Misplaced Pages

Calcium erythorbate: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 17:42, 17 December 2010 editLuckas-bot (talk | contribs)929,662 editsm r2.5.2) (robot Adding: vi:Canxi erythorbat← Previous edit Latest revision as of 09:36, 24 November 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,763 edits chemspider 
(11 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{orphan|date=August 2010}}

{{Unreferenced|date=August 2010}}
{{chembox {{chembox
| verifiedrevid = 402888917
| Reference =
| Name = Calcium erythorbate | Reference =
| Name = Calcium erythorbate
| ImageFile = Calcium erythorbate.png | ImageFile = Calcium erythorbate.png
| ImageSize = 180px | ImageSize = 180px
| ImageName = Calcium erythorbate | ImageName = Calcium erythorbate
| IUPACName = Calcium 5-(1,2-dihydroxyethyl)-3-hydroxy -4-oxo-furan-2-olate | PIN = Calcium bis{(2''R'')-2--4-hydroxy-5-oxo-2,5-dihydrofuran-3-olate}
| OtherNames = Erythorbic acid, calcium salt; E318 | OtherNames = Erythorbic acid, calcium salt; E318
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 99552-34-8 | CASNo = 99552-34-8
| ChemSpiderID = 57566561
| SMILES = OC1=C()((O)CO)()OC1=O.OC1=C()((O)CO)()OC1=O.
| PubChem = 54737445
| EC_number = 227-261-5
| InChI=1S/2C6H8O6.Ca/c2*7-1-2(8)5-3(9)4(10)6(11)12-5;/h2*2,5,7-10H,1H2;/q;;+2/p-2
| InChIKey = BLORRZQTHNGFTI-UHFFFAOYSA-L
| SMILES = OC1=C()((O)CO)()OC1=O.OC1=C()((O)CO)()OC1=O.
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| Formula = Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub> | Formula = Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub>
| MolarMass = 390.31 | MolarMass = 390.31 g/mol
| Appearance = | Appearance =
| Density = | Density =
| Solubility = | Solubility =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
}} }}
| Section7 = {{Chembox Hazards |Section7={{Chembox Hazards
| ExternalMSDS = | ExternalSDS =
| MainHazards = | MainHazards =
}} }}
}} }}


'''Calcium erythorbate''' is a food additive. Chemically, it is the ] ] of ], with the chemical formula Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub>. As an ] structurally related to ], it helps improve flavor stability and prevents the formation of ]ic ]s. '''Calcium erythorbate''' is a food additive.<ref>{{Cite book |last1=Hui |first1=Y. H. |url=https://books.google.com/books?id=Vu8gsgLeW-YC |title=Handbook of Fruits and Fruit Processing |last2=Barta |first2=József |last3=Cano |first3=M. Pilar |last4=Gusek |first4=Todd W. |last5=Sidhu |first5=Jiwan S. |last6=Sinha |first6=Nirmal K. |date=2008-02-28 |publisher=John Wiley & Sons |isbn=978-0-470-27648-8 |pages=276 |language=en}}</ref> Chemically, it is the ] ] of ], with the chemical formula Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub>. As an ] structurally related to ], it helps improve flavor stability and prevents the formation of ]ic ]s.


==References== ==References==
{{Reflist}} {{Reflist}}


{{DEFAULTSORT:Calcium Erythorbate}} {{Calcium compounds}}

] ]
] ]
Line 41: Line 45:


{{organic-compound-stub}} {{organic-compound-stub}}

]