| Revision as of 22:53, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbox← Previous edit |
Latest revision as of 23:17, 25 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,373 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (22 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443953677 |
|
⚫ |
| IUPAC_name = Ethoxy-''N'''-<nowiki/>{6-pyridazin-3-yl}carbohydrazide |
|
⚫ |
| image = Cadralazine.svg |
|
|
| width = 250 |
|
|
| image2 = Cadralazine-3D-spacefill.png |
|
|
| width2 = 180 |
|
|
| alt2 = Cadralazine molecule |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|cadralazine}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 64241-34-5 |
|
⚫ |
| ATC_prefix = C02 |
|
⚫ |
| ATC_suffix = DB04 |
|
⚫ |
| PubChem = 2515 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2106561 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 8T96I3U713 |
|
| UNII = 8T96I3U713 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| verifiedrevid = 443300058 |
|
|
|
| ChemSpiderID = 2420 |
| ⚫ |
| IUPAC_name = ethoxy-''N'''-{6-pyridazin-3-yl}carbohydrazide |
|
|
|
| smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1 |
| ⚫ |
| image = Cadralazine.png |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| CAS_number = 64241-34-5 |
|
|
|
| StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) |
| ⚫ |
| ATC_prefix = C02 |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| ATC_suffix = DB04 |
|
|
|
| StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N |
| ⚫ |
| PubChem = 2515 |
|
|
|
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
|
<!--Chemical data--> |
| ⚫ |
| DrugBank = |
|
|
| C=12|H=21|N=5|O=3 |
|
| C=12 | H=21 | N=5 | O=3 |
|
| molecular_weight = 283.33 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Cadralazine''' is an ] of the ] ].<ref name="pmid2083513">{{cite journal | vauthors = McTavish D, Young RA, Clissold SP | title = Cadralazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in the treatment of hypertension | journal = Drugs | volume = 40 | issue = 4 | pages = 543–60 | date = October 1990 | pmid = 2083513 | doi = 10.2165/00003495-199040040-00005 }}</ref> |
|
'''Cadralazine''' is an ] of the ] ]. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
{{Nonsympatholytic vasodilatory antihypertensives}} |
|
{{Nonsympatholytic vasodilatory antihypertensives}} |
|
{{Hydrazines}} |
|
{{Hydrazines}} |
|
|
|
|
|
⚫ |
] |
|
|
|
|
|
|
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antihypertensive-stub}} |
|
{{antihypertensive-stub}} |
|
|
|
|
] |
|