of the selective 5-HT(2C) receptor antagonist SB 242084 on learned helplessness in male Fischer 344 rats |journal=Psychopharmacology |volume=203 |issue=4 |pages=665–75 |date=May 2009 |pmid=19037632 |doi=10.1007/s00213-008-1413-3 |s2cid=24956531 }}</ref> It had promising results in animal models of obesity and psychosis, but associated with genotoxicity which means that future use will be restricted to scientific research applications only.<ref name="pmid16949622">{{cite journal |vauthors=Siuciak JA, Chapin DS, McCarthy SA, Guanowsky V, Brown J, Chiang P, Marala R, Patterson T, Seymour PA, Swick A, Iredale PA |title=CP-809,101, a selective 5-HT2C agonist, shows activity in animal models of antipsychotic activity |journal=Neuropharmacology |volume=52 |issue=2 |pages=279–90 |date=February 2007 |pmid=16949622 |doi=10.1016/j.neuropharm.2006.07.024 |s2cid=46489320 }}</ref><ref name="pmid17344339">{{cite journal |vauthors=Kalgutkar AS, Dalvie DK, Aubrecht J, Smith EB, Coffing SL, Cheung JR, Vage C, Lame ME, Chiang P, McClure KF, Maurer TS, Coelho RV, Soliman VF, Schildknegt K |title=Genotoxicity of 2-(3-chlorobenzyloxy)-6-(piperazinyl)pyrazine, a novel 5-hydroxytryptamine2c receptor agonist for the treatment of obesity: role of metabolic activation |journal=Drug Metabolism and Disposition |volume=35 |issue=6 |pages=848–58 |date=June 2007 |pmid=17344339 |doi=10.1124/dmd.106.013649 |s2cid=29863246 |url=http://pdfs.semanticscholar.org/72b2/41dd694746eaa4424134533804fd4a53bfd2.pdf |archive-url=https://web.archive.org/web/20190225184746/http://pdfs.semanticscholar.org/72b2/41dd694746eaa4424134533804fd4a53bfd2.pdf |url-status=dead |archive-date=2019-02-25 }}</ref> |
|
|
|
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
{{Serotonergics}} |
|
{{Serotonergics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |